![]() |
Name |
6-((3E, 5E)-5, 7-dimethyl-2-methylenenona-3, 5-dienyl)-2, 4-dihydroxy-3-methylbenza-ldehyde
|
Molecular Formula | C19H24O4 | |
IUPAC Name* |
6-(5,7-dimethyl-2-oxonona-3,5-dienyl)-2,4-dihydroxy-3-methylbenzaldehyde
|
|
SMILES |
CCC(C)C=C(C)C=CC(=O)Cc1cc(O)c(C)c(O)c1C=O
|
|
InChI |
InChI=1S/C19H24O4/c1-5-12(2)8-13(3)6-7-16(21)9-15-10-18(22)14(4)19(23)17(15)11-20/h6-8,10-12,22-23H,5,9H2,1-4H3/b7-6+,13-8+/t12-/m0/s1
|
|
InChIKey |
SRUILBLGVMJFPG-YDROHTJRSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 316.4 | ALogp: | 3.9 |
HBD: | 2 | HBA: | 4 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 74.6 | Aromatic Rings: | 1 |
Heavy Atoms: | 23 | QED Weighted: | 0.44 |
Caco-2 Permeability: | -4.97 | MDCK Permeability: | 0.00001660 |
Pgp-inhibitor: | 0.294 | Pgp-substrate: | 0.324 |
Human Intestinal Absorption (HIA): | 0.025 | 20% Bioavailability (F20%): | 0.784 |
30% Bioavailability (F30%): | 0.011 |
Blood-Brain-Barrier Penetration (BBB): | 0.446 | Plasma Protein Binding (PPB): | 95.14% |
Volume Distribution (VD): | 0.924 | Fu: | 2.38% |
CYP1A2-inhibitor: | 0.777 | CYP1A2-substrate: | 0.825 |
CYP2C19-inhibitor: | 0.553 | CYP2C19-substrate: | 0.365 |
CYP2C9-inhibitor: | 0.772 | CYP2C9-substrate: | 0.906 |
CYP2D6-inhibitor: | 0.644 | CYP2D6-substrate: | 0.711 |
CYP3A4-inhibitor: | 0.445 | CYP3A4-substrate: | 0.307 |
Clearance (CL): | 5.712 | Half-life (T1/2): | 0.938 |
hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.201 |
Drug-inuced Liver Injury (DILI): | 0.209 | AMES Toxicity: | 0.069 |
Rat Oral Acute Toxicity: | 0.039 | Maximum Recommended Daily Dose: | 0.919 |
Skin Sensitization: | 0.886 | Carcinogencity: | 0.13 |
Eye Corrosion: | 0.224 | Eye Irritation: | 0.854 |
Respiratory Toxicity: | 0.933 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005422 | ![]() |
0.493 | D05QDC | ![]() |
0.276 | ||
ENC005368 | ![]() |
0.486 | D0B1IP | ![]() |
0.272 | ||
ENC004938 | ![]() |
0.463 | D06JGH | ![]() |
0.256 | ||
ENC004249 | ![]() |
0.411 | D0J1VY | ![]() |
0.240 | ||
ENC001359 | ![]() |
0.394 | D0L5FY | ![]() |
0.227 | ||
ENC003533 | ![]() |
0.387 | D0WY9N | ![]() |
0.221 | ||
ENC004248 | ![]() |
0.387 | D08HUC | ![]() |
0.205 | ||
ENC004428 | ![]() |
0.383 | D0P5CD | ![]() |
0.204 | ||
ENC004250 | ![]() |
0.380 | D0I5HV | ![]() |
0.204 | ||
ENC005367 | ![]() |
0.361 | D0O1UZ | ![]() |
0.204 |