![]() |
Name |
2-Undecanone
|
Molecular Formula | C11H22O | |
IUPAC Name* |
undecan-2-one
|
|
SMILES |
CCCCCCCCCC(=O)C
|
|
InChI |
InChI=1S/C11H22O/c1-3-4-5-6-7-8-9-10-11(2)12/h3-10H2,1-2H3
|
|
InChIKey |
KYWIYKKSMDLRDC-UHFFFAOYSA-N
|
|
Synonyms |
2-Undecanone; Undecan-2-one; Methyl nonyl ketone; 112-12-9; 2-Hendecanone; UNDECANONE; Rue ketone; Ketone, methyl nonyl; Nonyl methyl ketone; Methylnonylketone; METHYL N-NONYL KETONE; 2-Oxoundecane; MGK Dog and Cat Repellent; FEMA No. 3093; Undecanone-(2); Mgk dog & cat repellent; YV5DSO8CY9; CHEBI:17700; NSC4028; NSC-4028; 53452-70-3; Caswell No. 573O; 2-Undecanone (natural); BioUD; HSDB 7431; NSC 4028; EINECS 203-937-5; UNII-YV5DSO8CY9; MFCD00009583; EPA Pesticide Chemical Code 044102; BRN 1749573; Luparone; Enodyl; AI3-03081; methyl n-nonylketone; Methyl-n-nonylketone; MGK dog AMP MNK; 2-Undecanone, 99%; 2-Methylundecanone,(S); Methyl Nonyl Ketone FCC; UNDECANONE, 2-; DSSTox_CID_1943; MOSTIQUE EGX 101; DSSTox_RID_76418; 2-UNDECANONE [FCC]; DSSTox_GSID_21943; 2-UNDECANONE [FHFI]; 2-UNDECANONE [HSDB]; SCHEMBL117635; SCHEMBL249443; WLN: 9V1; CHEMBL1236582; DTXSID2021943; FEMA 3093; METHYL NONYL KETONE [MI]; 2-Undecanone, analytical standard; 2-Undecanone, natural, FCC, FG; ZINC1529305; Tox21_301385; BBL011441; LMFA12000002; s3762; STL146552; 2-Undecanone, >=98%, FCC, FG; AKOS005720838; CCG-266363; CS-W017685; DB08688; HY-W016969; NCGC00164003-01; NCGC00255160-01; CAS-112-12-9; VS-02950; FT-0613466; U0006; C01875; EN300-170519; F17694; A802493; Q-201393; Q2024187
|
|
CAS | 112-12-9 | |
PubChem CID | 8163 | |
ChEMBL ID | CHEMBL1236582 |
Chemical Classification: |
|
|
---|
Molecular Weight: | 170.29 | ALogp: | 4.1 |
HBD: | 0 | HBA: | 1 |
Rotatable Bonds: | 8 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 17.1 | Aromatic Rings: | 0 |
Heavy Atoms: | 12 | QED Weighted: | 0.493 |
Caco-2 Permeability: | -4.512 | MDCK Permeability: | 0.00001590 |
Pgp-inhibitor: | 0.128 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.005 | 20% Bioavailability (F20%): | 0.996 |
30% Bioavailability (F30%): | 0.996 |
Blood-Brain-Barrier Penetration (BBB): | 0.99 | Plasma Protein Binding (PPB): | 94.15% |
Volume Distribution (VD): | 0.956 | Fu: | 5.38% |
CYP1A2-inhibitor: | 0.892 | CYP1A2-substrate: | 0.685 |
CYP2C19-inhibitor: | 0.516 | CYP2C19-substrate: | 0.482 |
CYP2C9-inhibitor: | 0.336 | CYP2C9-substrate: | 0.936 |
CYP2D6-inhibitor: | 0.024 | CYP2D6-substrate: | 0.374 |
CYP3A4-inhibitor: | 0.063 | CYP3A4-substrate: | 0.106 |
Clearance (CL): | 5.928 | Half-life (T1/2): | 0.606 |
hERG Blockers: | 0.096 | Human Hepatotoxicity (H-HT): | 0.02 |
Drug-inuced Liver Injury (DILI): | 0.122 | AMES Toxicity: | 0.006 |
Rat Oral Acute Toxicity: | 0.036 | Maximum Recommended Daily Dose: | 0.031 |
Skin Sensitization: | 0.768 | Carcinogencity: | 0.075 |
Eye Corrosion: | 0.988 | Eye Irritation: | 0.963 |
Respiratory Toxicity: | 0.328 |