|
Name |
Uncinatone
|
| Molecular Formula | C20H22O4 | |
| IUPAC Name* |
(9S,11bS)-7,11-dihydroxy-3,4,9,11b-tetramethyl-1,2,8,9-tetrahydronaphtho[2,1-f][1]benzofuran-6-one
|
|
| SMILES |
C[C@H]1CC2=C(C3=C(C(=C2O1)O)[C@]4(CCC(=C(C4=CC3=O)C)C)C)O
|
|
| InChI |
InChI=1S/C20H22O4/c1-9-5-6-20(4)13(11(9)3)8-14(21)15-16(20)18(23)19-12(17(15)22)7-10(2)24-19/h8,10,22-23H,5-7H2,1-4H3/t10-,20-/m0/s1
|
|
| InChIKey |
IQGPVLVWUUPQMQ-FVINQWEUSA-N
|
|
| Synonyms |
Uncinatone; C09976; 99624-92-7; AC1L9D22; CHEBI:9861; SCHEMBL4743868; CHEMBL4159483; DTXSID10912584; ZINC4098464; AKOS032948874; 1770782-39-2; Q27108504; (9S,11bS)-7,11-dihydroxy-3,4,9,11b-tetramethyl-1,2,8,9-tetrahydronaphtho[2,1-f]benzofuran-6-one; 1,8,9,11b-Tetrahydro-7,11-dihydroxy-3,4,9alpha,11balpha-tetramethylphenanthro[3,2-b]furan-6(2H)-one; 7,11-Dihydroxy-3,4,9,11b-tetramethyl-1,8,9,11b-tetrahydrophenanthro[3,2-b]furan-6(2H)-one
|
|
| CAS | 1770782-39-2 | |
| PubChem CID | 442547 | |
| ChEMBL ID | CHEMBL4159483 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 326.4 | ALogp: | 3.6 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 66.8 | Aromatic Rings: | 4 |
| Heavy Atoms: | 24 | QED Weighted: | 0.685 |
| Caco-2 Permeability: | -4.699 | MDCK Permeability: | 0.00001290 |
| Pgp-inhibitor: | 0.235 | Pgp-substrate: | 0.219 |
| Human Intestinal Absorption (HIA): | 0.022 | 20% Bioavailability (F20%): | 0.068 |
| 30% Bioavailability (F30%): | 0.014 |
| Blood-Brain-Barrier Penetration (BBB): | 0.016 | Plasma Protein Binding (PPB): | 92.11% |
| Volume Distribution (VD): | 1.292 | Fu: | 8.09% |
| CYP1A2-inhibitor: | 0.91 | CYP1A2-substrate: | 0.893 |
| CYP2C19-inhibitor: | 0.718 | CYP2C19-substrate: | 0.663 |
| CYP2C9-inhibitor: | 0.818 | CYP2C9-substrate: | 0.77 |
| CYP2D6-inhibitor: | 0.555 | CYP2D6-substrate: | 0.403 |
| CYP3A4-inhibitor: | 0.446 | CYP3A4-substrate: | 0.311 |
| Clearance (CL): | 17.902 | Half-life (T1/2): | 0.091 |
| hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.187 |
| Drug-inuced Liver Injury (DILI): | 0.855 | AMES Toxicity: | 0.087 |
| Rat Oral Acute Toxicity: | 0.568 | Maximum Recommended Daily Dose: | 0.41 |
| Skin Sensitization: | 0.699 | Carcinogencity: | 0.513 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.161 |
| Respiratory Toxicity: | 0.811 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005237 | ![]() |
0.451 | D06XZW | ![]() |
0.269 | ||
| ENC002282 | ![]() |
0.417 | D0K7LU | ![]() |
0.239 | ||
| ENC005119 | ![]() |
0.386 | D01XWG | ![]() |
0.235 | ||
| ENC002308 | ![]() |
0.363 | D01XDL | ![]() |
0.235 | ||
| ENC005706 | ![]() |
0.338 | D02NSF | ![]() |
0.233 | ||
| ENC006087 | ![]() |
0.337 | D0C1SF | ![]() |
0.226 | ||
| ENC000709 | ![]() |
0.333 | D08LTU | ![]() |
0.226 | ||
| ENC004364 | ![]() |
0.333 | D04JHN | ![]() |
0.225 | ||
| ENC002036 | ![]() |
0.326 | D0C9XJ | ![]() |
0.221 | ||
| ENC005158 | ![]() |
0.326 | D07VLY | ![]() |
0.221 | ||