![]() |
Name |
xanthoquinodin B9
|
Molecular Formula | C31H24O11 | |
IUPAC Name* |
methyl5,7,12,20,22-pentahydroxy-24-methyl-9,18,27-trioxo-14-oxaheptacyclo[15.10.2.01,19.03,16.06,15.08,13.021,26]nonacosa-3,5,7,15,19,21(26),22,24,28-nonaene-13-carboxylate
|
|
SMILES |
COC(=O)C12Oc3c(c(O)cc4c3C3C=CC5(C4)C(=O)c4cc(C)cc(O)c4C(O)=C5C3=O)C(O)=C1C(=O)CCC2O
|
|
InChI |
InChI=1S/C31H24O11/c1-11-7-14-20(16(33)8-11)25(37)23-24(36)13-5-6-30(23,28(14)39)10-12-9-17(34)21-26(38)22-15(32)3-4-18(35)31(22,29(40)41-2)42-27(21)19(12)13/h5-9,13,18,33-35,37-38H,3-4,10H2,1-2H3/t13-,18-,30-,31+/m0/s1
|
|
InChIKey |
HVHUQDDJNAABOF-INRCXLCWSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 572.52 | ALogp: | 2.6 |
HBD: | 5 | HBA: | 11 |
Rotatable Bonds: | 1 | Lipinski's rule of five: | Rejected |
Polar Surface Area: | 187.9 | Aromatic Rings: | 8 |
Heavy Atoms: | 42 | QED Weighted: | 0.249 |
Caco-2 Permeability: | -5.659 | MDCK Permeability: | 0.00001450 |
Pgp-inhibitor: | 0.28 | Pgp-substrate: | 0.603 |
Human Intestinal Absorption (HIA): | 0.835 | 20% Bioavailability (F20%): | 0.977 |
30% Bioavailability (F30%): | 0.916 |
Blood-Brain-Barrier Penetration (BBB): | 0.007 | Plasma Protein Binding (PPB): | 90.95% |
Volume Distribution (VD): | 0.505 | Fu: | 3.22% |
CYP1A2-inhibitor: | 0.08 | CYP1A2-substrate: | 0.757 |
CYP2C19-inhibitor: | 0.04 | CYP2C19-substrate: | 0.065 |
CYP2C9-inhibitor: | 0.198 | CYP2C9-substrate: | 0.246 |
CYP2D6-inhibitor: | 0.175 | CYP2D6-substrate: | 0.155 |
CYP3A4-inhibitor: | 0.803 | CYP3A4-substrate: | 0.226 |
Clearance (CL): | 0.821 | Half-life (T1/2): | 0.015 |
hERG Blockers: | 0.053 | Human Hepatotoxicity (H-HT): | 0.207 |
Drug-inuced Liver Injury (DILI): | 0.92 | AMES Toxicity: | 0.219 |
Rat Oral Acute Toxicity: | 0.916 | Maximum Recommended Daily Dose: | 0.912 |
Skin Sensitization: | 0.08 | Carcinogencity: | 0.046 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.004 |
Respiratory Toxicity: | 0.153 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002421 | ![]() |
0.870 | D0H1AR | ![]() |
0.259 | ||
ENC002945 | ![]() |
0.638 | D0C9XJ | ![]() |
0.256 | ||
ENC002486 | ![]() |
0.439 | D07VLY | ![]() |
0.256 | ||
ENC003816 | ![]() |
0.398 | D01XDL | ![]() |
0.253 | ||
ENC004265 | ![]() |
0.396 | D01XWG | ![]() |
0.253 | ||
ENC006116 | ![]() |
0.395 | D0R9WP | ![]() |
0.252 | ||
ENC006117 | ![]() |
0.374 | D07JHH | ![]() |
0.248 | ||
ENC003348 | ![]() |
0.371 | D07MGA | ![]() |
0.248 | ||
ENC000983 | ![]() |
0.366 | D0FX2Q | ![]() |
0.246 | ||
ENC000710 | ![]() |
0.366 | D08NQZ | ![]() |
0.244 |