| 
                    Name | 
                         [4-(Hydroxymethyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-8-yl]methanol 
                     | 
                
| Molecular Formula | C8H14O6 | |
| IUPAC Name* | 
                         [4-(hydroxymethyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-8-yl]methanol 
                     | 
                |
| SMILES | 
                         C1OC(C2C(O1)C(OCO2)CO)CO 
                     | 
                |
| InChI | 
                         InChI=1S/C8H14O6/c9-1-5-7-8(14-3-11-5)6(2-10)12-4-13-7/h5-10H,1-4H2 
                     | 
                |
| InChIKey | 
                         DLIMVTKZIGEWCB-UHFFFAOYSA-N 
                     | 
                |
| Synonyms | 
                         1,3,5,7-Tetraoxadecalin 4,8-dimethanol; 5334-20-3; MLS002637570; [4-(hydroxymethyl)-4,4a,8,8a-tetrahydro-[1,3]dioxino[5,4-d][1,3]dioxin-8-yl]methanol; 6945-65-9; 2,4:3,5-DI-O-METHYLENE-L-IDITOL; NSC1388; CHEMBL1885909; 2,4:3,5-Dimethylene-l-iditol; DTXSID80277258; NSC-1388; NSC52137; NSC-52137; 2,5-DI-O-METHYLENE-L-IDITOL; SMR001547101; FT-0667431 
                     | 
                |
| CAS | 6945-65-9 | |
| PubChem CID | 219727 | |
| ChEMBL ID | CHEMBL1885909 | 
Chemical Classification: | 
                    
                        
  | 
                    
                        
                            
                     | 
                
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | 
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | 
| Molecular Weight: | 206.19 | ALogp: | -1.7 | 
| HBD: | 2 | HBA: | 6 | 
| Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted | 
| Polar Surface Area: | 77.4 | Aromatic Rings: | 2 | 
| Heavy Atoms: | 14 | QED Weighted: | 0.604 | 
| Caco-2 Permeability: | -5.283 | MDCK Permeability: | 0.00038825 | 
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.002 | 
| Human Intestinal Absorption (HIA): | 0.272 | 20% Bioavailability (F20%): | 0.505 | 
| 30% Bioavailability (F30%): | 0.028 | 
| Blood-Brain-Barrier Penetration (BBB): | 0.248 | Plasma Protein Binding (PPB): | 10.49% | 
| Volume Distribution (VD): | 0.434 | Fu: | 82.19% | 
| CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.721 | 
| CYP2C19-inhibitor: | 0.012 | CYP2C19-substrate: | 0.235 | 
| CYP2C9-inhibitor: | 0.002 | CYP2C9-substrate: | 0.025 | 
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.121 | 
| CYP3A4-inhibitor: | 0.008 | CYP3A4-substrate: | 0.124 | 
| Clearance (CL): | 1.809 | Half-life (T1/2): | 0.71 | 
| hERG Blockers: | 0.032 | Human Hepatotoxicity (H-HT): | 0.114 | 
| Drug-inuced Liver Injury (DILI): | 0.451 | AMES Toxicity: | 0.357 | 
| Rat Oral Acute Toxicity: | 0.154 | Maximum Recommended Daily Dose: | 0.007 | 
| Skin Sensitization: | 0.147 | Carcinogencity: | 0.116 | 
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.185 | 
| Respiratory Toxicity: | 0.009 | 
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000447 | ![]()  | 
                    0.259 | D0Z4EI | ![]()  | 
                    0.232 | ||
| ENC001221 | ![]()  | 
                    0.211 | D0T5BC | ![]()  | 
                    0.214 | ||
| ENC000944 | ![]()  | 
                    0.208 | D0YS7D | ![]()  | 
                    0.206 | ||
| ENC000661 | ![]()  | 
                    0.203 | D0H2RI | ![]()  | 
                    0.203 | ||
| ENC001062 | ![]()  | 
                    0.203 | D0H3KI | ![]()  | 
                    0.203 | ||
| ENC003068 | ![]()  | 
                    0.203 | D07NSU | ![]()  | 
                    0.203 | ||
| ENC001312 | ![]()  | 
                    0.200 | D0D0ZD | ![]()  | 
                    0.185 | ||
| ENC003488 | ![]()  | 
                    0.197 | D05ZYM | ![]()  | 
                    0.179 | ||
| ENC003056 | ![]()  | 
                    0.193 | D01JQJ | ![]()  | 
                    0.175 | ||
| ENC001986 | ![]()  | 
                    0.192 | D0T3AD | ![]()  | 
                    0.175 | ||