![]() |
Name |
Alterporriol E
|
Molecular Formula | C32H30O16 | |
IUPAC Name* |
(1S,2R,3S,4R)-1,2,3,4,8-pentahydroxy-6-methoxy-3-methyl-5-[(5S,6R,7S,8R)-4,5,6,7,8-pentahydroxy-2-methoxy-7-methyl-9,10-dioxo-6,8-dihydro-5H-anthracen-1-yl]-2,4-dihydro-1H-anthracene-9,10-dione
|
|
SMILES |
C[C@]1([C@@H]([C@H](C2=C([C@H]1O)C(=O)C3=C(C2=O)C(=CC(=C3C4=C(C=C(C5=C4C(=O)C6=C(C5=O)[C@@H]([C@H]([C@@]([C@@H]6O)(C)O)O)O)O)OC)OC)O)O)O)O
|
|
InChI |
InChI=1S/C32H30O16/c1-31(45)27(41)19-17(25(39)29(31)43)21(35)11-7(33)5-9(47-3)13(15(11)23(19)37)14-10(48-4)6-8(34)12-16(14)24(38)20-18(22(12)36)26(40)30(44)32(2,46)28(20)42/h5-6,25-30,33-34,39-46H,1-4H3/t25-,26-,27+,28+,29+,30+,31-,32-/m0/s1
|
|
InChIKey |
IXBPWSPJMNOFJJ-KNEUHGCLSA-N
|
|
Synonyms |
Alterporriol E; Alterporriol D; 119644-07-4; 119718-06-8; (1S,2R,3S,4R)-1,2,3,4,8-pentahydroxy-6-methoxy-3-methyl-5-[(5S,6R,7S,8R)-4,5,6,7,8-pentahydroxy-2-methoxy-7-methyl-9,10-dioxo-6,8-dihydro-5H-anthracen-1-yl]-2,4-dihydro-1H-anthracene-9,10-dione; SCHEMBL23522462; DTXSID40923062; CHEBI:192405; 4,4',5,5',6,6',7,7',8,8'-Decahydroxy-2,2'-dimethoxy-7,7'-dimethyl-5,5',6,6',7,7',8,8'-octahydro[1,1'-bianthracene]-9,9',10,10'-tetrone
|
|
CAS | 119644-07-4 | |
PubChem CID | 195315 | |
ChEMBL ID | CHEMBL3335041 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 670.6 | ALogp: | -3.0 |
HBD: | 10 | HBA: | 16 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 289.0 | Aromatic Rings: | 6 |
Heavy Atoms: | 48 | QED Weighted: | 0.176 |
Caco-2 Permeability: | -6.642 | MDCK Permeability: | 0.00000406 |
Pgp-inhibitor: | 0.116 | Pgp-substrate: | 0.972 |
Human Intestinal Absorption (HIA): | 0.998 | 20% Bioavailability (F20%): | 0.02 |
30% Bioavailability (F30%): | 1 |
Blood-Brain-Barrier Penetration (BBB): | 0.004 | Plasma Protein Binding (PPB): | 80.12% |
Volume Distribution (VD): | 0.838 | Fu: | 25.96% |
CYP1A2-inhibitor: | 0.059 | CYP1A2-substrate: | 0.389 |
CYP2C19-inhibitor: | 0.004 | CYP2C19-substrate: | 0.052 |
CYP2C9-inhibitor: | 0.01 | CYP2C9-substrate: | 0.135 |
CYP2D6-inhibitor: | 0 | CYP2D6-substrate: | 0.113 |
CYP3A4-inhibitor: | 0.013 | CYP3A4-substrate: | 0.007 |
Clearance (CL): | 1.031 | Half-life (T1/2): | 0.372 |
hERG Blockers: | 0.039 | Human Hepatotoxicity (H-HT): | 0.013 |
Drug-inuced Liver Injury (DILI): | 0.976 | AMES Toxicity: | 0.203 |
Rat Oral Acute Toxicity: | 0 | Maximum Recommended Daily Dose: | 0.003 |
Skin Sensitization: | 0.067 | Carcinogencity: | 0.001 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.04 |
Respiratory Toxicity: | 0.006 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000947 | ![]() |
0.685 | D0Z2LG | ![]() |
0.276 | ||
ENC000911 | ![]() |
0.685 | D09LBS | ![]() |
0.276 | ||
ENC005390 | ![]() |
0.618 | D01XWG | ![]() |
0.251 | ||
ENC002596 | ![]() |
0.618 | D0C9XJ | ![]() |
0.247 | ||
ENC003207 | ![]() |
0.590 | D07VLY | ![]() |
0.247 | ||
ENC005223 | ![]() |
0.528 | D0I9HF | ![]() |
0.245 | ||
ENC003770 | ![]() |
0.435 | D0T5XN | ![]() |
0.240 | ||
ENC003729 | ![]() |
0.435 | D0J2NK | ![]() |
0.233 | ||
ENC000783 | ![]() |
0.400 | D0TC7C | ![]() |
0.222 | ||
ENC005226 | ![]() |
0.391 | D0T8EH | ![]() |
0.218 |