|
Name |
paecilin N
|
| Molecular Formula | C33H34O15 | |
| IUPAC Name* |
methyl5-hydroxy-6-[5-hydroxy-2-methoxycarbonyl-2-(1-hydroxy-4-methoxy-2-methyl-4-oxobutyl)-4-oxo-3H-chromen-6-yl]-2-(3-methyl-5-oxooxolan-2-yl)-4-oxo-3H-chromene-2-carboxylate
|
|
| SMILES |
COC(=O)CC(C)C(O)C1(C(=O)OC)CC(=O)c2c(ccc(-c3ccc4c(c3O)C(=O)CC(C(=O)OC)(C3OC(=O)CC3C)O4)c2O)O1
|
|
| InChI |
InChI=1S/C33H34O15/c1-14(10-22(36)43-3)28(40)32(30(41)44-4)12-18(34)24-20(47-32)8-6-16(26(24)38)17-7-9-21-25(27(17)39)19(35)13-33(48-21,31(42)45-5)29-15(2)11-23(37)46-29/h6-9,14-15,28-29,38-40H,10-13H2,1-5H3/t14-,15-,28+,29+,32-,33-/m0/s1
|
|
| InChIKey |
CDRXXQLYSTVHDM-MMJMNZOWSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 670.62 | ALogp: | 2.0 |
| HBD: | 3 | HBA: | 15 |
| Rotatable Bonds: | 8 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 218.5 | Aromatic Rings: | 5 |
| Heavy Atoms: | 48 | QED Weighted: | 0.272 |
| Caco-2 Permeability: | -5.299 | MDCK Permeability: | 0.00002440 |
| Pgp-inhibitor: | 0.566 | Pgp-substrate: | 0.05 |
| Human Intestinal Absorption (HIA): | 0.896 | 20% Bioavailability (F20%): | 0.008 |
| 30% Bioavailability (F30%): | 0.943 |
| Blood-Brain-Barrier Penetration (BBB): | 0.027 | Plasma Protein Binding (PPB): | 80.16% |
| Volume Distribution (VD): | 0.451 | Fu: | 10.25% |
| CYP1A2-inhibitor: | 0.021 | CYP1A2-substrate: | 0.574 |
| CYP2C19-inhibitor: | 0.067 | CYP2C19-substrate: | 0.127 |
| CYP2C9-inhibitor: | 0.303 | CYP2C9-substrate: | 0.609 |
| CYP2D6-inhibitor: | 0.016 | CYP2D6-substrate: | 0.19 |
| CYP3A4-inhibitor: | 0.884 | CYP3A4-substrate: | 0.607 |
| Clearance (CL): | 13.714 | Half-life (T1/2): | 0.163 |
| hERG Blockers: | 0.013 | Human Hepatotoxicity (H-HT): | 0.874 |
| Drug-inuced Liver Injury (DILI): | 0.973 | AMES Toxicity: | 0.022 |
| Rat Oral Acute Toxicity: | 0.877 | Maximum Recommended Daily Dose: | 0.022 |
| Skin Sensitization: | 0.008 | Carcinogencity: | 0.091 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.007 |
| Respiratory Toxicity: | 0.005 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005736 | ![]() |
0.920 | D0T5XN | ![]() |
0.279 | ||
| ENC005734 | ![]() |
0.904 | D07IPB | ![]() |
0.270 | ||
| ENC005727 | ![]() |
0.884 | D01XWG | ![]() |
0.259 | ||
| ENC005729 | ![]() |
0.806 | D0C9XJ | ![]() |
0.255 | ||
| ENC005732 | ![]() |
0.781 | D07VLY | ![]() |
0.255 | ||
| ENC003347 | ![]() |
0.738 | D01XDL | ![]() |
0.253 | ||
| ENC005737 | ![]() |
0.692 | D01UBX | ![]() |
0.246 | ||
| ENC005733 | ![]() |
0.684 | D0T8EH | ![]() |
0.244 | ||
| ENC003346 | ![]() |
0.671 | D0Q0PR | ![]() |
0.239 | ||
| ENC005885 | ![]() |
0.645 | D0F7CS | ![]() |
0.225 | ||