|
Name |
2-Methyl-1,2,3,4-tetrahydronaphthalen-1-ol
|
| Molecular Formula | C11H14O | |
| IUPAC Name* |
2-methyl-1,2,3,4-tetrahydronaphthalen-1-ol
|
|
| SMILES |
CC1CCC2=CC=CC=C2C1O
|
|
| InChI |
InChI=1S/C11H14O/c1-8-6-7-9-4-2-3-5-10(9)11(8)12/h2-5,8,11-12H,6-7H2,1H3
|
|
| InChIKey |
UMUJQRABWPODKX-UHFFFAOYSA-N
|
|
| Synonyms |
2-methyl-1,2,3,4-tetrahydronaphthalen-1-ol; 32281-70-2; 1,2,3,4-Tetrahydro-2-methyl-1-naphthol; 1,2,3,4-tetrahydro-2-methylnaphthalen-1-ol; 1-Naphthol, 1,2,3,4-tetrahydro-2-methyl-; SCHEMBL2190921; AMY6134; DTXSID301268559; ZB1755; AKOS011021388; DB-102864; CS-0068753; 1,2,3,4-Tetrahydro-2-methyl-1-naphthalenol; 2-Methyl-1,2,3,4-tetrahydro-1-naphthalenol #
|
|
| CAS | 32281-70-2 | |
| PubChem CID | 577664 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 162.23 | ALogp: | 2.3 |
| HBD: | 1 | HBA: | 1 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 20.2 | Aromatic Rings: | 2 |
| Heavy Atoms: | 12 | QED Weighted: | 0.621 |
| Caco-2 Permeability: | -4.377 | MDCK Permeability: | 0.00002600 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.032 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.627 |
| 30% Bioavailability (F30%): | 0.036 |
| Blood-Brain-Barrier Penetration (BBB): | 0.919 | Plasma Protein Binding (PPB): | 84.23% |
| Volume Distribution (VD): | 1.576 | Fu: | 14.88% |
| CYP1A2-inhibitor: | 0.333 | CYP1A2-substrate: | 0.898 |
| CYP2C19-inhibitor: | 0.176 | CYP2C19-substrate: | 0.761 |
| CYP2C9-inhibitor: | 0.051 | CYP2C9-substrate: | 0.807 |
| CYP2D6-inhibitor: | 0.013 | CYP2D6-substrate: | 0.887 |
| CYP3A4-inhibitor: | 0.013 | CYP3A4-substrate: | 0.52 |
| Clearance (CL): | 8.53 | Half-life (T1/2): | 0.414 |
| hERG Blockers: | 0.029 | Human Hepatotoxicity (H-HT): | 0.084 |
| Drug-inuced Liver Injury (DILI): | 0.042 | AMES Toxicity: | 0.247 |
| Rat Oral Acute Toxicity: | 0.102 | Maximum Recommended Daily Dose: | 0.095 |
| Skin Sensitization: | 0.177 | Carcinogencity: | 0.184 |
| Eye Corrosion: | 0.004 | Eye Irritation: | 0.498 |
| Respiratory Toxicity: | 0.063 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC006142 | ![]() |
0.447 | D06OMW | ![]() |
0.469 | ||
| ENC004793 | ![]() |
0.447 | D05IHU | ![]() |
0.386 | ||
| ENC002250 | ![]() |
0.435 | D0R8PX | ![]() |
0.364 | ||
| ENC000345 | ![]() |
0.386 | D0MP5H | ![]() |
0.315 | ||
| ENC001031 | ![]() |
0.383 | D0M2MC | ![]() |
0.309 | ||
| ENC000917 | ![]() |
0.378 | D0T6SU | ![]() |
0.298 | ||
| ENC005244 | ![]() |
0.360 | D0L9ZR | ![]() |
0.295 | ||
| ENC000038 | ![]() |
0.347 | D04QZD | ![]() |
0.294 | ||
| ENC006050 | ![]() |
0.346 | D0H0HJ | ![]() |
0.292 | ||
| ENC000028 | ![]() |
0.333 | D01JMC | ![]() |
0.291 | ||