|
Name |
Isorhapontigenin
|
| Molecular Formula | C15H14O4 | |
| IUPAC Name* |
5-[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]benzene-1,3-diol
|
|
| SMILES |
COC1=C(C=CC(=C1)/C=C/C2=CC(=CC(=C2)O)O)O
|
|
| InChI |
InChI=1S/C15H14O4/c1-19-15-8-10(4-5-14(15)18)2-3-11-6-12(16)9-13(17)7-11/h2-9,16-18H,1H3/b3-2+
|
|
| InChIKey |
ANNNBEZJTNCXHY-NSCUHMNNSA-N
|
|
| Synonyms |
Isorhapontigenin; 32507-66-7; Isorhapotogenin; 5-[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]benzene-1,3-diol; CZ49V3K5HS; (E)-5-(4-hydroxy-3-methoxystyryl)benzene-1,3-diol; 5-[2-(4-Hydroxy-3-methoxyphenyl)ethenyl]-1,3-benzenediol; 20767-15-1; 3'-methoxy-resveratrol; 5-((1E)-2-(4-HYDROXY-3-METHOXYPHENYL)ETHENYL)-1,3-BENZENEDIOL; 5-[(1E)-2-(4-HYDROXY-3-METHOXYPHENYL)ETHENYL]-1,3-BENZENEDIOL; ISOR; 3'-Methoxyresveratrol; UNII-CZ49V3K5HS; CHEMBL110370; MEGxp0_001015; SCHEMBL13004148; SCHEMBL14782177; ACon1_000713; CHEBI:167830; DTXSID601045304; 5-[(E)-2-(4-hydroxy-3-methoxy-phenyl)vinyl]benzene-1,3-diol; AMY40659; HY-N2593; 1,3-Benzenediol, 5-[(1E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]-; MFCD12407151; ZINC13541228; AKOS015915135; AC-7023; NCGC00169431-01; AS-49334; CS-0022945; I0804; 3,5,4'-trihydroxy-3'-methoxy-trans-stilbene; 3,4',5-Trihydroxy-3'-methoxy-trans-stilbene; H10554; 5-(4-Hydroxy-3-methoxystyryl)benzene-1,3-diol; 507I667; A821305; Q6086299; 3,4',5-STILBENETRIOL, 3'-METHOXY-, (E)-; 1,3-Benzenediol, 5-[2-(4-hydroxy-3-methoxyphenyl)ethenyl]-; 1,3-BENZENEDIOL, 5-(2-(4-HYDROXY-3-METHOXYPHENYL)ETHENYL)-, (E)-; NCGC00169431-02!5-[(E)-2-(4-hydroxy-3-methoxyphenyl)ethenyl]benzene-1,3-diol
|
|
| CAS | 32507-66-7 | |
| PubChem CID | 5318650 | |
| ChEMBL ID | CHEMBL110370 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 258.27 | ALogp: | 3.2 |
| HBD: | 3 | HBA: | 4 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 69.9 | Aromatic Rings: | 2 |
| Heavy Atoms: | 19 | QED Weighted: | 0.733 |
| Caco-2 Permeability: | -4.978 | MDCK Permeability: | 0.00001470 |
| Pgp-inhibitor: | 0.093 | Pgp-substrate: | 0.608 |
| Human Intestinal Absorption (HIA): | 0.012 | 20% Bioavailability (F20%): | 0.125 |
| 30% Bioavailability (F30%): | 0.181 |
| Blood-Brain-Barrier Penetration (BBB): | 0.033 | Plasma Protein Binding (PPB): | 98.00% |
| Volume Distribution (VD): | 0.603 | Fu: | 1.71% |
| CYP1A2-inhibitor: | 0.971 | CYP1A2-substrate: | 0.871 |
| CYP2C19-inhibitor: | 0.148 | CYP2C19-substrate: | 0.062 |
| CYP2C9-inhibitor: | 0.295 | CYP2C9-substrate: | 0.938 |
| CYP2D6-inhibitor: | 0.443 | CYP2D6-substrate: | 0.923 |
| CYP3A4-inhibitor: | 0.896 | CYP3A4-substrate: | 0.168 |
| Clearance (CL): | 13.944 | Half-life (T1/2): | 0.931 |
| hERG Blockers: | 0.086 | Human Hepatotoxicity (H-HT): | 0.306 |
| Drug-inuced Liver Injury (DILI): | 0.047 | AMES Toxicity: | 0.082 |
| Rat Oral Acute Toxicity: | 0.227 | Maximum Recommended Daily Dose: | 0.718 |
| Skin Sensitization: | 0.957 | Carcinogencity: | 0.218 |
| Eye Corrosion: | 0.026 | Eye Irritation: | 0.947 |
| Respiratory Toxicity: | 0.691 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003688 | ![]() |
0.710 | D07MGA | ![]() |
0.373 | ||
| ENC001097 | ![]() |
0.629 | D07EXH | ![]() |
0.351 | ||
| ENC001848 | ![]() |
0.563 | D0E9CD | ![]() |
0.339 | ||
| ENC002581 | ![]() |
0.521 | D04AIT | ![]() |
0.337 | ||
| ENC001101 | ![]() |
0.468 | D0V9EN | ![]() |
0.333 | ||
| ENC002499 | ![]() |
0.452 | D04XEG | ![]() |
0.326 | ||
| ENC003636 | ![]() |
0.442 | D0AZ8C | ![]() |
0.313 | ||
| ENC000027 | ![]() |
0.431 | D0E6OC | ![]() |
0.304 | ||
| ENC000068 | ![]() |
0.431 | D0K8KX | ![]() |
0.299 | ||
| ENC005410 | ![]() |
0.429 | D06GCK | ![]() |
0.284 | ||