![]() |
Name |
2-(4-Chlorophenoxy)-5-nitrobenzoic acid
|
Molecular Formula | C13H8ClNO5 | |
IUPAC Name* |
2-(4-chlorophenoxy)-5-nitrobenzoic acid
|
|
SMILES |
C1=CC(=CC=C1OC2=C(C=C(C=C2)[N+](=O)[O-])C(=O)O)Cl
|
|
InChI |
InChI=1S/C13H8ClNO5/c14-8-1-4-10(5-2-8)20-12-6-3-9(15(18)19)7-11(12)13(16)17/h1-7H,(H,16,17)
|
|
InChIKey |
WEVXAYQQNCIIIY-UHFFFAOYSA-N
|
|
Synonyms |
2-(4-Chlorophenoxy)-5-nitrobenzoic acid; Benzoic acid, 2-(4-chlorophenoxy)-5-nitro-; SCHEMBL9097065; AKOS000263691; 2-(4-Chlorophenoxy)-5-nitrobenzoic acid #
|
|
CAS | NA | |
PubChem CID | 597187 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 293.66 | ALogp: | 3.6 |
HBD: | 1 | HBA: | 5 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 92.4 | Aromatic Rings: | 2 |
Heavy Atoms: | 20 | QED Weighted: | 0.665 |
Caco-2 Permeability: | -4.617 | MDCK Permeability: | 0.00004440 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.006 | 20% Bioavailability (F20%): | 0.001 |
30% Bioavailability (F30%): | 0.001 |
Blood-Brain-Barrier Penetration (BBB): | 0.287 | Plasma Protein Binding (PPB): | 99.84% |
Volume Distribution (VD): | 0.205 | Fu: | 0.87% |
CYP1A2-inhibitor: | 0.422 | CYP1A2-substrate: | 0.093 |
CYP2C19-inhibitor: | 0.36 | CYP2C19-substrate: | 0.059 |
CYP2C9-inhibitor: | 0.613 | CYP2C9-substrate: | 0.287 |
CYP2D6-inhibitor: | 0.609 | CYP2D6-substrate: | 0.148 |
CYP3A4-inhibitor: | 0.042 | CYP3A4-substrate: | 0.146 |
Clearance (CL): | 0.78 | Half-life (T1/2): | 0.471 |
hERG Blockers: | 0.414 | Human Hepatotoxicity (H-HT): | 0.871 |
Drug-inuced Liver Injury (DILI): | 0.969 | AMES Toxicity: | 0.966 |
Rat Oral Acute Toxicity: | 0.822 | Maximum Recommended Daily Dose: | 0.498 |
Skin Sensitization: | 0.658 | Carcinogencity: | 0.776 |
Eye Corrosion: | 0.004 | Eye Irritation: | 0.737 |
Respiratory Toxicity: | 0.933 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC004474 | ![]() |
0.378 | D0J9ZR | ![]() |
0.455 | ||
ENC001510 | ![]() |
0.375 | D0NF1U | ![]() |
0.402 | ||
ENC000117 | ![]() |
0.342 | D0R1RS | ![]() |
0.378 | ||
ENC001324 | ![]() |
0.329 | D00WCX | ![]() |
0.363 | ||
ENC001381 | ![]() |
0.315 | D0CP4E | ![]() |
0.345 | ||
ENC000034 | ![]() |
0.308 | D00CSQ | ![]() |
0.342 | ||
ENC005996 | ![]() |
0.289 | D0O5LA | ![]() |
0.337 | ||
ENC000793 | ![]() |
0.286 | D07XGR | ![]() |
0.337 | ||
ENC000122 | ![]() |
0.286 | D01HKL | ![]() |
0.333 | ||
ENC000209 | ![]() |
0.284 | D0YB1G | ![]() |
0.326 |