![]() |
Name |
cis-4-Isopropyl-4-cyclohexene-1,2-dicarboxylic acid
|
Molecular Formula | C11H16O4 | |
IUPAC Name* |
4-propan-2-ylcyclohex-4-ene-1,2-dicarboxylic acid
|
|
SMILES |
CC(C)C1=CCC(C(C1)C(=O)O)C(=O)O
|
|
InChI |
InChI=1S/C11H16O4/c1-6(2)7-3-4-8(10(12)13)9(5-7)11(14)15/h3,6,8-9H,4-5H2,1-2H3,(H,12,13)(H,14,15)
|
|
InChIKey |
OAKIBDGEEQFWHU-UHFFFAOYSA-N
|
|
Synonyms |
CBDivE_000635; Cambridge id 5106441; SCHEMBL5478445; STL328845; AKOS003604394; 4-Isopropyl-4-cyclohexene-1,2-dicarboxylic acid; SR-01000195400; 4-Isopropyl-4-cyclohexene-1,2-dicarboxylic acid #; SR-01000195400-1; 4-(propan-2-yl)cyclohex-4-ene-1,2-dicarboxylic acid; cis-4-Isopropyl-4-cyclohexene-1,2-dicarboxylic acid
|
|
CAS | NA | |
PubChem CID | 597123 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 212.24 | ALogp: | 1.1 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 74.6 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.704 |
Caco-2 Permeability: | -5.932 | MDCK Permeability: | 0.00093235 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.063 | 20% Bioavailability (F20%): | 0.008 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.21 | Plasma Protein Binding (PPB): | 88.90% |
Volume Distribution (VD): | 0.345 | Fu: | 6.61% |
CYP1A2-inhibitor: | 0.01 | CYP1A2-substrate: | 0.048 |
CYP2C19-inhibitor: | 0.018 | CYP2C19-substrate: | 0.053 |
CYP2C9-inhibitor: | 0.004 | CYP2C9-substrate: | 0.899 |
CYP2D6-inhibitor: | 0.017 | CYP2D6-substrate: | 0.081 |
CYP3A4-inhibitor: | 0.007 | CYP3A4-substrate: | 0.011 |
Clearance (CL): | 4.644 | Half-life (T1/2): | 0.84 |
hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.271 |
Drug-inuced Liver Injury (DILI): | 0.301 | AMES Toxicity: | 0.003 |
Rat Oral Acute Toxicity: | 0.084 | Maximum Recommended Daily Dose: | 0.012 |
Skin Sensitization: | 0.102 | Carcinogencity: | 0.159 |
Eye Corrosion: | 0.72 | Eye Irritation: | 0.945 |
Respiratory Toxicity: | 0.034 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001296 | ![]() |
0.417 | D0I0EG | ![]() |
0.246 | ||
ENC003371 | ![]() |
0.291 | D0UA2Z | ![]() |
0.238 | ||
ENC001903 | ![]() |
0.267 | D06PSS | ![]() |
0.226 | ||
ENC003998 | ![]() |
0.267 | D0P2IW | ![]() |
0.222 | ||
ENC000749 | ![]() |
0.266 | D0S8LV | ![]() |
0.217 | ||
ENC004003 | ![]() |
0.263 | D0N5HJ | ![]() |
0.213 | ||
ENC002569 | ![]() |
0.261 | D01GYK | ![]() |
0.212 | ||
ENC004007 | ![]() |
0.261 | D0T8LY | ![]() |
0.210 | ||
ENC001837 | ![]() |
0.259 | D0G4JI | ![]() |
0.209 | ||
ENC004313 | ![]() |
0.254 | D00ENY | ![]() |
0.208 |