|
Name |
2,3-Butanediol
|
| Molecular Formula | C4H10O2 | |
| IUPAC Name* |
butane-2,3-diol
|
|
| SMILES |
CC(C(C)O)O
|
|
| InChI |
InChI=1S/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3
|
|
| InChIKey |
OWBTYPJTUOEWEK-UHFFFAOYSA-N
|
|
| Synonyms |
2,3-butanediol; 513-85-9; Butane-2,3-diol; 2,3-butylene glycol; 2,3-Dihydroxybutane; Dimethylethylene glycol; Dimethylene glycol; Pseudobutylene glycol; Sym-dimethylethylene glycol; MFCD00004523; 123513-85-9; CHEBI:62064; DL-2,3-Butanediol; 2,3-Butanediol, (R*,R*)-(.+/-.)-; 2,3-butanodiol; 34439-75-3; CCRIS 5501; HSDB 1505; EINECS 208-173-6; BRN 0969165; UNII-45427ZB5IJ; MFCD00063648; MFCD00064267; NSC-249246; 2.3-butanediol; (2S,3S)-(+)2,3-Butanediol; 2,3- butanediol; 2,3-butane diol; butane 2,3-diol; 2,3-Butandiol; a 2,3-butanediol; 2d-Pharmalyte(9ci); a butane-2,3-diol; dimethyl ethyleneglycol; 2,3-dihydroxy butane; 2,3-dihydroxy-butane; D-2,3-Butane diol; dimethyl ethylene glycol; levo-butane-2,3-diol; a 2,3-butylene glycol; 2,3-Butanediol (DL); 2,3-Butanediol, 98%; DL-2,3-BUTANDIOL; EC 208-173-6; DSSTox_CID_21321; DSSTox_RID_79687; DSSTox_GSID_41321; 4-01-00-02524 (Beilstein Handbook Reference); 2D-PHARMALYTE (9CI); CHEMBL2312529; DTXSID8041321; 45427ZB5IJ; (2R,3R)-(-)2,3-Butanediol; Tox21_300789; NSC249246; AKOS009031391; SB44226; SB44692; NCGC00248169-01; NCGC00254693-01; CAS-513-85-9; SY047189; SY057405; DB-027533; HY-128387; B0681; CS-0099502; FT-0604653; FT-0605350; FT-0656644; FT-0696715; FT-0720882; S6040; EN300-19321; F14836; 2,3-Butanediol, Vetec(TM) reagent grade, 98%; Q209157; ( inverted exclamation markA)-2,3-Butanediol, 98%; METHYL5-ACETYL-3-ETHYLISOXAZOLE-4-CARBOXYLATE; F0001-1337; Z104473532; 35007-63-7
|
|
| CAS | 513-85-9 | |
| PubChem CID | 262 | |
| ChEMBL ID | CHEMBL2312529 |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 90.12 | ALogp: | -0.9 |
| HBD: | 2 | HBA: | 2 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 40.5 | Aromatic Rings: | 0 |
| Heavy Atoms: | 6 | QED Weighted: | 0.482 |
| Caco-2 Permeability: | -4.641 | MDCK Permeability: | 0.00127527 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.011 |
| Human Intestinal Absorption (HIA): | 0.019 | 20% Bioavailability (F20%): | 0.006 |
| 30% Bioavailability (F30%): | 0.02 |
| Blood-Brain-Barrier Penetration (BBB): | 0.386 | Plasma Protein Binding (PPB): | 9.92% |
| Volume Distribution (VD): | 1.024 | Fu: | 80.34% |
| CYP1A2-inhibitor: | 0.038 | CYP1A2-substrate: | 0.491 |
| CYP2C19-inhibitor: | 0.018 | CYP2C19-substrate: | 0.758 |
| CYP2C9-inhibitor: | 0.005 | CYP2C9-substrate: | 0.581 |
| CYP2D6-inhibitor: | 0.004 | CYP2D6-substrate: | 0.434 |
| CYP3A4-inhibitor: | 0.003 | CYP3A4-substrate: | 0.186 |
| Clearance (CL): | 5.467 | Half-life (T1/2): | 0.784 |
| hERG Blockers: | 0.024 | Human Hepatotoxicity (H-HT): | 0.045 |
| Drug-inuced Liver Injury (DILI): | 0.13 | AMES Toxicity: | 0.025 |
| Rat Oral Acute Toxicity: | 0.026 | Maximum Recommended Daily Dose: | 0.023 |
| Skin Sensitization: | 0.055 | Carcinogencity: | 0.027 |
| Eye Corrosion: | 0.012 | Eye Irritation: | 0.881 |
| Respiratory Toxicity: | 0.019 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC001011 | ![]() |
1.000 | D08QGD | ![]() |
0.286 | ||
| ENC000874 | ![]() |
0.500 | D00ZOF | ![]() |
0.227 | ||
| ENC000824 | ![]() |
0.391 | D02OAV | ![]() |
0.217 | ||
| ENC000147 | ![]() |
0.333 | D00WUF | ![]() |
0.206 | ||
| ENC000057 | ![]() |
0.333 | D0I8FI | ![]() |
0.205 | ||
| ENC004318 | ![]() |
0.333 | D02UFG | ![]() |
0.205 | ||
| ENC000814 | ![]() |
0.333 | D04EYC | ![]() |
0.184 | ||
| ENC000010 | ![]() |
0.300 | D08HUC | ![]() |
0.184 | ||
| ENC000037 | ![]() |
0.300 | D09PUL | ![]() |
0.182 | ||
| ENC000149 | ![]() |
0.300 | D0Q9YT | ![]() |
0.180 | ||