|
Name |
1-[3-(3,4,5-Trimethoxyphenyl)propanoyl]-2,3-dihydropyridin-6-one
|
| Molecular Formula | C17H21NO5 | |
| IUPAC Name* |
1-[3-(3,4,5-trimethoxyphenyl)propanoyl]-2,3-dihydropyridin-6-one
|
|
| SMILES |
COC1=CC(=CC(=C1OC)OC)CCC(=O)N2CCC=CC2=O
|
|
| InChI |
InChI=1S/C17H21NO5/c1-21-13-10-12(11-14(22-2)17(13)23-3)7-8-16(20)18-9-5-4-6-15(18)19/h4,6,10-11H,5,7-9H2,1-3H3
|
|
| InChIKey |
WAGZSQGCUXDBOA-UHFFFAOYSA-N
|
|
| Synonyms |
Dihydropiplartine; 8,9-DIHYDROPIPLARTINE; 1-[3-(3,4,5-trimethoxyphenyl)propanoyl]-2,3-dihydropyridin-6-one; 1-(3-(3,4,5-Trimethoxyphenyl)propanoyl)-5,6-dihydropyridin-2(1H)-one; 137760-69-1; CHEMBL2260448; SCHEMBL15422095; ACon1_001503; BRD1177; CHEBI:182635; BRD-1177; NCGC00180438-01; BRD-K26531177-001-01-4; 1-[3-(3,4,5-Trimethoxyphenyl)propanoyl]-5,6-dihydro-2(1H)-pyridinone #; Propan-1-one, 3-(3,4,5-trimethoxyphenyl)-1-(2,3-dihydropyridin-5(1H)-one-1-yl)-
|
|
| CAS | NA | |
| PubChem CID | 613753 | |
| ChEMBL ID | CHEMBL2260448 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 319.4 | ALogp: | 1.9 |
| HBD: | 0 | HBA: | 5 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 65.1 | Aromatic Rings: | 2 |
| Heavy Atoms: | 23 | QED Weighted: | 0.806 |
| Caco-2 Permeability: | -4.573 | MDCK Permeability: | 0.00002270 |
| Pgp-inhibitor: | 0.077 | Pgp-substrate: | 0.011 |
| Human Intestinal Absorption (HIA): | 0.007 | 20% Bioavailability (F20%): | 0.006 |
| 30% Bioavailability (F30%): | 0.18 |
| Blood-Brain-Barrier Penetration (BBB): | 0.992 | Plasma Protein Binding (PPB): | 63.55% |
| Volume Distribution (VD): | 0.444 | Fu: | 25.26% |
| CYP1A2-inhibitor: | 0.326 | CYP1A2-substrate: | 0.858 |
| CYP2C19-inhibitor: | 0.486 | CYP2C19-substrate: | 0.849 |
| CYP2C9-inhibitor: | 0.34 | CYP2C9-substrate: | 0.774 |
| CYP2D6-inhibitor: | 0.06 | CYP2D6-substrate: | 0.457 |
| CYP3A4-inhibitor: | 0.565 | CYP3A4-substrate: | 0.503 |
| Clearance (CL): | 9.025 | Half-life (T1/2): | 0.823 |
| hERG Blockers: | 0.025 | Human Hepatotoxicity (H-HT): | 0.251 |
| Drug-inuced Liver Injury (DILI): | 0.046 | AMES Toxicity: | 0.02 |
| Rat Oral Acute Toxicity: | 0.005 | Maximum Recommended Daily Dose: | 0.253 |
| Skin Sensitization: | 0.86 | Carcinogencity: | 0.125 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.028 |
| Respiratory Toxicity: | 0.012 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001423 | ![]() |
0.662 | D0AO5H | ![]() |
0.402 | ||
| ENC000340 | ![]() |
0.458 | D0A8FB | ![]() |
0.365 | ||
| ENC005523 | ![]() |
0.455 | D09DHY | ![]() |
0.346 | ||
| ENC001376 | ![]() |
0.381 | D02LZB | ![]() |
0.324 | ||
| ENC005314 | ![]() |
0.352 | D0D4HN | ![]() |
0.319 | ||
| ENC005277 | ![]() |
0.344 | D01FFA | ![]() |
0.314 | ||
| ENC001403 | ![]() |
0.342 | D0Y7TS | ![]() |
0.311 | ||
| ENC000523 | ![]() |
0.330 | D0S0AF | ![]() |
0.308 | ||
| ENC005931 | ![]() |
0.320 | D06GCK | ![]() |
0.304 | ||
| ENC004456 | ![]() |
0.319 | D0Q4YI | ![]() |
0.297 | ||