![]() |
Name |
Gliocladic acid
|
Molecular Formula | C14H22O4 | |
IUPAC Name* |
(E)-2-(hydroxymethyl)-3-[(1R,6R)-3-(hydroxymethyl)-6-propan-2-ylcyclohex-2-en-1-yl]prop-2-enoic acid
|
|
SMILES |
CC(C)[C@H]1CCC(=C[C@@H]1/C=C(\CO)/C(=O)O)CO
|
|
InChI |
InChI=1S/C14H22O4/c1-9(2)13-4-3-10(7-15)5-11(13)6-12(8-16)14(17)18/h5-6,9,11,13,15-16H,3-4,7-8H2,1-2H3,(H,17,18)/b12-6+/t11-,13-/m1/s1
|
|
InChIKey |
SLVSUVFUFJKMCV-URFGDBDFSA-N
|
|
Synonyms |
Gliocladic acid; (E)-2-(hydroxymethyl)-3-[(1R,6R)-3-(hydroxymethyl)-6-propan-2-ylcyclohex-2-en-1-yl]prop-2-enoic acid; Gliocladic acid_130132; CHEMBL488443; CHEBI:181498; ZINC15257890; NCGC00380929-01; (E)-2-Hydroxymethyl-3-[3-(hydroxymethyl)-6alpha-(1-methylethyl)-2-cyclohexen-1beta-yl]propenoic acid
|
|
CAS | NA | |
PubChem CID | 26495249 | |
ChEMBL ID | CHEMBL488443 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 254.32 | ALogp: | 1.1 |
HBD: | 3 | HBA: | 4 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 77.8 | Aromatic Rings: | 1 |
Heavy Atoms: | 18 | QED Weighted: | 0.519 |
Caco-2 Permeability: | -4.976 | MDCK Permeability: | 0.00002760 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.003 |
Human Intestinal Absorption (HIA): | 0.308 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.003 |
Blood-Brain-Barrier Penetration (BBB): | 0.845 | Plasma Protein Binding (PPB): | 68.09% |
Volume Distribution (VD): | 0.426 | Fu: | 23.05% |
CYP1A2-inhibitor: | 0.025 | CYP1A2-substrate: | 0.067 |
CYP2C19-inhibitor: | 0.015 | CYP2C19-substrate: | 0.196 |
CYP2C9-inhibitor: | 0.008 | CYP2C9-substrate: | 0.195 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.113 |
CYP3A4-inhibitor: | 0.016 | CYP3A4-substrate: | 0.149 |
Clearance (CL): | 2.877 | Half-life (T1/2): | 0.896 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.898 |
Drug-inuced Liver Injury (DILI): | 0.361 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.078 | Maximum Recommended Daily Dose: | 0.906 |
Skin Sensitization: | 0.939 | Carcinogencity: | 0.362 |
Eye Corrosion: | 0.073 | Eye Irritation: | 0.969 |
Respiratory Toxicity: | 0.559 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003998 | ![]() |
0.705 | D0YH0N | ![]() |
0.238 | ||
ENC004062 | ![]() |
0.514 | D04CSZ | ![]() |
0.222 | ||
ENC002578 | ![]() |
0.478 | D07VFD | ![]() |
0.219 | ||
ENC004921 | ![]() |
0.444 | D06PSS | ![]() |
0.217 | ||
ENC004003 | ![]() |
0.438 | D0P4MT | ![]() |
0.212 | ||
ENC003999 | ![]() |
0.425 | D0I0EG | ![]() |
0.197 | ||
ENC003589 | ![]() |
0.421 | D07SJT | ![]() |
0.194 | ||
ENC004007 | ![]() |
0.333 | D0D1SG | ![]() |
0.190 | ||
ENC003649 | ![]() |
0.333 | D0KR5B | ![]() |
0.190 | ||
ENC000762 | ![]() |
0.328 | D09KDV | ![]() |
0.189 |