![]() |
Name |
4-Chlorophenoxyacetate
|
Molecular Formula | C8H6ClO3- | |
IUPAC Name* |
2-(4-chlorophenoxy)acetate
|
|
SMILES |
C1=CC(=CC=C1OCC(=O)[O-])Cl
|
|
InChI |
InChI=1S/C8H7ClO3/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5H2,(H,10,11)/p-1
|
|
InChIKey |
SODPIMGUZLOIPE-UHFFFAOYSA-M
|
|
Synonyms |
4-Chlorophenoxyacetate; (4-chlorophenoxy)acetate; 2-(4-chlorophenoxy)acetate; CHEBI:28739; DTXSID501265620; Acetic acid, 2-(4-chlorophenoxy)-, ion(1-); Q27103874; 13673-91-1
|
|
CAS | 13673-91-1 | |
PubChem CID | 3794534 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 185.58 | ALogp: | 2.9 |
HBD: | 0 | HBA: | 3 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 49.4 | Aromatic Rings: | 1 |
Heavy Atoms: | 12 | QED Weighted: | 0.702 |
Caco-2 Permeability: | -4.728 | MDCK Permeability: | 0.00003620 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.001 |
Blood-Brain-Barrier Penetration (BBB): | 0.335 | Plasma Protein Binding (PPB): | 95.17% |
Volume Distribution (VD): | 0.175 | Fu: | 3.92% |
CYP1A2-inhibitor: | 0.096 | CYP1A2-substrate: | 0.212 |
CYP2C19-inhibitor: | 0.048 | CYP2C19-substrate: | 0.101 |
CYP2C9-inhibitor: | 0.041 | CYP2C9-substrate: | 0.929 |
CYP2D6-inhibitor: | 0.012 | CYP2D6-substrate: | 0.241 |
CYP3A4-inhibitor: | 0.005 | CYP3A4-substrate: | 0.153 |
Clearance (CL): | 5.21 | Half-life (T1/2): | 0.886 |
hERG Blockers: | 0.035 | Human Hepatotoxicity (H-HT): | 0.21 |
Drug-inuced Liver Injury (DILI): | 0.946 | AMES Toxicity: | 0.014 |
Rat Oral Acute Toxicity: | 0.161 | Maximum Recommended Daily Dose: | 0.011 |
Skin Sensitization: | 0.204 | Carcinogencity: | 0.42 |
Eye Corrosion: | 0.308 | Eye Irritation: | 0.952 |
Respiratory Toxicity: | 0.093 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000106 | ![]() |
0.408 | D0VB0U | ![]() |
0.510 | ||
ENC001676 | ![]() |
0.404 | D0J5DC | ![]() |
0.462 | ||
ENC000785 | ![]() |
0.385 | D01AJY | ![]() |
0.392 | ||
ENC001364 | ![]() |
0.375 | D06CDO | ![]() |
0.347 | ||
ENC001358 | ![]() |
0.370 | D02HXS | ![]() |
0.345 | ||
ENC000201 | ![]() |
0.370 | D00BCP | ![]() |
0.339 | ||
ENC001338 | ![]() |
0.353 | D0NF1U | ![]() |
0.329 | ||
ENC003949 | ![]() |
0.351 | D0W5UV | ![]() |
0.313 | ||
ENC005266 | ![]() |
0.351 | D01HKL | ![]() |
0.310 | ||
ENC005265 | ![]() |
0.351 | D06OAV | ![]() |
0.309 |