|
Name |
Di-n-2-propylpentylphthalate
|
| Molecular Formula | C24H38O4 | |
| IUPAC Name* |
bis(2-propylpentyl) benzene-1,2-dicarboxylate
|
|
| SMILES |
CCCC(CCC)COC(=O)C1=CC=CC=C1C(=O)OCC(CCC)CCC
|
|
| InChI |
InChI=1S/C24H38O4/c1-5-11-19(12-6-2)17-27-23(25)21-15-9-10-16-22(21)24(26)28-18-20(13-7-3)14-8-4/h9-10,15-16,19-20H,5-8,11-14,17-18H2,1-4H3
|
|
| InChIKey |
KIYUVQCUDDMZRE-UHFFFAOYSA-N
|
|
| Synonyms |
Di-n-2-propylpentylphthalate; 70910-37-1; phthalic acid di(2-propylpentyl)ester; bis(2-propylpentyl) benzene-1,2-dicarboxylate; 1,2-Benzenedicarboxylic acid, bis(2-propylpentyl) ester; DTXSID90221141; CHEBI:178062; Phthalic acid, di(2-propylpentyl) ester
|
|
| CAS | 70910-37-1 | |
| PubChem CID | 191964 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 390.6 | ALogp: | 7.4 |
| HBD: | 0 | HBA: | 4 |
| Rotatable Bonds: | 16 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 52.6 | Aromatic Rings: | 1 |
| Heavy Atoms: | 28 | QED Weighted: | 0.345 |
| Caco-2 Permeability: | -5.006 | MDCK Permeability: | 0.00001860 |
| Pgp-inhibitor: | 0.998 | Pgp-substrate: | 0.652 |
| Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.975 |
| 30% Bioavailability (F30%): | 0.951 |
| Blood-Brain-Barrier Penetration (BBB): | 0.017 | Plasma Protein Binding (PPB): | 98.95% |
| Volume Distribution (VD): | 1.861 | Fu: | 1.15% |
| CYP1A2-inhibitor: | 0.12 | CYP1A2-substrate: | 0.254 |
| CYP2C19-inhibitor: | 0.658 | CYP2C19-substrate: | 0.068 |
| CYP2C9-inhibitor: | 0.289 | CYP2C9-substrate: | 0.417 |
| CYP2D6-inhibitor: | 0.6 | CYP2D6-substrate: | 0.097 |
| CYP3A4-inhibitor: | 0.544 | CYP3A4-substrate: | 0.117 |
| Clearance (CL): | 7.398 | Half-life (T1/2): | 0.077 |
| hERG Blockers: | 0.162 | Human Hepatotoxicity (H-HT): | 0.017 |
| Drug-inuced Liver Injury (DILI): | 0.112 | AMES Toxicity: | 0.003 |
| Rat Oral Acute Toxicity: | 0.009 | Maximum Recommended Daily Dose: | 0.014 |
| Skin Sensitization: | 0.821 | Carcinogencity: | 0.51 |
| Eye Corrosion: | 0.023 | Eye Irritation: | 0.976 |
| Respiratory Toxicity: | 0.038 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000290 | ![]() |
0.696 | D03LGY | ![]() |
0.379 | ||
| ENC000157 | ![]() |
0.593 | D0X4FM | ![]() |
0.354 | ||
| ENC001802 | ![]() |
0.548 | D0K8CI | ![]() |
0.309 | ||
| ENC000155 | ![]() |
0.500 | D0VL8Q | ![]() |
0.289 | ||
| ENC005690 | ![]() |
0.500 | D0N6CR | ![]() |
0.271 | ||
| ENC001801 | ![]() |
0.495 | D0P5GE | ![]() |
0.263 | ||
| ENC000586 | ![]() |
0.494 | D05KON | ![]() |
0.263 | ||
| ENC000669 | ![]() |
0.490 | D06ORU | ![]() |
0.261 | ||
| ENC000090 | ![]() |
0.489 | D0S5CU | ![]() |
0.254 | ||
| ENC000300 | ![]() |
0.488 | D06IAQ | ![]() |
0.254 | ||