![]() |
Name |
Phomoparagin B
|
Molecular Formula | C30H39NO5 | |
IUPAC Name* |
(15-benzyl-3,10-dihydroxy-5,7,12-trimethyl-11-methylidene-17-oxo-16-azatetracyclo[7.8.0.01,14.03,9]heptadec-4-en-18-yl)acetate
|
|
SMILES |
C=C1C(C)C2C(Cc3ccccc3)NC(=O)C23C(OC(C)=O)C2C=C(C)CC(C)CC(O)C2C3C1O
|
|
InChI |
InChI=1S/C30H39NO5/c1-15-11-16(2)13-23(33)24-21(12-15)28(36-19(5)32)30-25(17(3)18(4)27(34)26(24)30)22(31-29(30)35)14-20-9-7-6-8-10-20/h6-10,12,16-17,21-28,33-34H,4,11,13-14H2,1-3,5H3,(H,31,35)/b15-12-/t16-,17-,21+,22+,23-,24-,25+,26+,27-,28-,30-/m1/s1
|
|
InChIKey |
XBTAAHRUEOXMHK-VMJJFKNVSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 493.64 | ALogp: | 3.4 |
HBD: | 3 | HBA: | 5 |
Rotatable Bonds: | 3 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 95.9 | Aromatic Rings: | 5 |
Heavy Atoms: | 36 | QED Weighted: | 0.434 |
Caco-2 Permeability: | -4.98 | MDCK Permeability: | 0.00006600 |
Pgp-inhibitor: | 0.006 | Pgp-substrate: | 0.026 |
Human Intestinal Absorption (HIA): | 0.534 | 20% Bioavailability (F20%): | 0.018 |
30% Bioavailability (F30%): | 0.007 |
Blood-Brain-Barrier Penetration (BBB): | 0.538 | Plasma Protein Binding (PPB): | 80.61% |
Volume Distribution (VD): | 1.283 | Fu: | 9.93% |
CYP1A2-inhibitor: | 0.025 | CYP1A2-substrate: | 0.09 |
CYP2C19-inhibitor: | 0.054 | CYP2C19-substrate: | 0.234 |
CYP2C9-inhibitor: | 0.066 | CYP2C9-substrate: | 0.205 |
CYP2D6-inhibitor: | 0.014 | CYP2D6-substrate: | 0.125 |
CYP3A4-inhibitor: | 0.614 | CYP3A4-substrate: | 0.538 |
Clearance (CL): | 5.243 | Half-life (T1/2): | 0.018 |
hERG Blockers: | 0.011 | Human Hepatotoxicity (H-HT): | 0.614 |
Drug-inuced Liver Injury (DILI): | 0.849 | AMES Toxicity: | 0.038 |
Rat Oral Acute Toxicity: | 0.988 | Maximum Recommended Daily Dose: | 0.906 |
Skin Sensitization: | 0.023 | Carcinogencity: | 0.04 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.006 |
Respiratory Toxicity: | 0.952 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003937 | ![]() |
0.810 | D05VQI | ![]() |
0.252 | ||
ENC005760 | ![]() |
0.621 | D0TB8C | ![]() |
0.248 | ||
ENC004745 | ![]() |
0.610 | D06VFO | ![]() |
0.248 | ||
ENC006060 | ![]() |
0.602 | D06CWH | ![]() |
0.245 | ||
ENC003763 | ![]() |
0.574 | D0IN7I | ![]() |
0.241 | ||
ENC005175 | ![]() |
0.574 | D0SP3D | ![]() |
0.241 | ||
ENC005506 | ![]() |
0.574 | D09NNH | ![]() |
0.240 | ||
ENC006059 | ![]() |
0.568 | D0V3ZA | ![]() |
0.240 | ||
ENC004341 | ![]() |
0.568 | D0R1BD | ![]() |
0.237 | ||
ENC004468 | ![]() |
0.559 | D01TSI | ![]() |
0.233 |