|
Name |
p-Xylene
|
| Molecular Formula | C8H10 | |
| IUPAC Name* |
1,4-xylene
|
|
| SMILES |
CC1=CC=C(C=C1)C
|
|
| InChI |
InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3
|
|
| InChIKey |
URLKBWYHVLBVBO-UHFFFAOYSA-N
|
|
| Synonyms |
P-XYLENE; 1,4-Dimethylbenzene; Para-Xylene; 1,4-Xylene; 106-42-3; p-Methyltoluene; p-Dimethylbenzene; p-Xylol; Benzene, 1,4-dimethyl-; 4-Xylene; 4-Methyltoluene; Chromar; Scintillar; 1,4-Dimethylbenzol; NSC 72419; CHEMBL31561; 6WAC1O477V; CHEBI:27417; NSC-72419; 68650-36-2; Xylene, p-; Benzene, p-dimethyl-; paraxylene; p-Xylenes; Xylene, p-isomer; PXY; CCRIS 910; HSDB 136; EINECS 203-396-5; UNII-6WAC1O477V; AI3-52255; MFCD00008556; PARA XYLENE; 1,4-dimethyl benzene; 1,4-dimethyl-benzene; DSSTox_CID_1868; P-XYLENE [MI]; 4-XYLENE [HSDB]; bmse000834; EC 203-396-5; DSSTox_RID_76374; DSSTox_GSID_21868; p-Xylene, analytical standard; BENZENE,1,4-DIMETHYL; WLN: 1R D1; p-Xylene, anhydrous, >=99%; DTXSID2021868; p-Xylene, for synthesis, 99%; 187l; p-Xylene, for HPLC, >=99%; ZINC968254; p-Xylene, ReagentPlus(R), 99%; NSC72419; p-Xylene 10 microg/mL in Methanol; Tox21_201113; BDBM50008567; Benzene, 1,2(or 1,4)-dimethyl-; c0083; STL264212; AKOS000121124; p-Xylene 5000 microg/mL in Methanol; p-Xylene, purum, >=98.0% (GC); NCGC00091661-01; NCGC00091661-02; NCGC00258665-01; 68411-39-2; CAS-106-42-3; p-Xylene, SAJ first grade, >=99.0%; p-Xylene [UN1307] [Flammable liquid]; p-Xylene, SAJ special grade, >=99.0%; FT-0689271; S0649; X0014; X0044; EN300-24549; p-Xylene, puriss. p.a., >=99.0% (GC); C06756; J-001588; J-524068; Q3314420; F0001-0120; Z199056432; p-Xylene, Pharmaceutical Secondary Standard; Certified Reference Material; 136777-61-2; 25951-90-0
|
|
| CAS | 106-42-3 | |
| PubChem CID | 7809 | |
| ChEMBL ID | CHEMBL31561 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 106.16 | ALogp: | 3.2 |
| HBD: | 0 | HBA: | 0 |
| Rotatable Bonds: | 0 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 0.0 | Aromatic Rings: | 1 |
| Heavy Atoms: | 8 | QED Weighted: | 0.477 |
| Caco-2 Permeability: | -4.263 | MDCK Permeability: | 0.00002430 |
| Pgp-inhibitor: | 0.001 | Pgp-substrate: | 0.005 |
| Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.2 |
| 30% Bioavailability (F30%): | 0.034 |
| Blood-Brain-Barrier Penetration (BBB): | 0.93 | Plasma Protein Binding (PPB): | 88.92% |
| Volume Distribution (VD): | 2.438 | Fu: | 11.67% |
| CYP1A2-inhibitor: | 0.941 | CYP1A2-substrate: | 0.943 |
| CYP2C19-inhibitor: | 0.891 | CYP2C19-substrate: | 0.879 |
| CYP2C9-inhibitor: | 0.351 | CYP2C9-substrate: | 0.676 |
| CYP2D6-inhibitor: | 0.168 | CYP2D6-substrate: | 0.906 |
| CYP3A4-inhibitor: | 0.063 | CYP3A4-substrate: | 0.576 |
| Clearance (CL): | 11.126 | Half-life (T1/2): | 0.632 |
| hERG Blockers: | 0.057 | Human Hepatotoxicity (H-HT): | 0.084 |
| Drug-inuced Liver Injury (DILI): | 0.086 | AMES Toxicity: | 0.033 |
| Rat Oral Acute Toxicity: | 0.058 | Maximum Recommended Daily Dose: | 0.05 |
| Skin Sensitization: | 0.31 | Carcinogencity: | 0.59 |
| Eye Corrosion: | 0.979 | Eye Irritation: | 0.996 |
| Respiratory Toxicity: | 0.056 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC000086 | ![]() |
0.571 | D06OIV | ![]() |
0.315 | ||
| ENC000221 | ![]() |
0.567 | D06GIP | ![]() |
0.308 | ||
| ENC000199 | ![]() |
0.531 | D0X0WU | ![]() |
0.304 | ||
| ENC000392 | ![]() |
0.474 | D0T1WN | ![]() |
0.303 | ||
| ENC000239 | ![]() |
0.467 | D09BHB | ![]() |
0.298 | ||
| ENC000180 | ![]() |
0.394 | D03UOT | ![]() |
0.294 | ||
| ENC000179 | ![]() |
0.375 | D02WCI | ![]() |
0.292 | ||
| ENC000772 | ![]() |
0.370 | D06CDO | ![]() |
0.279 | ||
| ENC000796 | ![]() |
0.370 | D0U5QK | ![]() |
0.268 | ||
| ENC000649 | ![]() |
0.361 | D0Y7PG | ![]() |
0.267 | ||