![]() |
Name |
Diaportheolide A
|
Molecular Formula | C14H24O5 | |
IUPAC Name* |
3,4,7-trihydroxy-2-pentyl-2,3,4,7,8,9-hexahydrooxecin-10-one
|
|
SMILES |
CCCCCC1OC(=O)CCC(O)C=CC(O)C1O
|
|
InChI |
InChI=1S/C14H24O5/c1-2-3-4-5-12-14(18)11(16)8-6-10(15)7-9-13(17)19-12/h6,8,10-12,14-16,18H,2-5,7,9H2,1H3/b8-6+/t10-,11+,12-,14+/m1/s1
|
|
InChIKey |
GCUVQXPQQSSMDW-XGXGCATBSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 272.34 | ALogp: | 0.9 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 87.0 | Aromatic Rings: | 1 |
Heavy Atoms: | 19 | QED Weighted: | 0.408 |
Caco-2 Permeability: | -4.789 | MDCK Permeability: | 0.00041243 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.156 |
Human Intestinal Absorption (HIA): | 0.897 | 20% Bioavailability (F20%): | 0.008 |
30% Bioavailability (F30%): | 0.968 |
Blood-Brain-Barrier Penetration (BBB): | 0.433 | Plasma Protein Binding (PPB): | 55.71% |
Volume Distribution (VD): | 1.233 | Fu: | 36.25% |
CYP1A2-inhibitor: | 0.031 | CYP1A2-substrate: | 0.102 |
CYP2C19-inhibitor: | 0.013 | CYP2C19-substrate: | 0.123 |
CYP2C9-inhibitor: | 0.004 | CYP2C9-substrate: | 0.957 |
CYP2D6-inhibitor: | 0.008 | CYP2D6-substrate: | 0.153 |
CYP3A4-inhibitor: | 0.037 | CYP3A4-substrate: | 0.115 |
Clearance (CL): | 6.555 | Half-life (T1/2): | 0.818 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.031 |
Drug-inuced Liver Injury (DILI): | 0.08 | AMES Toxicity: | 0.027 |
Rat Oral Acute Toxicity: | 0.051 | Maximum Recommended Daily Dose: | 0.035 |
Skin Sensitization: | 0.107 | Carcinogencity: | 0.088 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.017 |
Respiratory Toxicity: | 0.046 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005834 | ![]() |
0.769 | D0HR8Z | ![]() |
0.296 | ||
ENC005831 | ![]() |
0.459 | D00HCQ | ![]() |
0.263 | ||
ENC003186 | ![]() |
0.432 | D0XN8C | ![]() |
0.261 | ||
ENC006036 | ![]() |
0.432 | D0V0IX | ![]() |
0.258 | ||
ENC000899 | ![]() |
0.397 | D01WUA | ![]() |
0.248 | ||
ENC003241 | ![]() |
0.391 | D0I4DQ | ![]() |
0.247 | ||
ENC005599 | ![]() |
0.346 | D0O1UZ | ![]() |
0.237 | ||
ENC002066 | ![]() |
0.342 | D0L7AS | ![]() |
0.235 | ||
ENC003134 | ![]() |
0.341 | D00CTS | ![]() |
0.235 | ||
ENC002090 | ![]() |
0.341 | D0P1FO | ![]() |
0.234 |