|
Name |
3-Methylbutyl pentanoate
|
| Molecular Formula | C10H20O2 | |
| IUPAC Name* |
3-methylbutyl pentanoate
|
|
| SMILES |
CCCCC(=O)OCCC(C)C
|
|
| InChI |
InChI=1S/C10H20O2/c1-4-5-6-10(11)12-8-7-9(2)3/h9H,4-8H2,1-3H3
|
|
| InChIKey |
UBLAMKHIFZBBSS-UHFFFAOYSA-N
|
|
| Synonyms |
Isoamyl valerate; 2050-09-1; Isopentyl valerate; 3-Methylbutyl pentanoate; Pentanoic acid, 3-methylbutyl ester; Isopentyl pentanoate; 3-Methylbutyl valerate; Irishmoss; Valeric acid, 3-methylbutyl ester; Valeric Acid Isoamyl Ester; iso-Amyl N-valerate; 7HQJ459H95; NSC-7006; Isopentyl pentanoate #; starbld0016507; Isopentyl valerate, 8CI; ISOAMYL N-VALERATE; Valeric Acid Isopentyl Ester; UNII-7HQJ459H95; 3-Methylbutyl pentanoate, 9CI; SCHEMBL1305063; (3-methyl-1-butyl) pentanoate; DTXSID70174484; NSC7006; CHEBI:179541; ISOPENTYL ALCOHOL, VALERATE; CAA05009; NSC 7006; ZINC1566492; EINECS 218-081-8; 3-METHYL-1-BUTYL N-VALERATE; LMFA07010762; MFCD00085198; VALERIC ACID, ISOPENTYL ESTER; AKOS028108467; AI3-24391; FT-0627335; I0897; D91212; Q27268318
|
|
| CAS | 2050-09-1 | |
| PubChem CID | 74901 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 172.26 | ALogp: | 3.2 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
| Heavy Atoms: | 12 | QED Weighted: | 0.573 |
| Caco-2 Permeability: | -4.267 | MDCK Permeability: | 0.00003120 |
| Pgp-inhibitor: | 0.036 | Pgp-substrate: | 0.002 |
| Human Intestinal Absorption (HIA): | 0.002 | 20% Bioavailability (F20%): | 0.091 |
| 30% Bioavailability (F30%): | 0.509 |
| Blood-Brain-Barrier Penetration (BBB): | 0.787 | Plasma Protein Binding (PPB): | 87.21% |
| Volume Distribution (VD): | 0.582 | Fu: | 12.01% |
| CYP1A2-inhibitor: | 0.972 | CYP1A2-substrate: | 0.396 |
| CYP2C19-inhibitor: | 0.752 | CYP2C19-substrate: | 0.641 |
| CYP2C9-inhibitor: | 0.731 | CYP2C9-substrate: | 0.881 |
| CYP2D6-inhibitor: | 0.014 | CYP2D6-substrate: | 0.091 |
| CYP3A4-inhibitor: | 0.104 | CYP3A4-substrate: | 0.214 |
| Clearance (CL): | 12.281 | Half-life (T1/2): | 0.772 |
| hERG Blockers: | 0.041 | Human Hepatotoxicity (H-HT): | 0.03 |
| Drug-inuced Liver Injury (DILI): | 0.121 | AMES Toxicity: | 0.006 |
| Rat Oral Acute Toxicity: | 0.059 | Maximum Recommended Daily Dose: | 0.017 |
| Skin Sensitization: | 0.784 | Carcinogencity: | 0.311 |
| Eye Corrosion: | 0.966 | Eye Irritation: | 0.984 |
| Respiratory Toxicity: | 0.185 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000231 | ![]() |
0.794 | D0AY9Q | ![]() |
0.370 | ||
| ENC000227 | ![]() |
0.657 | D0Y3KG | ![]() |
0.289 | ||
| ENC001015 | ![]() |
0.649 | D0G2KD | ![]() |
0.288 | ||
| ENC000228 | ![]() |
0.641 | D01QLH | ![]() |
0.286 | ||
| ENC000645 | ![]() |
0.558 | D05PLH | ![]() |
0.274 | ||
| ENC000371 | ![]() |
0.556 | D0Q7ZQ | ![]() |
0.273 | ||
| ENC000245 | ![]() |
0.553 | D08HQK | ![]() |
0.269 | ||
| ENC000655 | ![]() |
0.548 | D0ZK8H | ![]() |
0.268 | ||
| ENC000448 | ![]() |
0.537 | D00WUF | ![]() |
0.250 | ||
| ENC000603 | ![]() |
0.528 | D0ZI4H | ![]() |
0.247 | ||