|
Name |
Ethyl sorbate
|
| Molecular Formula | C8H12O2 | |
| IUPAC Name* |
ethyl (2E,4E)-hexa-2,4-dienoate
|
|
| SMILES |
CCOC(=O)/C=C/C=C/C
|
|
| InChI |
InChI=1S/C8H12O2/c1-3-5-6-7-8(9)10-4-2/h3,5-7H,4H2,1-2H3/b5-3+,7-6+
|
|
| InChIKey |
OZZYKXXGCOLLLO-TWTPFVCWSA-N
|
|
| Synonyms |
ETHYL SORBATE; 2396-84-1; Ethyl 2,4-hexadienoate; Ethyl hexa-2,4-dienoate; Sorbic acid, ethyl ester; 2,4-Hexadienoic acid, ethyl ester; ethyl (2E,4E)-hexa-2,4-dienoate; 2,4-Hexadienoic acid, ethyl ester, (2E,4E)-; FEMA No. 2459; Sorbic Acid Ethyl Ester; Ethyl (E,E)-2,4-hexadienoate; Hexa-2,4-dienoic acid ethyl ester; HSR16USG4D; Ethyl (2E,4E)-2,4-hexadienoate; Ethyl trans,trans-2,4-hexadienoate; NSC-8874; (2E,4E)-ethyl hexa-2,4-dienoate; 2,4-Hexadienoic acid, ethyl ester, (E,E)-); ethylsorbate; NSC 8874; Ethyl 2,4-hexadienoate, (E,E)-; EINECS 219-258-2; UNII-HSR16USG4D; AI3-11732; MFCD00009296; 2,4-Hexadienoic acid, ethyl ester, (E,E)-; Ethyl sorbate, 98%; ETHYL SORBATE [FHFI]; SCHEMBL345935; CHEMBL398921; Ethyl sorbate, >=97%, FG; (E,E)-Ethyl 2,4-hexadienoate; CHEBI:72819; FEMA 2459; OZZYKXXGCOLLLO-TWTPFVCWSA-; DTXSID80883712; NSC8874; CAA39684; ZINC1648290; LMFA07010882; AKOS015915299; CS-W014374; (4E)-2,4-Hexadienoic acid ethyl ester; Ethyl ester(E,E)-2,4-Hexadienoic acid; AS-56445; LS-13455; 2,4-Hexadienoic acid, ethyl ester (9CI); Ethyl ester(2E,4E)-2,4-Hexadienoic acid; S0055; trans,trans-hexa-2,4-dienoic acid ethyl ester; (E,E)-2,4-HEXADIENOIC ACID ETHYL ESTER; A817011; W-107365; 2,4-Hexadienoic acid, ethyl ester, (E,E)- (9CI); Ethyl 2,4-dimethyl-2,4-hexadienoate, not E,E, # 1; Q27140166
|
|
| CAS | 2396-84-1 | |
| PubChem CID | 1550470 | |
| ChEMBL ID | CHEMBL398921 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 140.18 | ALogp: | 1.9 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
| Heavy Atoms: | 10 | QED Weighted: | 0.341 |
| Caco-2 Permeability: | -4.289 | MDCK Permeability: | 0.00002870 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.003 |
| Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.863 |
| 30% Bioavailability (F30%): | 0.959 |
| Blood-Brain-Barrier Penetration (BBB): | 0.994 | Plasma Protein Binding (PPB): | 75.79% |
| Volume Distribution (VD): | 1.015 | Fu: | 27.12% |
| CYP1A2-inhibitor: | 0.864 | CYP1A2-substrate: | 0.816 |
| CYP2C19-inhibitor: | 0.297 | CYP2C19-substrate: | 0.88 |
| CYP2C9-inhibitor: | 0.075 | CYP2C9-substrate: | 0.598 |
| CYP2D6-inhibitor: | 0.02 | CYP2D6-substrate: | 0.792 |
| CYP3A4-inhibitor: | 0.02 | CYP3A4-substrate: | 0.328 |
| Clearance (CL): | 8.402 | Half-life (T1/2): | 0.768 |
| hERG Blockers: | 0.04 | Human Hepatotoxicity (H-HT): | 0.335 |
| Drug-inuced Liver Injury (DILI): | 0.032 | AMES Toxicity: | 0.317 |
| Rat Oral Acute Toxicity: | 0.942 | Maximum Recommended Daily Dose: | 0.859 |
| Skin Sensitization: | 0.962 | Carcinogencity: | 0.678 |
| Eye Corrosion: | 0.865 | Eye Irritation: | 0.935 |
| Respiratory Toxicity: | 0.915 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000415 | ![]() |
0.655 | D0B1IP | ![]() |
0.244 | ||
| ENC001733 | ![]() |
0.543 | D0A7MY | ![]() |
0.233 | ||
| ENC001698 | ![]() |
0.459 | D02CKX | ![]() |
0.229 | ||
| ENC002842 | ![]() |
0.404 | D0T3NY | ![]() |
0.214 | ||
| ENC001725 | ![]() |
0.400 | D0ZK8H | ![]() |
0.205 | ||
| ENC000312 | ![]() |
0.355 | D0Q8ZX | ![]() |
0.200 | ||
| ENC001421 | ![]() |
0.353 | D0J5DC | ![]() |
0.186 | ||
| ENC001556 | ![]() |
0.351 | D0G2MW | ![]() |
0.185 | ||
| ENC002687 | ![]() |
0.329 | D03ZFG | ![]() |
0.183 | ||
| ENC001578 | ![]() |
0.327 | D0Q9HF | ![]() |
0.182 | ||