|
Name |
Altertoxin II
|
| Molecular Formula | C20H14O6 | |
| IUPAC Name* |
5,10,17-trihydroxy-13-oxahexacyclo[9.8.1.12,6.012,14.016,20.010,21]henicosa-1(20),2(21),3,5,16,18-hexaene-7,15-dione
|
|
| SMILES |
C1CC2(C3C4C(O4)C(=O)C5=C(C=CC(=C35)C6=C2C(=C(C=C6)O)C1=O)O)O
|
|
| InChI |
InChI=1S/C20H14O6/c21-9-4-2-8-7-1-3-10(22)14-12(7)16(18-19(26-18)17(14)24)20(25)6-5-11(23)13(9)15(8)20/h1-4,16,18-19,21-22,25H,5-6H2
|
|
| InChIKey |
UBVHBTLDPUYTDO-UHFFFAOYSA-N
|
|
| Synonyms |
Altertoxin II; 56257-59-1; Stemphyltoxin II; 5,10,17-trihydroxy-13-oxahexacyclo[9.8.1.12,6.012,14.016,20.010,21]henicosa-1(20),2(21),3,5,16,18-hexaene-7,15-dione; CCRIS 2191; BRN 5156144; Perylo(1,2-b)oxirene-7,11-dione, 7a,8a,8b,8c,9,10-hexahydro-1,6,8c-trihydroxy-, (7aR,8aR,8bS,8cR)-; Perylo(1,2-b)oxirene-7,11-dione, 7a,8a,8b,8c,9,10-hexahydro-1,6,8c-trihydroxy-, (7aR-(7aalpha,8aalpha,8bbeta,8calpha))-
|
|
| CAS | 56257-59-1 | |
| PubChem CID | 107702 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 350.3 | ALogp: | 1.9 |
| HBD: | 3 | HBA: | 6 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 107.0 | Aromatic Rings: | 6 |
| Heavy Atoms: | 26 | QED Weighted: | 0.631 |
| Caco-2 Permeability: | -5.147 | MDCK Permeability: | 0.00001240 |
| Pgp-inhibitor: | 0.011 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.108 | 20% Bioavailability (F20%): | 0.027 |
| 30% Bioavailability (F30%): | 0.9 |
| Blood-Brain-Barrier Penetration (BBB): | 0.066 | Plasma Protein Binding (PPB): | 93.50% |
| Volume Distribution (VD): | 0.705 | Fu: | 4.34% |
| CYP1A2-inhibitor: | 0.201 | CYP1A2-substrate: | 0.147 |
| CYP2C19-inhibitor: | 0.173 | CYP2C19-substrate: | 0.06 |
| CYP2C9-inhibitor: | 0.517 | CYP2C9-substrate: | 0.509 |
| CYP2D6-inhibitor: | 0.498 | CYP2D6-substrate: | 0.248 |
| CYP3A4-inhibitor: | 0.534 | CYP3A4-substrate: | 0.181 |
| Clearance (CL): | 1.396 | Half-life (T1/2): | 0.026 |
| hERG Blockers: | 0.032 | Human Hepatotoxicity (H-HT): | 0.175 |
| Drug-inuced Liver Injury (DILI): | 0.912 | AMES Toxicity: | 0.891 |
| Rat Oral Acute Toxicity: | 0.878 | Maximum Recommended Daily Dose: | 0.151 |
| Skin Sensitization: | 0.564 | Carcinogencity: | 0.659 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.369 |
| Respiratory Toxicity: | 0.106 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000835 | ![]() |
0.726 | D01XDL | ![]() |
0.295 | ||
| ENC005389 | ![]() |
0.726 | D0R9WP | ![]() |
0.287 | ||
| ENC003841 | ![]() |
0.698 | D0R6RC | ![]() |
0.282 | ||
| ENC000883 | ![]() |
0.698 | D08LTU | ![]() |
0.280 | ||
| ENC005311 | ![]() |
0.581 | D0H1AR | ![]() |
0.276 | ||
| ENC003652 | ![]() |
0.581 | D0H6QU | ![]() |
0.275 | ||
| ENC003252 | ![]() |
0.581 | D0R3JB | ![]() |
0.273 | ||
| ENC002281 | ![]() |
0.576 | D07JHH | ![]() |
0.272 | ||
| ENC000881 | ![]() |
0.543 | D02GAC | ![]() |
0.269 | ||
| ENC002360 | ![]() |
0.430 | D01XWG | ![]() |
0.266 | ||