|
Name |
1,2,3-Trimethylbenzene
|
| Molecular Formula | C9H12 | |
| IUPAC Name* |
1,2,3-trimethylbenzene
|
|
| SMILES |
CC1=C(C(=CC=C1)C)C
|
|
| InChI |
InChI=1S/C9H12/c1-7-5-4-6-8(2)9(7)3/h4-6H,1-3H3
|
|
| InChIKey |
FYGHSUNMUKGBRK-UHFFFAOYSA-N
|
|
| Synonyms |
1,2,3-TRIMETHYLBENZENE; 526-73-8; Hemimellitene; Hemellitol; Trimethylbenzene; Hemimellitol; Benzene, 1,2,3-trimethyl-; 25551-13-7; ZK4R7UPH6R; 1,2,3-trimethyl-benzene; CHEBI:34037; NSC-5167; 1,3-Trimethylbenzene; Hemimellitene, 90.5%; Benzene,2,3-trimethyl-; 1,2,3-Trimethylbenzene 100 microg/mL in Methanol; WLN: 1R B1 C1; 1,3-Trimethylbenzene, 90.5%; NSC 5167; 1,2,3-Trimethylbenzene, 90.5%; EINECS 208-394-8; UNII-ZK4R7UPH6R; BRN 1903410; Trimethylbenzene, 1,2,3-; CCRIS 8145; HSDB 7551; 1,2,3-TrimethyIbenzene; DSSTox_CID_27750; HEMIMELLITENE [HSDB]; DSSTox_GSID_47769; 4-05-00-01007 (Beilstein Handbook Reference); BIDD:ER0517; CHEMBL1797279; DTXSID8047769; NSC5167; 1,2,3-TRIMETHYL BENZENE; AMY25707; NSC65599; ZINC1680739; Tox21_303868; MFCD00008520; NSC-65599; AKOS009031505; 1,2,3-Trimethylbenzene (>90per cent); NCGC00357131-01; CAS-526-73-8; 1,2,3-Trimethylbenzene, analytical standard; FT-0606232; T0468; EN300-19373; 1,2,3-Trimethylbenzene, technical grade, 90%; A829196; Q4352416; W-105806; F0001-1357
|
|
| CAS | 526-73-8 | |
| PubChem CID | 10686 | |
| ChEMBL ID | CHEMBL1797279 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 120.19 | ALogp: | 3.6 |
| HBD: | 0 | HBA: | 0 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
| Heavy Atoms: | 9 | QED Weighted: | 0.492 |
| Caco-2 Permeability: | -4.34 | MDCK Permeability: | 0.00002780 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.119 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.683 |
| 30% Bioavailability (F30%): | 0.91 |
| Blood-Brain-Barrier Penetration (BBB): | 0.82 | Plasma Protein Binding (PPB): | 88.84% |
| Volume Distribution (VD): | 1.682 | Fu: | 11.03% |
| CYP1A2-inhibitor: | 0.915 | CYP1A2-substrate: | 0.942 |
| CYP2C19-inhibitor: | 0.702 | CYP2C19-substrate: | 0.903 |
| CYP2C9-inhibitor: | 0.251 | CYP2C9-substrate: | 0.799 |
| CYP2D6-inhibitor: | 0.279 | CYP2D6-substrate: | 0.924 |
| CYP3A4-inhibitor: | 0.193 | CYP3A4-substrate: | 0.464 |
| Clearance (CL): | 11.194 | Half-life (T1/2): | 0.524 |
| hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.056 |
| Drug-inuced Liver Injury (DILI): | 0.108 | AMES Toxicity: | 0.188 |
| Rat Oral Acute Toxicity: | 0.023 | Maximum Recommended Daily Dose: | 0.202 |
| Skin Sensitization: | 0.37 | Carcinogencity: | 0.686 |
| Eye Corrosion: | 0.986 | Eye Irritation: | 0.997 |
| Respiratory Toxicity: | 0.03 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000342 | ![]() |
0.563 | D0X0RI | ![]() |
0.475 | ||
| ENC001334 | ![]() |
0.545 | D01PJR | ![]() |
0.452 | ||
| ENC000179 | ![]() |
0.533 | D0U3DU | ![]() |
0.404 | ||
| ENC000180 | ![]() |
0.500 | D0X4RN | ![]() |
0.373 | ||
| ENC000614 | ![]() |
0.412 | D0WO8W | ![]() |
0.345 | ||
| ENC000239 | ![]() |
0.394 | D0G7DJ | ![]() |
0.322 | ||
| ENC000240 | ![]() |
0.394 | D05FTJ | ![]() |
0.321 | ||
| ENC000365 | ![]() |
0.378 | D09RHQ | ![]() |
0.311 | ||
| ENC000498 | ![]() |
0.378 | D0A0FL | ![]() |
0.297 | ||
| ENC000404 | ![]() |
0.371 | D09QUQ | ![]() |
0.297 | ||