| 
                    Name | 
                         Isosorbide 
                     | 
                
| Molecular Formula | C6H10O4 | |
| IUPAC Name* | 
                         (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol 
                     | 
                |
| SMILES | 
                         C1[C@H]([C@@H]2[C@H](O1)[C@H](CO2)O)O 
                     | 
                |
| InChI | 
                         InChI=1S/C6H10O4/c7-3-1-9-6-4(8)2-10-5(3)6/h3-8H,1-2H2/t3-,4+,5-,6-/m1/s1 
                     | 
                |
| InChIKey | 
                         KLDXJTOLSGUMSJ-JGWLITMVSA-N 
                     | 
                |
| Synonyms | 
                         isosorbide; 652-67-5; Isobide; Devicoran; Hydronol; Ismotic; 1,4:3,6-Dianhydro-D-glucitol; Sorbid; (3R,3aR,6S,6aR)-hexahydrofuro[3,2-b]furan-3,6-diol; (+)-D-Isosorbide; Vascardin dinitrate; Dianhydro-D-glucitol; D-Glucitol, 1,4:3,6-dianhydro-; 1,4-Dianhydrosorbitol; AT-101; 1,4:3,6-Dianhydro-D-sorbitol; 1,4:3,6-Dianhydrosorbitol; D-Isosorbide; (3S,3aR,6R,6aR)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3,6-diol; NSC-40725; WXR179L51S; Sorbitol, 1,4:3,6-dianhydro-; NSC40725; D-1,4:3,6-Dianhydroglucitol; NCGC00160508-01; Isosorbide 100 microg/mL in Acetonitrile; Glucitol, 1,4:3,6-dianhydro-, D-; DSSTox_CID_26196; DSSTox_RID_81427; DSSTox_GSID_46196; Hydronol (VAN); Isosorbida; Isosorbidum; Isosorbidum [INN-Latin]; Isosorbida [INN-Spanish]; CAS-652-67-5; HSDB 3105; EINECS 211-492-3; NSC 40725; BRN 0080510; UNII-WXR179L51S; Ismotic (TN); Isobide (TN); MFCD00064827; Isosorbide [USAN:USP:INN:BAN:JAN]; 1,6-Dianhydrosorbitol; ISOSORBIDE [MI]; ISOSORBIDE [INN]; ISOSORBIDE [JAN]; ISOSORBIDE [HSDB]; ISOSORBIDE [INCI]; ISOSORBIDE [USAN]; ISOSORBIDE [VANDF]; 1,6-Dianhydro-D-glucitol; 1,6-Dianhydro-D-sorbitol; EC 211-492-3; ISOSORBIDE [MART.]; ISOSORBIDE [USP-RS]; ISOSORBIDE [WHO-DD]; Dianhydro-D-glucitol, 98%; SCHEMBL15495; 1,4:3,6-Dianhydroglucitol; 5-19-03-00201 (Beilstein Handbook Reference); BIDD:GT0695; 1,4; 3,6-dianhydrosorbitol; CHEBI:6060; Isosorbide (JP17/USP/INN); D-Glucitol,4:3,6-dianhydro-; CHEMBL1200660; DTXSID5046196; ISOSORBIDE [ORANGE BOOK]; 1.4:3.6-dianhydro-D-glucitol; 1.4;3.6-dianhydro-D-glucitol; ISOSORBIDE [USP IMPURITY]; Glucitol,4:3,6-dianhydro-, D-; HY-B1469; Tox21_111861; BBL029591; s4204; STK801813; ZINC18284778; AKOS005622709; Tox21_111861_1; CCG-266173; CS-5157; DB09401; SMP1_000177; NCGC00160508-02; NCGC00160508-03; AS-14140; I0407; D00347; EN300-170910; AB01566931_01; Q1243800; Z1216815730; A912284D-27E1-4FB0-91B8-86C8AB905297; WURCS=2.0/1,1,0/[h2122h_1-4_3-6]/1/; D-Sorbitol, {1,4:3,6-dianhydro(furo[3,2-b]furan-3,6-diol,} hexahydro-); D-Sorbitol,4:3,6-dianhydro(furo[3,2-b]furan-3,6-diol, hexahydro-) 
                     | 
                |
| CAS | 652-67-5 | |
| PubChem CID | 12597 | |
| ChEMBL ID | CHEMBL1200660 | 
Chemical Classification: | 
                    
                        
  | 
                    
                        
                            
                     | 
                
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | 
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | 
| Molecular Weight: | 146.14 | ALogp: | -1.4 | 
| HBD: | 2 | HBA: | 4 | 
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted | 
| Polar Surface Area: | 58.9 | Aromatic Rings: | 2 | 
| Heavy Atoms: | 10 | QED Weighted: | 0.462 | 
| Caco-2 Permeability: | -5.09 | MDCK Permeability: | 0.00007460 | 
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.969 | 
| Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.188 | 
| 30% Bioavailability (F30%): | 0.276 | 
| Blood-Brain-Barrier Penetration (BBB): | 0.393 | Plasma Protein Binding (PPB): | 13.20% | 
| Volume Distribution (VD): | 1.388 | Fu: | 85.80% | 
| CYP1A2-inhibitor: | 0.03 | CYP1A2-substrate: | 0.103 | 
| CYP2C19-inhibitor: | 0.031 | CYP2C19-substrate: | 0.416 | 
| CYP2C9-inhibitor: | 0.007 | CYP2C9-substrate: | 0.058 | 
| CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.238 | 
| CYP3A4-inhibitor: | 0.011 | CYP3A4-substrate: | 0.07 | 
| Clearance (CL): | 2.413 | Half-life (T1/2): | 0.663 | 
| hERG Blockers: | 0.102 | Human Hepatotoxicity (H-HT): | 0.689 | 
| Drug-inuced Liver Injury (DILI): | 0.09 | AMES Toxicity: | 0.136 | 
| Rat Oral Acute Toxicity: | 0.652 | Maximum Recommended Daily Dose: | 0.058 | 
| Skin Sensitization: | 0.658 | Carcinogencity: | 0.183 | 
| Eye Corrosion: | 0.521 | Eye Irritation: | 0.834 | 
| Respiratory Toxicity: | 0.778 | 
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003056 | ![]()  | 
                    0.366 | D0YS7D | ![]()  | 
                    0.524 | ||
| ENC001251 | ![]()  | 
                    0.326 | D07HZY | ![]()  | 
                    0.350 | ||
| ENC001252 | ![]()  | 
                    0.286 | D0I1SK | ![]()  | 
                    0.286 | ||
| ENC000767 | ![]()  | 
                    0.283 | D0Z4EI | ![]()  | 
                    0.239 | ||
| ENC001003 | ![]()  | 
                    0.259 | D0MU9L | ![]()  | 
                    0.213 | ||
| ENC003037 | ![]()  | 
                    0.245 | D0D0ZD | ![]()  | 
                    0.182 | ||
| ENC000927 | ![]()  | 
                    0.217 | D0H2RI | ![]()  | 
                    0.180 | ||
| ENC000928 | ![]()  | 
                    0.217 | D0H3KI | ![]()  | 
                    0.180 | ||
| ENC003431 | ![]()  | 
                    0.213 | D07NSU | ![]()  | 
                    0.180 | ||
| ENC005293 | ![]()  | 
                    0.213 | D0F8CM | ![]()  | 
                    0.178 | ||