|
Name |
Valencene
|
| Molecular Formula | C15H24 | |
| IUPAC Name* |
(3R,4aS,5R)-4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene
|
|
| SMILES |
C[C@@H]1CCC=C2[C@]1(C[C@@H](CC2)C(=C)C)C
|
|
| InChI |
InChI=1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h7,12-13H,1,5-6,8-10H2,2-4H3/t12-,13-,15+/m1/s1
|
|
| InChIKey |
QEBNYNLSCGVZOH-NFAWXSAZSA-N
|
|
| Synonyms |
Valencene; (+)-Valencene; 4630-07-3; Valencen; Valencene (natural); (3R,4aS,5R)-4a,5-dimethyl-3-(prop-1-en-2-yl)-1,2,3,4,4a,5,6,7-octahydronaphthalene; FEMA No. 3443; CHEBI:61700; 96H21P91IG; ent-7betaH-eremophila-10(1),11-diene; (+)-Valencene 1000 microg/mL in Isopropanol; (1R-(1alpha,7beta,8alpha))-1,2,3,5,6,7,8,8a-Octahydro-1,8a-dimethyl-7-(1-methylvinyl)naphthalene; (3R,4aS,5R)-4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7-hexahydro-1H-naphthalene; Naphthalene, 1,2,3,5,6,7,8,8a-octahydro-1,8a-dimethyl-7-(1-methylethenyl)-, (1R,7R,8aS)-; NSC-148969; (3R,4aS,5R)-4a,5-Dimethyl-3-isopropenyl-1,2,3,4,4a,5,6,7-octahydronaphthalene; (A+/-)-valencene; 4.beta.H,5.alpha.-Eremophila-1(10),11-diene; VALENCENE [FHFI]; VALENCENE [INCI]; DSSTox_CID_27052; DSSTox_RID_82070; DSSTox_GSID_47052; UNII-96H21P91IG; Valencene, natural, >=65%; CHEMBL3186909; DTXSID8047052; (+)-Valencene, analytical standard; HY-N6636; NAPHTHALENE, 1,2,3,5,6,7,8,8A-OCTAHYDRO-1,8A-DIMETHYL-7-(1-METHYLETHENYL)-, (1R-(1.ALPHA.,7.BETA.,8A.ALPHA.))-; ZINC1734352; EINECS 225-047-6; Tox21_302397; MFCD00075884; (+)-Valencene, technical, >=70%; NSC 148969; NCGC00256249-01; CAS-4630-07-3; 4Betah,5alpha-eremophila-1(10),11-diene; CS-0044199; C17277; F71379; Q289496; 4alpha,10alpha-Dimethyl-6beta-isopropyl-delta1,9-octalin; 4alpha,10alpha-Dimethyl-6beta-isopropyl-.DELTA.1,9-octalin; 1,2,3,5,6,7,8,8a-Octahydro-1,8A-dimethyl-7-(1-methylethenyl)naphthalene, (1R-(1alpha,7beta,8aalpha))-; Naphthalene, 1,2,3,5,6,7,8,8A-octahydro-1,8A-dimethyl-7-(1-methylethenyl)-, (1R-(1alpha,7beta,8aalpha))-
|
|
| CAS | 4630-07-3 | |
| PubChem CID | 9855795 | |
| ChEMBL ID | CHEMBL3186909 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 204.35 | ALogp: | 5.2 |
| HBD: | 0 | HBA: | 0 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 0.0 | Aromatic Rings: | 2 |
| Heavy Atoms: | 15 | QED Weighted: | 0.518 |
| Caco-2 Permeability: | -4.543 | MDCK Permeability: | 0.00001680 |
| Pgp-inhibitor: | 0.504 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.806 |
| 30% Bioavailability (F30%): | 0.044 |
| Blood-Brain-Barrier Penetration (BBB): | 0.099 | Plasma Protein Binding (PPB): | 94.58% |
| Volume Distribution (VD): | 2.921 | Fu: | 3.77% |
| CYP1A2-inhibitor: | 0.637 | CYP1A2-substrate: | 0.746 |
| CYP2C19-inhibitor: | 0.375 | CYP2C19-substrate: | 0.935 |
| CYP2C9-inhibitor: | 0.284 | CYP2C9-substrate: | 0.701 |
| CYP2D6-inhibitor: | 0.197 | CYP2D6-substrate: | 0.855 |
| CYP3A4-inhibitor: | 0.738 | CYP3A4-substrate: | 0.309 |
| Clearance (CL): | 6.842 | Half-life (T1/2): | 0.141 |
| hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.237 |
| Drug-inuced Liver Injury (DILI): | 0.198 | AMES Toxicity: | 0.027 |
| Rat Oral Acute Toxicity: | 0.031 | Maximum Recommended Daily Dose: | 0.919 |
| Skin Sensitization: | 0.548 | Carcinogencity: | 0.744 |
| Eye Corrosion: | 0.929 | Eye Irritation: | 0.98 |
| Respiratory Toxicity: | 0.656 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001832 | ![]() |
1.000 | D07BSQ | ![]() |
0.265 | ||
| ENC001829 | ![]() |
0.673 | D04SFH | ![]() |
0.253 | ||
| ENC001834 | ![]() |
0.439 | D0B4RU | ![]() |
0.250 | ||
| ENC005063 | ![]() |
0.435 | D0Z1XD | ![]() |
0.244 | ||
| ENC005064 | ![]() |
0.435 | D0I2SD | ![]() |
0.239 | ||
| ENC002392 | ![]() |
0.414 | D0G8BV | ![]() |
0.235 | ||
| ENC001836 | ![]() |
0.414 | D0F1UL | ![]() |
0.235 | ||
| ENC001078 | ![]() |
0.403 | D06XMU | ![]() |
0.235 | ||
| ENC002990 | ![]() |
0.390 | D0K0EK | ![]() |
0.235 | ||
| ENC003255 | ![]() |
0.390 | D02CJX | ![]() |
0.234 | ||