|
Name |
7-Hydroxy-2,5-dimethyl-4H-1-benzopyran-4-one
|
| Molecular Formula | C11H10O3 | |
| IUPAC Name* |
7-hydroxy-2,5-dimethylchromen-4-one
|
|
| SMILES |
CC1=CC(=CC2=C1C(=O)C=C(O2)C)O
|
|
| InChI |
InChI=1S/C11H10O3/c1-6-3-8(12)5-10-11(6)9(13)4-7(2)14-10/h3-5,12H,1-2H3
|
|
| InChIKey |
CRNGFKXWIYTEPH-UHFFFAOYSA-N
|
|
| Synonyms |
Altechromone A; 38412-47-4; 7-Hydroxy-2,5-dimethyl-4H-1-benzopyran-4-one; 7-hydroxy-2,5-dimethylchromen-4-one; 2,5Dimethyl7hydroxy chromone; 2,5-dimethyl-7-hydroxychromone; 4H-1-Benzopyran-4-one, 7-hydroxy-2,5-dimethyl-; 7-Hydroxy-2,5-dimethyl-4H-chromen-4-one; 68L85KAC8Q; CHEMBL509319; 7-hydroxy-2,5-dimethylchromone; SCHEMBL18096537; DTXSID20415713; 2,5-Dimethyl-7-hydroxychromenone; CHEBI:173911; ZINC14447816; 7-Hydroxy-2,5-dimethyl-4H-chromone; 2,5-Dimethyl-7-oxidanyl-chromen-4-one; 7-Hydroxy-2,5-dimethyl-4H-chromen-4-one #; Q4736228
|
|
| CAS | 38412-47-4 | |
| PubChem CID | 5316891 | |
| ChEMBL ID | CHEMBL509319 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 190.19 | ALogp: | 1.9 |
| HBD: | 1 | HBA: | 3 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 46.5 | Aromatic Rings: | 2 |
| Heavy Atoms: | 14 | QED Weighted: | 0.694 |
| Caco-2 Permeability: | -4.726 | MDCK Permeability: | 0.00001380 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.997 |
| Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.72 |
| 30% Bioavailability (F30%): | 0.989 |
| Blood-Brain-Barrier Penetration (BBB): | 0.041 | Plasma Protein Binding (PPB): | 86.09% |
| Volume Distribution (VD): | 0.825 | Fu: | 17.83% |
| CYP1A2-inhibitor: | 0.979 | CYP1A2-substrate: | 0.942 |
| CYP2C19-inhibitor: | 0.554 | CYP2C19-substrate: | 0.338 |
| CYP2C9-inhibitor: | 0.251 | CYP2C9-substrate: | 0.923 |
| CYP2D6-inhibitor: | 0.495 | CYP2D6-substrate: | 0.896 |
| CYP3A4-inhibitor: | 0.245 | CYP3A4-substrate: | 0.267 |
| Clearance (CL): | 7.377 | Half-life (T1/2): | 0.76 |
| hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.091 |
| Drug-inuced Liver Injury (DILI): | 0.357 | AMES Toxicity: | 0.437 |
| Rat Oral Acute Toxicity: | 0.059 | Maximum Recommended Daily Dose: | 0.868 |
| Skin Sensitization: | 0.747 | Carcinogencity: | 0.113 |
| Eye Corrosion: | 0.319 | Eye Irritation: | 0.983 |
| Respiratory Toxicity: | 0.477 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003365 | ![]() |
0.681 | D04AIT | ![]() |
0.371 | ||
| ENC006074 | ![]() |
0.673 | D0FA2O | ![]() |
0.371 | ||
| ENC001620 | ![]() |
0.647 | D0G4KG | ![]() |
0.338 | ||
| ENC001618 | ![]() |
0.647 | D0K8KX | ![]() |
0.324 | ||
| ENC005932 | ![]() |
0.647 | D06GCK | ![]() |
0.305 | ||
| ENC005306 | ![]() |
0.647 | D07EXH | ![]() |
0.265 | ||
| ENC006070 | ![]() |
0.647 | D0S5CH | ![]() |
0.258 | ||
| ENC001518 | ![]() |
0.592 | D0N0OU | ![]() |
0.255 | ||
| ENC005178 | ![]() |
0.583 | D07MGA | ![]() |
0.253 | ||
| ENC003990 | ![]() |
0.559 | D0O6KE | ![]() |
0.253 | ||