![]() |
Name |
Fonsecin B
|
Molecular Formula | C16H16O6 | |
IUPAC Name* |
2,5-dihydroxy-6,8-dimethoxy-2-methyl-3H-benzo[g]chromen-4-one
|
|
SMILES |
CC1(CC(=O)C2=C(C3=C(C=C(C=C3C=C2O1)OC)OC)O)O
|
|
InChI |
InChI=1S/C16H16O6/c1-16(19)7-10(17)14-12(22-16)5-8-4-9(20-2)6-11(21-3)13(8)15(14)18/h4-6,18-19H,7H2,1-3H3
|
|
InChIKey |
ZYTKFYQKQVYVMW-UHFFFAOYSA-N
|
|
Synonyms |
Fonsecin B; Fonsecin monomethyl ether; 1856-95-7; 2,5-dihydroxy-6,8-dimethoxy-2-methyl-2,3-dihydro-4H-naphtho[2,3-b]pyran-4-one; 5C2V4W4G42; Antibiotic TMC 256B2; 4H-Naphtho(2,3-b)pyran-4-one, 2,3-dihydro-2,5-dihydroxy-6,8-dimethoxy-2-methyl-,; MLS004256125; UNII-5C2V4W4G42; MEGxm0_000069; TMC256B2; ACon0_001057; ACon1_001769; TMC 256B2; TMC-256B2; DTXSID20939984; CHEBI:133825; TMC 256 B2; 2,5-dihydroxy-6,8-dimethoxy-2-methyl-3H-benzo[g]chromen-4-one; NCGC00180161-01; SMR003081010; 2,5-dihydroxy-6,8-dimethoxy-2-methyl-2.3-dihydrobenzo[g]chromen-4-one; 2,5-dihydroxy-6,8-dimethoxy-2-methyl-2,3-dihydro-4H-benzo[g]chromen-4-one; 2,5-DIHYDROXY-6,8-DIMETHOXY-2-METHYL-2H,3H,4H-NAPHTHO[2,3-B]PYRAN-4-ONE
|
|
CAS | 1856-95-7 | |
PubChem CID | 160596 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 304.29 | ALogp: | 2.4 |
HBD: | 2 | HBA: | 6 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 85.2 | Aromatic Rings: | 3 |
Heavy Atoms: | 22 | QED Weighted: | 0.887 |
Caco-2 Permeability: | -4.766 | MDCK Permeability: | 0.00002170 |
Pgp-inhibitor: | 0.056 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.029 | 20% Bioavailability (F20%): | 0.009 |
30% Bioavailability (F30%): | 0.014 |
Blood-Brain-Barrier Penetration (BBB): | 0.213 | Plasma Protein Binding (PPB): | 86.05% |
Volume Distribution (VD): | 1.143 | Fu: | 10.22% |
CYP1A2-inhibitor: | 0.935 | CYP1A2-substrate: | 0.94 |
CYP2C19-inhibitor: | 0.142 | CYP2C19-substrate: | 0.732 |
CYP2C9-inhibitor: | 0.242 | CYP2C9-substrate: | 0.842 |
CYP2D6-inhibitor: | 0.392 | CYP2D6-substrate: | 0.739 |
CYP3A4-inhibitor: | 0.455 | CYP3A4-substrate: | 0.275 |
Clearance (CL): | 12.887 | Half-life (T1/2): | 0.495 |
hERG Blockers: | 0.01 | Human Hepatotoxicity (H-HT): | 0.121 |
Drug-inuced Liver Injury (DILI): | 0.762 | AMES Toxicity: | 0.153 |
Rat Oral Acute Toxicity: | 0.073 | Maximum Recommended Daily Dose: | 0.206 |
Skin Sensitization: | 0.253 | Carcinogencity: | 0.046 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.075 |
Respiratory Toxicity: | 0.286 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001001 | ![]() |
0.773 | D06GCK | ![]() |
0.344 | ||
ENC000962 | ![]() |
0.532 | D07MGA | ![]() |
0.330 | ||
ENC002363 | ![]() |
0.513 | D0C1SF | ![]() |
0.302 | ||
ENC005172 | ![]() |
0.496 | D0G4KG | ![]() |
0.284 | ||
ENC002884 | ![]() |
0.496 | D0L1JW | ![]() |
0.273 | ||
ENC001770 | ![]() |
0.494 | D0D4HN | ![]() |
0.272 | ||
ENC000969 | ![]() |
0.487 | D0W8WB | ![]() |
0.267 | ||
ENC000984 | ![]() |
0.483 | D09GYT | ![]() |
0.266 | ||
ENC000970 | ![]() |
0.475 | D02LZB | ![]() |
0.262 | ||
ENC001504 | ![]() |
0.463 | D0F7CS | ![]() |
0.257 |