|
Name |
2-Ethyl-4,5-dimethylphenol
|
| Molecular Formula | C10H14O | |
| IUPAC Name* |
2-ethyl-4,5-dimethylphenol
|
|
| SMILES |
CCC1=C(C=C(C(=C1)C)C)O
|
|
| InChI |
InChI=1S/C10H14O/c1-4-9-5-7(2)8(3)6-10(9)11/h5-6,11H,4H2,1-3H3
|
|
| InChIKey |
ZUDAICPAUJSPHK-UHFFFAOYSA-N
|
|
| Synonyms |
2-Ethyl-4,5-dimethylphenol; 2219-78-5; 6-Ethyl-3,4-dimethylphenol; Phenol, 2-ethyl-4,5-dimethyl-; 4,5-Dimethyl-2-ethylphenol; 3,4-DIMETHYL-6-ETHYLPHENOL; 3,4-Xylenol, 6-ethyl-; Phenol,2-ethyl-4,5-dimethyl-; 7CX4CE64WG; NSC-62107; 1-Hydroxy-3,4-dimethyl-6-ethylbenzene; NSC62107; 3, 6-ethyl-; UNII-7CX4CE64WG; SCHEMBL4092415; 2-Ethyl-4,5-dimethylphenol #; DTXSID30289588; ZINC1691007; NSC 62107; AKOS006282036; FT-0699515; Q4596877
|
|
| CAS | 2219-78-5 | |
| PubChem CID | 247477 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 150.22 | ALogp: | 3.1 |
| HBD: | 1 | HBA: | 1 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 20.2 | Aromatic Rings: | 1 |
| Heavy Atoms: | 11 | QED Weighted: | 0.65 |
| Caco-2 Permeability: | -4.542 | MDCK Permeability: | 0.00002450 |
| Pgp-inhibitor: | 0.043 | Pgp-substrate: | 0.025 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.967 |
| 30% Bioavailability (F30%): | 0.976 |
| Blood-Brain-Barrier Penetration (BBB): | 0.835 | Plasma Protein Binding (PPB): | 93.08% |
| Volume Distribution (VD): | 1.408 | Fu: | 7.05% |
| CYP1A2-inhibitor: | 0.908 | CYP1A2-substrate: | 0.956 |
| CYP2C19-inhibitor: | 0.524 | CYP2C19-substrate: | 0.603 |
| CYP2C9-inhibitor: | 0.19 | CYP2C9-substrate: | 0.777 |
| CYP2D6-inhibitor: | 0.794 | CYP2D6-substrate: | 0.911 |
| CYP3A4-inhibitor: | 0.108 | CYP3A4-substrate: | 0.361 |
| Clearance (CL): | 13.448 | Half-life (T1/2): | 0.73 |
| hERG Blockers: | 0.021 | Human Hepatotoxicity (H-HT): | 0.037 |
| Drug-inuced Liver Injury (DILI): | 0.049 | AMES Toxicity: | 0.142 |
| Rat Oral Acute Toxicity: | 0.039 | Maximum Recommended Daily Dose: | 0.883 |
| Skin Sensitization: | 0.681 | Carcinogencity: | 0.277 |
| Eye Corrosion: | 0.94 | Eye Irritation: | 0.988 |
| Respiratory Toxicity: | 0.408 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000734 | ![]() |
0.474 | D06GIP | ![]() |
0.289 | ||
| ENC000181 | ![]() |
0.447 | D0Y4DY | ![]() |
0.258 | ||
| ENC000498 | ![]() |
0.436 | D0X0RI | ![]() |
0.255 | ||
| ENC000084 | ![]() |
0.410 | D0EL2O | ![]() |
0.246 | ||
| ENC002336 | ![]() |
0.390 | D0S5LH | ![]() |
0.245 | ||
| ENC005230 | ![]() |
0.390 | D0K5CB | ![]() |
0.233 | ||
| ENC000180 | ![]() |
0.359 | D08HUC | ![]() |
0.233 | ||
| ENC001359 | ![]() |
0.333 | D02ZJI | ![]() |
0.233 | ||
| ENC000346 | ![]() |
0.327 | D0H2ZW | ![]() |
0.233 | ||
| ENC000614 | ![]() |
0.325 | D09EBS | ![]() |
0.231 | ||