|
Name |
[2-(2-Aminopropoxy)-3-methylphenyl]methanol
|
| Molecular Formula | C11H17NO2 | |
| IUPAC Name* |
[2-(2-aminopropoxy)-3-methylphenyl]methanol
|
|
| SMILES |
CC1=C(C(=CC=C1)CO)OCC(C)N
|
|
| InChI |
InChI=1S/C11H17NO2/c1-8-4-3-5-10(6-13)11(8)14-7-9(2)12/h3-5,9,13H,6-7,12H2,1-2H3
|
|
| InChIKey |
XMJYSMLLWRQQAE-UHFFFAOYSA-N
|
|
| Synonyms |
[2-(2-Aminopropoxy)-3-methylphenyl]methanol; 53566-98-6; 2-hydroxymexiletine; Hydroxymethylmexiletine; Benzenemethanol, 2-(2-aminopropoxy)-3-methyl-; 0G7UJL9QZJ; 6-Hydroxymethylmexiletine; (2-(2-AMINOPROPOXY)-3-METHYLPHENYL)METHANOL; UNII-0G7UJL9QZJ; DTXSID00968333; CHEBI:172437; KO-2259; [2-(2-Aminopropoxy)-3-methylphenyl]methanol #
|
|
| CAS | 53566-98-6 | |
| PubChem CID | 93285 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 195.26 | ALogp: | 0.9 |
| HBD: | 2 | HBA: | 3 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 55.5 | Aromatic Rings: | 1 |
| Heavy Atoms: | 14 | QED Weighted: | 0.768 |
| Caco-2 Permeability: | -4.914 | MDCK Permeability: | 0.00003050 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.127 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.003 |
| 30% Bioavailability (F30%): | 0.002 |
| Blood-Brain-Barrier Penetration (BBB): | 0.771 | Plasma Protein Binding (PPB): | 39.95% |
| Volume Distribution (VD): | 2.699 | Fu: | 72.85% |
| CYP1A2-inhibitor: | 0.739 | CYP1A2-substrate: | 0.108 |
| CYP2C19-inhibitor: | 0.025 | CYP2C19-substrate: | 0.653 |
| CYP2C9-inhibitor: | 0.002 | CYP2C9-substrate: | 0.062 |
| CYP2D6-inhibitor: | 0.878 | CYP2D6-substrate: | 0.904 |
| CYP3A4-inhibitor: | 0.036 | CYP3A4-substrate: | 0.421 |
| Clearance (CL): | 8.012 | Half-life (T1/2): | 0.778 |
| hERG Blockers: | 0.063 | Human Hepatotoxicity (H-HT): | 0.206 |
| Drug-inuced Liver Injury (DILI): | 0.029 | AMES Toxicity: | 0.357 |
| Rat Oral Acute Toxicity: | 0.643 | Maximum Recommended Daily Dose: | 0.071 |
| Skin Sensitization: | 0.309 | Carcinogencity: | 0.161 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.019 |
| Respiratory Toxicity: | 0.363 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001315 | ![]() |
0.360 | D0X0RI | ![]() |
0.659 | ||
| ENC000407 | ![]() |
0.340 | D01PJR | ![]() |
0.339 | ||
| ENC003028 | ![]() |
0.340 | D0F2PO | ![]() |
0.290 | ||
| ENC004302 | ![]() |
0.328 | D04JEE | ![]() |
0.278 | ||
| ENC000364 | ![]() |
0.319 | D0W1RY | ![]() |
0.278 | ||
| ENC005504 | ![]() |
0.317 | D0K5CB | ![]() |
0.277 | ||
| ENC006038 | ![]() |
0.302 | D02ZJI | ![]() |
0.277 | ||
| ENC000365 | ![]() |
0.300 | D04EYC | ![]() |
0.273 | ||
| ENC001334 | ![]() |
0.300 | D0U3DU | ![]() |
0.270 | ||
| ENC006137 | ![]() |
0.293 | D05BMG | ![]() |
0.269 | ||