|
Name |
daldinone C
|
| Molecular Formula | C20H16O5 | |
| IUPAC Name* |
(2R,11S,12S)-2,7,17-trihydroxypentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(20),3(8),4,6,16,18-hexaene-9,15-dione
|
|
| SMILES |
C1CC(=O)C2=C(C=CC3=C2[C@@H]1[C@H]4[C@@]3(C5=C(C(=O)C4)C(=CC=C5)O)O)O
|
|
| InChI |
InChI=1S/C20H16O5/c21-13-3-1-2-10-18(13)16(24)8-12-9-4-6-14(22)19-15(23)7-5-11(17(9)19)20(10,12)25/h1-3,5,7,9,12,21,23,25H,4,6,8H2/t9-,12-,20-/m0/s1
|
|
| InChIKey |
OYRYUFABCKQXTO-TVLKGPQESA-N
|
|
| Synonyms |
daldinone C; (2R,11S,12S)-2,7,17-Trihydroxypentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(20),3(8),4,6,16,18-hexaene-9,15-dione
|
|
| CAS | NA | |
| PubChem CID | 16104916 | |
| ChEMBL ID | CHEMBL375524 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 336.3 | ALogp: | 2.4 |
| HBD: | 3 | HBA: | 5 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 94.8 | Aromatic Rings: | 5 |
| Heavy Atoms: | 25 | QED Weighted: | 0.685 |
| Caco-2 Permeability: | -5.032 | MDCK Permeability: | 0.00001230 |
| Pgp-inhibitor: | 0.022 | Pgp-substrate: | 0.008 |
| Human Intestinal Absorption (HIA): | 0.754 | 20% Bioavailability (F20%): | 0.977 |
| 30% Bioavailability (F30%): | 0.997 |
| Blood-Brain-Barrier Penetration (BBB): | 0.348 | Plasma Protein Binding (PPB): | 90.88% |
| Volume Distribution (VD): | 0.972 | Fu: | 7.14% |
| CYP1A2-inhibitor: | 0.548 | CYP1A2-substrate: | 0.519 |
| CYP2C19-inhibitor: | 0.566 | CYP2C19-substrate: | 0.097 |
| CYP2C9-inhibitor: | 0.734 | CYP2C9-substrate: | 0.829 |
| CYP2D6-inhibitor: | 0.75 | CYP2D6-substrate: | 0.259 |
| CYP3A4-inhibitor: | 0.62 | CYP3A4-substrate: | 0.336 |
| Clearance (CL): | 0.683 | Half-life (T1/2): | 0.094 |
| hERG Blockers: | 0.036 | Human Hepatotoxicity (H-HT): | 0.227 |
| Drug-inuced Liver Injury (DILI): | 0.739 | AMES Toxicity: | 0.797 |
| Rat Oral Acute Toxicity: | 0.448 | Maximum Recommended Daily Dose: | 0.836 |
| Skin Sensitization: | 0.732 | Carcinogencity: | 0.772 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.191 |
| Respiratory Toxicity: | 0.236 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003960 | ![]() |
0.556 | D0H6QU | ![]() |
0.337 | ||
| ENC002281 | ![]() |
0.543 | D08NQZ | ![]() |
0.328 | ||
| ENC003961 | ![]() |
0.522 | D05AFR | ![]() |
0.301 | ||
| ENC002122 | ![]() |
0.522 | D0J2NK | ![]() |
0.300 | ||
| ENC005389 | ![]() |
0.511 | D07MGA | ![]() |
0.297 | ||
| ENC000835 | ![]() |
0.511 | D0R9WP | ![]() |
0.294 | ||
| ENC003958 | ![]() |
0.490 | D08LTU | ![]() |
0.287 | ||
| ENC003957 | ![]() |
0.490 | D0S0LZ | ![]() |
0.283 | ||
| ENC003959 | ![]() |
0.489 | D0H1AR | ![]() |
0.283 | ||
| ENC003252 | ![]() |
0.455 | D0R6RC | ![]() |
0.268 | ||