![]() |
Name |
2-Methylbutyl acetate
|
Molecular Formula | C7H14O2 | |
IUPAC Name* |
2-methylbutyl acetate
|
|
SMILES |
CCC(C)COC(=O)C
|
|
InChI |
InChI=1S/C7H14O2/c1-4-6(2)5-9-7(3)8/h6H,4-5H2,1-3H3
|
|
InChIKey |
XHIUFYZDQBSEMF-UHFFFAOYSA-N
|
|
Synonyms |
2-METHYLBUTYL ACETATE; 624-41-9; 2-Methyl-1-butyl acetate; 1-Butanol, 2-methyl-, acetate; Acetic acid 2-methylbutyl ester; 2-methyl-1-butanol acetate; 1-Butanol, 2-methyl-, 1-acetate; 2-methyl butyl acetate; FEMA No. 3644; 2-methylbutanol acetate; Active amyl acetate; 2-Methybutyl acetate; IY8732E0YC; CHEBI:50585; 2-Methylbutyl acetate (natural); EINECS 210-843-8; UNII-IY8732E0YC; starbld0000221; Aceticacidmethylbutylester; DSSTox_CID_7254; DSSTox_RID_78371; DSSTox_GSID_27254; Nat.d-2-Methylbutyl Acetate; SCHEMBL309720; CHEMBL3188103; DTXSID2027254; FEMA 3644; XHIUFYZDQBSEMF-UHFFFAOYSA-; 2-Methylbutyl acetate, 99%, FG; 2-METHYLBUTYL ACETATE [FCC]; Tox21_200883; MFCD00040494; 2-METHYLBUTYL ACETATE [FHFI]; AKOS015902767; (+/-)-2-METHYLBUTYL ACETATE; NCGC00248864-01; NCGC00258437-01; 2-METHYLBUTYL ACETATE, (+/-)-; CAS-624-41-9; LS-13346; 2-Methylbutyl acetate, analytical standard; 2-Methylbutyl Acetate (Active Amyl Acetate); A1076; CS-0454341; FT-0628830; 2-Methylbutyl acetate, natural, >=95%, FG
|
|
CAS | 624-41-9 | |
PubChem CID | 12209 | |
ChEMBL ID | CHEMBL3188103 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 130.18 | ALogp: | 2.1 |
HBD: | 0 | HBA: | 2 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 26.3 | Aromatic Rings: | 0 |
Heavy Atoms: | 9 | QED Weighted: | 0.547 |
Caco-2 Permeability: | -4.277 | MDCK Permeability: | 0.00002940 |
Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.048 |
30% Bioavailability (F30%): | 0.353 |
Blood-Brain-Barrier Penetration (BBB): | 0.997 | Plasma Protein Binding (PPB): | 38.04% |
Volume Distribution (VD): | 1.021 | Fu: | 71.48% |
CYP1A2-inhibitor: | 0.624 | CYP1A2-substrate: | 0.12 |
CYP2C19-inhibitor: | 0.08 | CYP2C19-substrate: | 0.783 |
CYP2C9-inhibitor: | 0.036 | CYP2C9-substrate: | 0.147 |
CYP2D6-inhibitor: | 0.044 | CYP2D6-substrate: | 0.219 |
CYP3A4-inhibitor: | 0.022 | CYP3A4-substrate: | 0.281 |
Clearance (CL): | 7.166 | Half-life (T1/2): | 0.749 |
hERG Blockers: | 0.014 | Human Hepatotoxicity (H-HT): | 0.037 |
Drug-inuced Liver Injury (DILI): | 0.222 | AMES Toxicity: | 0.024 |
Rat Oral Acute Toxicity: | 0.042 | Maximum Recommended Daily Dose: | 0.022 |
Skin Sensitization: | 0.713 | Carcinogencity: | 0.555 |
Eye Corrosion: | 0.949 | Eye Irritation: | 0.984 |
Respiratory Toxicity: | 0.159 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000819 | ![]() |
0.594 | D0ZK8H | ![]() |
0.483 | ||
ENC000246 | ![]() |
0.593 | D0Q9HF | ![]() |
0.371 | ||
ENC000225 | ![]() |
0.536 | D0Q6DX | ![]() |
0.348 | ||
ENC000211 | ![]() |
0.486 | D04MWJ | ![]() |
0.316 | ||
ENC001138 | ![]() |
0.484 | D02KBD | ![]() |
0.280 | ||
ENC000603 | ![]() |
0.484 | D0U7BW | ![]() |
0.263 | ||
ENC000312 | ![]() |
0.462 | D07ZTO | ![]() |
0.250 | ||
ENC005511 | ![]() |
0.438 | D0FM2P | ![]() |
0.250 | ||
ENC000602 | ![]() |
0.419 | D05PLH | ![]() |
0.228 | ||
ENC000182 | ![]() |
0.407 | D0M1PQ | ![]() |
0.225 |