|
Name |
Allyl valerate
|
| Molecular Formula | C8H14O2 | |
| IUPAC Name* |
prop-2-enyl pentanoate
|
|
| SMILES |
CCCCC(=O)OCC=C
|
|
| InChI |
InChI=1S/C8H14O2/c1-3-5-6-8(9)10-7-4-2/h4H,2-3,5-7H2,1H3
|
|
| InChIKey |
PWYXVVREDGESBB-UHFFFAOYSA-N
|
|
| Synonyms |
Allyl valerate; 6321-45-5; Allyl pentanoate; prop-2-enyl pentanoate; allyl n-valerate; Pentanoic acid, 2-propenyl ester; Valeric acid allyl ester; prop-2-en-1-yl pentanoate; YZV641464H; NSC-32631; ALLYLN-VALERATE; allylvalerat; UNII-YZV641464H; Allyl pentanoate #; EINECS 228-675-9; ALLYL VALERATE [FHFI]; SCHEMBL437266; FEMA NO. 4074; DTXSID70212577; CHEBI:180290; NSC32631; ZINC1665012; LMFA07010781; MFCD00078336; NSC 32631; PENTANOIC ACID 2-PROPENYL ESTER; FT-0767086; Q27294812
|
|
| CAS | 6321-45-5 | |
| PubChem CID | 80606 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 142.2 | ALogp: | 2.1 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 6 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
| Heavy Atoms: | 10 | QED Weighted: | 0.435 |
| Caco-2 Permeability: | -4.259 | MDCK Permeability: | 0.00003790 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.001 |
| Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.069 |
| 30% Bioavailability (F30%): | 0.527 |
| Blood-Brain-Barrier Penetration (BBB): | 0.999 | Plasma Protein Binding (PPB): | 69.26% |
| Volume Distribution (VD): | 0.781 | Fu: | 46.56% |
| CYP1A2-inhibitor: | 0.924 | CYP1A2-substrate: | 0.333 |
| CYP2C19-inhibitor: | 0.444 | CYP2C19-substrate: | 0.627 |
| CYP2C9-inhibitor: | 0.096 | CYP2C9-substrate: | 0.746 |
| CYP2D6-inhibitor: | 0.067 | CYP2D6-substrate: | 0.473 |
| CYP3A4-inhibitor: | 0.158 | CYP3A4-substrate: | 0.264 |
| Clearance (CL): | 11.425 | Half-life (T1/2): | 0.897 |
| hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.054 |
| Drug-inuced Liver Injury (DILI): | 0.046 | AMES Toxicity: | 0.144 |
| Rat Oral Acute Toxicity: | 0.885 | Maximum Recommended Daily Dose: | 0.029 |
| Skin Sensitization: | 0.807 | Carcinogencity: | 0.596 |
| Eye Corrosion: | 0.932 | Eye Irritation: | 0.98 |
| Respiratory Toxicity: | 0.174 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000371 | ![]() |
0.594 | D0AY9Q | ![]() |
0.327 | ||
| ENC000718 | ![]() |
0.475 | D01QLH | ![]() |
0.289 | ||
| ENC000655 | ![]() |
0.463 | D0Z5BC | ![]() |
0.260 | ||
| ENC000245 | ![]() |
0.459 | D0Y3KG | ![]() |
0.233 | ||
| ENC000235 | ![]() |
0.457 | D0OL6O | ![]() |
0.233 | ||
| ENC000228 | ![]() |
0.439 | D0Y4AW | ![]() |
0.222 | ||
| ENC000226 | ![]() |
0.412 | D02HXS | ![]() |
0.220 | ||
| ENC000232 | ![]() |
0.412 | D0R3QY | ![]() |
0.220 | ||
| ENC000758 | ![]() |
0.400 | D0G2KD | ![]() |
0.219 | ||
| ENC001253 | ![]() |
0.400 | D0EP8X | ![]() |
0.216 | ||