![]() |
Name |
2',6'-Dihydroxyacetophenone
|
Molecular Formula | C8H8O3 | |
IUPAC Name* |
1-(2,6-dihydroxyphenyl)ethanone
|
|
SMILES |
CC(=O)C1=C(C=CC=C1O)O
|
|
InChI |
InChI=1S/C8H8O3/c1-5(9)8-6(10)3-2-4-7(8)11/h2-4,10-11H,1H3
|
|
InChIKey |
YPTJKHVBDCRKNF-UHFFFAOYSA-N
|
|
Synonyms |
2',6'-Dihydroxyacetophenone; 699-83-2; 1-(2,6-Dihydroxyphenyl)ethanone; 2,6-Dihydroxyacetophenone; 2-Acetylresorcinol; Resorcinol, 2-acetyl-; Ethanone, 1-(2,6-dihydroxyphenyl)-; 1-(2,6-dihydroxyphenyl)ethan-1-one; 2,6-dihydroxy acetophenone; gamma-Resacetophenone; 1,3-Benzenediol, 2-acetyl-; .gamma.-Resacetophenone; Acetophenone, 2',6'-dihydroxy-; MFCD00002270; NSC 615; 2, 6-Dihydroxyacetophenone; Acetyl-2,6-dihydroxybenzene; 2',6'-dihydroxy-acetophenone; CHEMBL454739; 2-Acetyl-1,3-dihydroxybenzene; NSC-615; 88BO51G3Y2; 1-(2,6-dihydroxyphenyl)-ethanone; 1-(2,6-dihydroxy-phenyl)-ethanone; 1-[2,6-bis(oxidanyl)phenyl]ethanone; 1-(2,6-Dihydroxyphenyl)ethanone (2',6'-Dihydroxyacetophenone); UNII-88BO51G3Y2; EINECS 211-833-6; 2-Acetyl-Resorcinol; mono acetyl resorcinol; 2-ACETYL RESORCINOL; EC 211-833-6; Acetophenone,6'-dihydroxy-; 2-Acetyl-1,3-Benzenediol; dihydroxyacetophenone(2,6-); 2`,6`-Dihydroxyacetophenone; Ethanone,6-dihydroxyphenyl)-; BIDD:ER0607; SCHEMBL105807; 2',6'-dihydroxy acetophenone; NSC615; (2',6'-dihydroxy)acetophenone; 2'',6''-dihydroxyacetophenone; 2\',6\'-Dihydroxyacetophenone; laquo gammaRaquo -resacetophenone; YPTJKHVBDCRKNF-UHFFFAOYSA-; DTXSID00220185; CHEBI:173644; ZINC157768; ACT00503; AMY21894; HY-Y0106; 2',6'-Dihydroxyacetophenone, 97%; BDBM50249071; CK2557; STL195537; ACETOPHENONE, 2,6-DIHYDROXY-; AKOS000299253; CS-W019984; FS-2546; 1-(2,6-Dihydroxyphenyl)ethanone, 9CI; NCGC00166008-01; AC-10724; Acetophenone, 2',6'-dihydroxy- (8CI); SY001633; DB-020214; D1716; FT-0610665; Ethanone, 1-(2,6-dihydroxyphenyl)- (9CI); 99D832; D-3400; EN300-114470; A836723; AB-131/40185723; SODIUM CROMOGLICATE IMPURITY A [EP IMPURITY]; W-203531; Q27269919; Z1255485184; 2',6'-Dihydroxyacetophenone, matrix substance for MALDI-MS, >=99.5%; 2 inverted exclamation mark ,6 inverted exclamation mark -Dihydroxyacetophenone; 2',6'-Dihydroxyacetophenone, matrix substance for MALDI-MS, >=99.5% (HPLC), Ultra pure; 9EQ
|
|
CAS | 699-83-2 | |
PubChem CID | 69687 | |
ChEMBL ID | CHEMBL454739 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 152.15 | ALogp: | 1.4 |
HBD: | 2 | HBA: | 3 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 57.5 | Aromatic Rings: | 1 |
Heavy Atoms: | 11 | QED Weighted: | 0.603 |
Caco-2 Permeability: | -4.607 | MDCK Permeability: | 0.00001730 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.326 |
30% Bioavailability (F30%): | 0.149 |
Blood-Brain-Barrier Penetration (BBB): | 0.187 | Plasma Protein Binding (PPB): | 87.58% |
Volume Distribution (VD): | 0.775 | Fu: | 17.57% |
CYP1A2-inhibitor: | 0.92 | CYP1A2-substrate: | 0.549 |
CYP2C19-inhibitor: | 0.227 | CYP2C19-substrate: | 0.066 |
CYP2C9-inhibitor: | 0.314 | CYP2C9-substrate: | 0.842 |
CYP2D6-inhibitor: | 0.569 | CYP2D6-substrate: | 0.415 |
CYP3A4-inhibitor: | 0.428 | CYP3A4-substrate: | 0.194 |
Clearance (CL): | 10.327 | Half-life (T1/2): | 0.846 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.045 |
Drug-inuced Liver Injury (DILI): | 0.599 | AMES Toxicity: | 0.579 |
Rat Oral Acute Toxicity: | 0.566 | Maximum Recommended Daily Dose: | 0.03 |
Skin Sensitization: | 0.84 | Carcinogencity: | 0.667 |
Eye Corrosion: | 0.912 | Eye Irritation: | 0.992 |
Respiratory Toxicity: | 0.878 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001513 | ![]() |
0.641 | D07HBX | ![]() |
0.400 | ||
ENC002350 | ![]() |
0.610 | D0V9EN | ![]() |
0.362 | ||
ENC002237 | ![]() |
0.595 | D0BA6T | ![]() |
0.360 | ||
ENC004796 | ![]() |
0.568 | D0U0OT | ![]() |
0.353 | ||
ENC000390 | ![]() |
0.568 | D0C4YC | ![]() |
0.349 | ||
ENC000404 | ![]() |
0.559 | D01WJL | ![]() |
0.349 | ||
ENC000060 | ![]() |
0.514 | D08HVR | ![]() |
0.347 | ||
ENC000344 | ![]() |
0.487 | D0P7JZ | ![]() |
0.340 | ||
ENC000021 | ![]() |
0.457 | D0I3RO | ![]() |
0.333 | ||
ENC002213 | ![]() |
0.422 | D0Y6KO | ![]() |
0.316 |