![]() |
Name |
5-(Hydroxymethyl)-2(5H)-furanone
|
Molecular Formula | C5H6O3 | |
IUPAC Name* |
2-(hydroxymethyl)-2H-furan-5-one
|
|
SMILES |
C1=CC(=O)OC1CO
|
|
InChI |
InChI=1S/C5H6O3/c6-3-4-1-2-5(7)8-4/h1-2,4,6H,3H2
|
|
InChIKey |
AWNLUIGMHSSXHB-UHFFFAOYSA-N
|
|
Synonyms |
5-(Hydroxymethyl)-2(5H)-furanone; 10374-60-4; 2(5H)-Furanone, 5-(hydroxymethyl)-; 2-(hydroxymethyl)-2H-furan-5-one; L-ERYTHRO-ASCORBATE; (S)-(-)-5-(HYDROXYMETHYL)-2(5H)-FURANONE; (S)-5-Hydroxymethyl-2(5H)-furanone; (S)-5-Hydroxymethyl-2[5H]-furanone; 5-(Hydroxymethyl)furan-2(5H)-one; erythro-ascorbate; SCHEMBL811051; 5-hydroxymethyl-2(5h)-furanone; DTXSID70276396; CHEBI:183113; 2-(hydroxymethyl)-2H-uran-5-one; AKOS015913945; SB45317; 5-(hydroxymethyl)-2,5-dihydrofuran-2-one; DB-060249; FT-0605221; FT-0771760
|
|
CAS | 78508-96-0 | |
PubChem CID | 144863 | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 114.1 | ALogp: | -0.4 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 8 | QED Weighted: | 0.484 |
Caco-2 Permeability: | -4.645 | MDCK Permeability: | 0.00013135 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.073 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.578 |
30% Bioavailability (F30%): | 0.829 |
Blood-Brain-Barrier Penetration (BBB): | 0.092 | Plasma Protein Binding (PPB): | 47.31% |
Volume Distribution (VD): | 1.228 | Fu: | 71.71% |
CYP1A2-inhibitor: | 0.105 | CYP1A2-substrate: | 0.24 |
CYP2C19-inhibitor: | 0.036 | CYP2C19-substrate: | 0.074 |
CYP2C9-inhibitor: | 0.008 | CYP2C9-substrate: | 0.5 |
CYP2D6-inhibitor: | 0.007 | CYP2D6-substrate: | 0.75 |
CYP3A4-inhibitor: | 0.012 | CYP3A4-substrate: | 0.14 |
Clearance (CL): | 10.506 | Half-life (T1/2): | 0.915 |
hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.116 |
Drug-inuced Liver Injury (DILI): | 0.298 | AMES Toxicity: | 0.368 |
Rat Oral Acute Toxicity: | 0.617 | Maximum Recommended Daily Dose: | 0.01 |
Skin Sensitization: | 0.158 | Carcinogencity: | 0.894 |
Eye Corrosion: | 0.117 | Eye Irritation: | 0.983 |
Respiratory Toxicity: | 0.136 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005124 | ![]() |
0.368 | D0Z8EX | ![]() |
0.269 | ||
ENC001883 | ![]() |
0.368 | D07TQV | ![]() |
0.208 | ||
ENC003800 | ![]() |
0.333 | D0Z9QR | ![]() |
0.208 | ||
ENC002189 | ![]() |
0.318 | D07AHW | ![]() |
0.205 | ||
ENC003396 | ![]() |
0.318 | D0Y7DP | ![]() |
0.193 | ||
ENC001433 | ![]() |
0.304 | D07XSN | ![]() |
0.193 | ||
ENC005200 | ![]() |
0.300 | D03UVS | ![]() |
0.186 | ||
ENC002838 | ![]() |
0.300 | D06FDR | ![]() |
0.183 | ||
ENC002163 | ![]() |
0.294 | D0S9SD | ![]() |
0.179 | ||
ENC005531 | ![]() |
0.292 | D0MM2L | ![]() |
0.179 |