![]() |
Name |
Myrothin F
|
Molecular Formula | C12H18O2 | |
IUPAC Name* |
4-ethenyldeca-3,5,7-triene-2,9-diol
|
|
SMILES |
C=CC(C=CC=CC(C)O)=CC(C)O
|
|
InChI |
InChI=1S/C12H18O2/c1-4-12(9-11(3)14)8-6-5-7-10(2)13/h4-11,13-14H,1H2,2-3H3/b7-5+,8-6+,12-9+/t10-,11+/m1/s1
|
|
InChIKey |
NCRBITVCMZMGLH-UWJPKYITSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 194.27 | ALogp: | 2.0 |
HBD: | 2 | HBA: | 2 |
Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 40.5 | Aromatic Rings: | 0 |
Heavy Atoms: | 14 | QED Weighted: | 0.66 |
Caco-2 Permeability: | -4.792 | MDCK Permeability: | 0.00002400 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.125 |
Human Intestinal Absorption (HIA): | 0.23 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.12 |
Blood-Brain-Barrier Penetration (BBB): | 0.833 | Plasma Protein Binding (PPB): | 74.72% |
Volume Distribution (VD): | 1.274 | Fu: | 32.44% |
CYP1A2-inhibitor: | 0.052 | CYP1A2-substrate: | 0.078 |
CYP2C19-inhibitor: | 0.022 | CYP2C19-substrate: | 0.823 |
CYP2C9-inhibitor: | 0.015 | CYP2C9-substrate: | 0.571 |
CYP2D6-inhibitor: | 0.003 | CYP2D6-substrate: | 0.468 |
CYP3A4-inhibitor: | 0.018 | CYP3A4-substrate: | 0.265 |
Clearance (CL): | 5.57 | Half-life (T1/2): | 0.848 |
hERG Blockers: | 0.035 | Human Hepatotoxicity (H-HT): | 0.863 |
Drug-inuced Liver Injury (DILI): | 0.032 | AMES Toxicity: | 0.93 |
Rat Oral Acute Toxicity: | 0.877 | Maximum Recommended Daily Dose: | 0.95 |
Skin Sensitization: | 0.965 | Carcinogencity: | 0.609 |
Eye Corrosion: | 0.014 | Eye Irritation: | 0.732 |
Respiratory Toxicity: | 0.961 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005839 | ![]() |
0.451 | D08QGD | ![]() |
0.159 | ||
ENC005823 | ![]() |
0.370 | D0N3NO | ![]() |
0.156 | ||
ENC005534 | ![]() |
0.370 | D0S7WX | ![]() |
0.146 | ||
ENC005822 | ![]() |
0.370 | D0G3PI | ![]() |
0.143 | ||
ENC004318 | ![]() |
0.333 | D00DKK | ![]() |
0.143 | ||
ENC002791 | ![]() |
0.323 | D02DGU | ![]() |
0.143 | ||
ENC005837 | ![]() |
0.321 | D0H6VY | ![]() |
0.141 | ||
ENC005835 | ![]() |
0.321 | D00WUF | ![]() |
0.140 | ||
ENC005818 | ![]() |
0.321 | D0X2MB | ![]() |
0.139 | ||
ENC005819 | ![]() |
0.321 | D05ZTH | ![]() |
0.135 |