|
Name |
2-Acetylfuran
|
| Molecular Formula | C6H6O2 | |
| IUPAC Name* |
1-(furan-2-yl)ethanone
|
|
| SMILES |
CC(=O)C1=CC=CO1
|
|
| InChI |
InChI=1S/C6H6O2/c1-5(7)6-3-2-4-8-6/h2-4H,1H3
|
|
| InChIKey |
IEMMBWWQXVXBEU-UHFFFAOYSA-N
|
|
| Synonyms |
2-Acetylfuran; 1192-62-7; 1-(furan-2-yl)ethanone; Acetylfuran; 2-Furyl methyl ketone; 2-Acetyl furan; Methyl 2-furyl ketone; 1-(2-Furyl)ethanone; 2-Furylethanone; Ketone, 2-furyl methyl; 1-Furan-2-yl-ethanone; Ethanone, 1-(2-furanyl)-; 1-(2-FURANYL)ETHANONE; Furyl methyl ketone; 1-(Furan-2-yl)ethan-1-one; Furan, 2-acetyl-; 2-acetylfurane; (2-furanyl)-1-ethanone; FEMA No. 3163; 1-(2-Furanyl)-ethanone; Ethanone, 1-(furanyl)-; 2-acetyl-furan; Q5ZRP80K02; CHEBI:59983; NSC-4665; NSC-49133; acetyl furan; CCRIS 3161; 2-Furyl methyl ketone (natural); NSC 4665; EINECS 214-757-1; NSC 49133; BRN 0107909; UNII-Q5ZRP80K02; AI3-23586; 2-Acetofurone; MFCD00003242; a-Furyl methyl ketone; methyl-2-furyl ketone; 1-(2-Furyl)ethanone #; Epitope ID:136039; 1-(furan-2-yl)-ethanone; SCHEMBL43960; 5-17-09-00381 (Beilstein Handbook Reference); 2-ACETYLFURAN [FHFI]; 2-Furyl methyl ketone, 99%; 1-(2-Furanyl)ethanone, 9CI; DTXSID0051601; FEMA 3163; NSC4665; ZINC157401; NSC49133; STR05504; 1-(2-furyl)ethanone;2-Acetylfuran; 2-FURYL METHYL KETONE [FCC]; STK400329; 1-(2-furanyl)ethanone (acetylfuran); AKOS000119584; 2-Furyl methyl ketone, >=99%, FG; AM91073; CS-W016628; HY-W015912; PS-4586; SB60920; 1-(2-Furanyl)-ethanone (2-acetylfuran); 80145-44-4; AC-11853; 2-Furyl methyl ketone, analytical standard; DB-003253; A0091; FT-0610977; EN300-20230; 2-Furyl methyl ketone, purum, >=99.0% (GC); A804234; 2-Furyl methyl ketone, natural (US), >=97%, FG; Q-100089; Q15634156; F0001-0316; 2-Aminomethyl-azetidine-1-carboxylic acid tert-butylester
|
|
| CAS | 1192-62-7 | |
| PubChem CID | 14505 | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 110.11 | ALogp: | 0.5 |
| HBD: | 0 | HBA: | 2 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 30.2 | Aromatic Rings: | 1 |
| Heavy Atoms: | 8 | QED Weighted: | 0.517 |
| Caco-2 Permeability: | -4.383 | MDCK Permeability: | 0.00002930 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.021 |
| Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.003 |
| 30% Bioavailability (F30%): | 0.005 |
| Blood-Brain-Barrier Penetration (BBB): | 0.416 | Plasma Protein Binding (PPB): | 82.45% |
| Volume Distribution (VD): | 1.43 | Fu: | 39.14% |
| CYP1A2-inhibitor: | 0.94 | CYP1A2-substrate: | 0.684 |
| CYP2C19-inhibitor: | 0.523 | CYP2C19-substrate: | 0.182 |
| CYP2C9-inhibitor: | 0.072 | CYP2C9-substrate: | 0.196 |
| CYP2D6-inhibitor: | 0.011 | CYP2D6-substrate: | 0.311 |
| CYP3A4-inhibitor: | 0.009 | CYP3A4-substrate: | 0.233 |
| Clearance (CL): | 8.051 | Half-life (T1/2): | 0.844 |
| hERG Blockers: | 0.087 | Human Hepatotoxicity (H-HT): | 0.082 |
| Drug-inuced Liver Injury (DILI): | 0.286 | AMES Toxicity: | 0.35 |
| Rat Oral Acute Toxicity: | 0.951 | Maximum Recommended Daily Dose: | 0.032 |
| Skin Sensitization: | 0.118 | Carcinogencity: | 0.887 |
| Eye Corrosion: | 0.941 | Eye Irritation: | 0.994 |
| Respiratory Toxicity: | 0.923 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000162 | ![]() |
0.630 | D0GY5Z | ![]() |
0.239 | ||
| ENC001133 | ![]() |
0.567 | D0U5QK | ![]() |
0.238 | ||
| ENC001839 | ![]() |
0.429 | D06NVJ | ![]() |
0.237 | ||
| ENC000190 | ![]() |
0.400 | D0X9RY | ![]() |
0.237 | ||
| ENC000163 | ![]() |
0.375 | D06REO | ![]() |
0.227 | ||
| ENC000678 | ![]() |
0.355 | D07HBX | ![]() |
0.225 | ||
| ENC000189 | ![]() |
0.355 | D0PQ3G | ![]() |
0.215 | ||
| ENC000640 | ![]() |
0.353 | D0WV3U | ![]() |
0.214 | ||
| ENC000192 | ![]() |
0.343 | D0O2WB | ![]() |
0.213 | ||
| ENC000546 | ![]() |
0.333 | D0Y2IE | ![]() |
0.212 | ||