![]() |
Name |
Versicoisochromane B
|
Molecular Formula | C12H14O4 | |
IUPAC Name* |
(3R)-8-hydroxy-5-(hydroxymethyl)-3,7-dimethyl-3,4-dihydroisochromen-1-one
|
|
SMILES |
C[C@@H]1CC2=C(C=C(C(=C2C(=O)O1)O)C)CO
|
|
InChI |
InChI=1S/C12H14O4/c1-6-3-8(5-13)9-4-7(2)16-12(15)10(9)11(6)14/h3,7,13-14H,4-5H2,1-2H3/t7-/m1/s1
|
|
InChIKey |
IVPMBAZIFSYUQO-SSDOTTSWSA-N
|
|
Synonyms |
Versicoisochromane B
|
|
CAS | NA | |
PubChem CID | 156582408 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 222.24 | ALogp: | 1.9 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 66.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 16 | QED Weighted: | 0.711 |
Caco-2 Permeability: | -4.618 | MDCK Permeability: | 0.00001070 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.002 |
30% Bioavailability (F30%): | 0.026 |
Blood-Brain-Barrier Penetration (BBB): | 0.723 | Plasma Protein Binding (PPB): | 89.83% |
Volume Distribution (VD): | 0.776 | Fu: | 9.48% |
CYP1A2-inhibitor: | 0.824 | CYP1A2-substrate: | 0.467 |
CYP2C19-inhibitor: | 0.064 | CYP2C19-substrate: | 0.36 |
CYP2C9-inhibitor: | 0.045 | CYP2C9-substrate: | 0.391 |
CYP2D6-inhibitor: | 0.389 | CYP2D6-substrate: | 0.376 |
CYP3A4-inhibitor: | 0.12 | CYP3A4-substrate: | 0.173 |
Clearance (CL): | 11.358 | Half-life (T1/2): | 0.836 |
hERG Blockers: | 0.007 | Human Hepatotoxicity (H-HT): | 0.185 |
Drug-inuced Liver Injury (DILI): | 0.492 | AMES Toxicity: | 0.084 |
Rat Oral Acute Toxicity: | 0.094 | Maximum Recommended Daily Dose: | 0.496 |
Skin Sensitization: | 0.562 | Carcinogencity: | 0.76 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.339 |
Respiratory Toxicity: | 0.142 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002310 | ![]() |
0.615 | D0YH0N | ![]() |
0.269 | ||
ENC002309 | ![]() |
0.528 | D07MUN | ![]() |
0.267 | ||
ENC002045 | ![]() |
0.509 | D07MGA | ![]() |
0.238 | ||
ENC005706 | ![]() |
0.491 | D07AHW | ![]() |
0.233 | ||
ENC005553 | ![]() |
0.483 | D0S5CH | ![]() |
0.222 | ||
ENC003934 | ![]() |
0.483 | D09EBS | ![]() |
0.221 | ||
ENC005703 | ![]() |
0.482 | D0CL9S | ![]() |
0.219 | ||
ENC005939 | ![]() |
0.473 | D0N0OU | ![]() |
0.211 | ||
ENC004363 | ![]() |
0.466 | D0P4MT | ![]() |
0.210 | ||
ENC001305 | ![]() |
0.448 | D0K5CB | ![]() |
0.205 |