![]() |
Name |
Aloesol
|
Molecular Formula | C13H14O4 | |
IUPAC Name* |
7-hydroxy-2-(2-hydroxypropyl)-5-methylchromen-4-one
|
|
SMILES |
CC1=CC(=CC2=C1C(=O)C=C(O2)CC(C)O)O
|
|
InChI |
InChI=1S/C13H14O4/c1-7-3-9(15)5-12-13(7)11(16)6-10(17-12)4-8(2)14/h3,5-6,8,14-15H,4H2,1-2H3
|
|
InChIKey |
ZYCNQWOKCMJKEZ-UHFFFAOYSA-N
|
|
Synonyms |
Aloesol; dl-Aloesol; 104871-04-7; 7-hydroxy-2-(2-hydroxypropyl)-5-methylchromen-4-one; 94356-35-1; CHEBI:174202; J3.656.657D; 7-hydroxy-2-(2-hydroxypropyl)-5-methylchromone; 2-(2'-hydroxypropyl)-5-methyl-7-hydroxychromone; 7-hydroxy-2-(2-hydroxypropyl)-5-methyl-4H-chromen-4-one; 2-(2-Hydroxypropyl)-5-methyl-7-hydroxy-4H-1-benzopyran-4-one; 7-Hydroxy-2-(2-hydroxypropyl)-5-methyl-4H-1-benzopyran-4-one, 9CI
|
|
CAS | 94356-35-1 | |
PubChem CID | 5318230 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 234.25 | ALogp: | 1.6 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 17 | QED Weighted: | 0.836 |
Caco-2 Permeability: | -4.852 | MDCK Permeability: | 0.00001200 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.996 |
Human Intestinal Absorption (HIA): | 0.021 | 20% Bioavailability (F20%): | 0.466 |
30% Bioavailability (F30%): | 0.982 |
Blood-Brain-Barrier Penetration (BBB): | 0.036 | Plasma Protein Binding (PPB): | 80.32% |
Volume Distribution (VD): | 0.948 | Fu: | 28.93% |
CYP1A2-inhibitor: | 0.973 | CYP1A2-substrate: | 0.934 |
CYP2C19-inhibitor: | 0.407 | CYP2C19-substrate: | 0.376 |
CYP2C9-inhibitor: | 0.347 | CYP2C9-substrate: | 0.933 |
CYP2D6-inhibitor: | 0.232 | CYP2D6-substrate: | 0.845 |
CYP3A4-inhibitor: | 0.153 | CYP3A4-substrate: | 0.404 |
Clearance (CL): | 9.534 | Half-life (T1/2): | 0.756 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.137 |
Drug-inuced Liver Injury (DILI): | 0.146 | AMES Toxicity: | 0.246 |
Rat Oral Acute Toxicity: | 0.055 | Maximum Recommended Daily Dose: | 0.538 |
Skin Sensitization: | 0.398 | Carcinogencity: | 0.057 |
Eye Corrosion: | 0.007 | Eye Irritation: | 0.782 |
Respiratory Toxicity: | 0.159 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006070 | ![]() |
1.000 | D04AIT | ![]() |
0.351 | ||
ENC005306 | ![]() |
1.000 | D0K8KX | ![]() |
0.309 | ||
ENC005305 | ![]() |
0.695 | D02UFG | ![]() |
0.303 | ||
ENC003990 | ![]() |
0.695 | D06GCK | ![]() |
0.292 | ||
ENC006121 | ![]() |
0.695 | D0M8RC | ![]() |
0.275 | ||
ENC001618 | ![]() |
0.673 | D0FA2O | ![]() |
0.274 | ||
ENC001617 | ![]() |
0.647 | D04XEG | ![]() |
0.259 | ||
ENC005179 | ![]() |
0.643 | D0O6KE | ![]() |
0.258 | ||
ENC006074 | ![]() |
0.579 | D0G4KG | ![]() |
0.253 | ||
ENC001569 | ![]() |
0.559 | D07EXH | ![]() |
0.250 |