![]() |
Name |
(+)-delta-Cadinene
|
Molecular Formula | C15H24 | |
IUPAC Name* |
(1S,8aR)-4,7-dimethyl-1-propan-2-yl-1,2,3,5,6,8a-hexahydronaphthalene
|
|
SMILES |
CC1=C[C@H]2[C@@H](CCC(=C2CC1)C)C(C)C
|
|
InChI |
InChI=1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h9-10,13,15H,5-8H2,1-4H3/t13-,15-/m0/s1
|
|
InChIKey |
FUCYIEXQVQJBKY-ZFWWWQNUSA-N
|
|
Synonyms |
(+)-delta-Cadinene; 483-76-1; DELTA-CADINENE; (+)-D-Cadinene; (1S,8aR)-1-Isopropyl-4,7-dimethyl-1,2,3,5,6,8a-hexahydronaphthalene; D-Cadinene; Cadina-1(10),4-diene; CHEBI:15385; 7848KI47OS; (1S,8aR)-4,7-dimethyl-1-propan-2-yl-1,2,3,5,6,8a-hexahydronaphthalene; (1S,8aR)-4,7-dimethyl-1-(propan-2-yl)-1,2,3,5,6,8a-hexahydronaphthalene; .delta.-Cadinene, (+)-; delta-Amorphene; UNII-7848KI47OS; (1S,8aR)-delta-cadinene; CADINENE, .DELTA.-; CHEMBL445759; FEMA NO. 4967; (+)-1(10),4-Cadinadiene; DTXSID70858792; ZINC8220462; LMPR0103330001; (+)-1S,8aR-Cadina-1(10),4-diene; C3734; C06394; Q27089406; NAPHTHALENE, DECAHYDRO-1,6-DIMETHYL-4- (1-METHYLETHYL); (1S,8aR)-1-isopropyl-4,7-di-methyl-1,2,3,5,6,8a-hexahydronaphthalene; 1,2,3,5,6,8a-Hexahydro-4,7-dimethyl-1-(1-methylethyl)-(1S,8aR)-Naphthalene
|
|
CAS | 483-76-1 | |
PubChem CID | 441005 | |
ChEMBL ID | CHEMBL445759 |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 204.35 | ALogp: | 3.8 |
HBD: | 0 | HBA: | 0 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 0.0 | Aromatic Rings: | 2 |
Heavy Atoms: | 15 | QED Weighted: | 0.518 |
Caco-2 Permeability: | -4.495 | MDCK Permeability: | 0.00001530 |
Pgp-inhibitor: | 0.987 | Pgp-substrate: | 0.004 |
Human Intestinal Absorption (HIA): | 0.004 | 20% Bioavailability (F20%): | 0.981 |
30% Bioavailability (F30%): | 0.872 |
Blood-Brain-Barrier Penetration (BBB): | 0.06 | Plasma Protein Binding (PPB): | 95.72% |
Volume Distribution (VD): | 6.551 | Fu: | 2.36% |
CYP1A2-inhibitor: | 0.559 | CYP1A2-substrate: | 0.477 |
CYP2C19-inhibitor: | 0.478 | CYP2C19-substrate: | 0.885 |
CYP2C9-inhibitor: | 0.693 | CYP2C9-substrate: | 0.576 |
CYP2D6-inhibitor: | 0.03 | CYP2D6-substrate: | 0.143 |
CYP3A4-inhibitor: | 0.351 | CYP3A4-substrate: | 0.449 |
Clearance (CL): | 9.908 | Half-life (T1/2): | 0.122 |
hERG Blockers: | 0.026 | Human Hepatotoxicity (H-HT): | 0.19 |
Drug-inuced Liver Injury (DILI): | 0.72 | AMES Toxicity: | 0.008 |
Rat Oral Acute Toxicity: | 0.04 | Maximum Recommended Daily Dose: | 0.023 |
Skin Sensitization: | 0.05 | Carcinogencity: | 0.128 |
Eye Corrosion: | 0.071 | Eye Irritation: | 0.533 |
Respiratory Toxicity: | 0.022 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC000339 | ![]() |
1.000 | D04CSZ | ![]() |
0.273 | ||
ENC000800 | ![]() |
0.464 | D0P1FO | ![]() |
0.235 | ||
ENC000762 | ![]() |
0.458 | D0O1UZ | ![]() |
0.224 | ||
ENC002224 | ![]() |
0.439 | D04ATM | ![]() |
0.222 | ||
ENC003087 | ![]() |
0.439 | D09PJX | ![]() |
0.207 | ||
ENC002374 | ![]() |
0.414 | D0F2AK | ![]() |
0.200 | ||
ENC002017 | ![]() |
0.400 | D04GJN | ![]() |
0.198 | ||
ENC001817 | ![]() |
0.367 | D0WO8W | ![]() |
0.197 | ||
ENC002652 | ![]() |
0.344 | D01CKY | ![]() |
0.196 | ||
ENC001739 | ![]() |
0.344 | D0K5WS | ![]() |
0.190 |