|
Name |
Di-sec-butyl phthalate
|
| Molecular Formula | C16H22O4 | |
| IUPAC Name* |
dibutan-2-yl benzene-1,2-dicarboxylate
|
|
| SMILES |
CCC(C)OC(=O)C1=CC=CC=C1C(=O)OC(C)CC
|
|
| InChI |
InChI=1S/C16H22O4/c1-5-11(3)19-15(17)13-9-7-8-10-14(13)16(18)20-12(4)6-2/h7-12H,5-6H2,1-4H3
|
|
| InChIKey |
HAPGVMADJBQOGC-UHFFFAOYSA-N
|
|
| Synonyms |
di-sec-butyl phthalate; 4489-61-6; dibutan-2-yl benzene-1,2-dicarboxylate; NSC67890; Di-(sec.-butyl)-phthalat; NCIOpen2_003427; Phthalic acid disec-butyl ester; SCHEMBL6231293; DTXSID80290301; NSC-67890; Phthalic acid bis-(sec-butyl)-ester; AKOS030254903; 1,2-bis(butan-2-yl) benzene-1,2-dicarboxylate; 1,2-Benzenedicarboxylic acid, di-sec-butyl ester
|
|
| CAS | 4489-61-6 | |
| PubChem CID | 249496 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 278.34 | ALogp: | 3.9 |
| HBD: | 0 | HBA: | 4 |
| Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 52.6 | Aromatic Rings: | 1 |
| Heavy Atoms: | 20 | QED Weighted: | 0.727 |
| Caco-2 Permeability: | -4.488 | MDCK Permeability: | 0.00003280 |
| Pgp-inhibitor: | 0.603 | Pgp-substrate: | 0 |
| Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.079 |
| 30% Bioavailability (F30%): | 0.961 |
| Blood-Brain-Barrier Penetration (BBB): | 0.057 | Plasma Protein Binding (PPB): | 92.36% |
| Volume Distribution (VD): | 1.131 | Fu: | 1.87% |
| CYP1A2-inhibitor: | 0.584 | CYP1A2-substrate: | 0.323 |
| CYP2C19-inhibitor: | 0.682 | CYP2C19-substrate: | 0.069 |
| CYP2C9-inhibitor: | 0.744 | CYP2C9-substrate: | 0.59 |
| CYP2D6-inhibitor: | 0.264 | CYP2D6-substrate: | 0.08 |
| CYP3A4-inhibitor: | 0.289 | CYP3A4-substrate: | 0.174 |
| Clearance (CL): | 11.562 | Half-life (T1/2): | 0.324 |
| hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.035 |
| Drug-inuced Liver Injury (DILI): | 0.902 | AMES Toxicity: | 0.007 |
| Rat Oral Acute Toxicity: | 0.003 | Maximum Recommended Daily Dose: | 0.032 |
| Skin Sensitization: | 0.154 | Carcinogencity: | 0.028 |
| Eye Corrosion: | 0.03 | Eye Irritation: | 0.976 |
| Respiratory Toxicity: | 0.067 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001804 | ![]() |
0.635 | D0GY5Z | ![]() |
0.328 | ||
| ENC003076 | ![]() |
0.568 | D0B7OD | ![]() |
0.319 | ||
| ENC000155 | ![]() |
0.543 | D06LYG | ![]() |
0.307 | ||
| ENC005690 | ![]() |
0.543 | D0S5CU | ![]() |
0.303 | ||
| ENC001802 | ![]() |
0.538 | D0G2MH | ![]() |
0.292 | ||
| ENC000154 | ![]() |
0.531 | D0Y0JH | ![]() |
0.289 | ||
| ENC000586 | ![]() |
0.514 | D05PIZ | ![]() |
0.286 | ||
| ENC004744 | ![]() |
0.500 | D0GR0T | ![]() |
0.286 | ||
| ENC000300 | ![]() |
0.486 | D0RA5Q | ![]() |
0.284 | ||
| ENC000299 | ![]() |
0.484 | D05OFX | ![]() |
0.284 | ||