![]() |
Name |
fungerin F
|
Molecular Formula | C12H16N2O2 | |
IUPAC Name* |
3-[1-methyl-5-(3-methylbut-2-enyl)imidazol-4-yl]prop-2-enoicacid
|
|
SMILES |
CC(C)=CCc1c(C=CC(=O)O)ncn1C
|
|
InChI |
InChI=1S/C12H16N2O2/c1-9(2)4-6-11-10(5-7-12(15)16)13-8-14(11)3/h4-5,7-8H,6H2,1-3H3,(H,15,16)/b7-5+
|
|
InChIKey |
MPDMBWBAXFOITJ-FNORWQNLSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 220.27 | ALogp: | 2.0 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 55.1 | Aromatic Rings: | 1 |
Heavy Atoms: | 16 | QED Weighted: | 0.627 |
Caco-2 Permeability: | -5.001 | MDCK Permeability: | 0.00000601 |
Pgp-inhibitor: | 0 | Pgp-substrate: | 0.094 |
Human Intestinal Absorption (HIA): | 0.01 | 20% Bioavailability (F20%): | 0.003 |
30% Bioavailability (F30%): | 0.004 |
Blood-Brain-Barrier Penetration (BBB): | 0.837 | Plasma Protein Binding (PPB): | 52.36% |
Volume Distribution (VD): | 1.001 | Fu: | 59.13% |
CYP1A2-inhibitor: | 0.042 | CYP1A2-substrate: | 0.457 |
CYP2C19-inhibitor: | 0.031 | CYP2C19-substrate: | 0.151 |
CYP2C9-inhibitor: | 0.021 | CYP2C9-substrate: | 0.953 |
CYP2D6-inhibitor: | 0.014 | CYP2D6-substrate: | 0.267 |
CYP3A4-inhibitor: | 0.013 | CYP3A4-substrate: | 0.108 |
Clearance (CL): | 6.328 | Half-life (T1/2): | 0.905 |
hERG Blockers: | 0.006 | Human Hepatotoxicity (H-HT): | 0.715 |
Drug-inuced Liver Injury (DILI): | 0.631 | AMES Toxicity: | 0.012 |
Rat Oral Acute Toxicity: | 0.41 | Maximum Recommended Daily Dose: | 0.834 |
Skin Sensitization: | 0.905 | Carcinogencity: | 0.663 |
Eye Corrosion: | 0.02 | Eye Irritation: | 0.533 |
Respiratory Toxicity: | 0.954 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC001977 | ![]() |
0.745 | D0C7AA | ![]() |
0.260 | ||
ENC002176 | ![]() |
0.614 | D0V9EN | ![]() |
0.238 | ||
ENC005656 | ![]() |
0.459 | D01ZJK | ![]() |
0.233 | ||
ENC005655 | ![]() |
0.459 | D05QDC | ![]() |
0.230 | ||
ENC005653 | ![]() |
0.382 | D0O4EU | ![]() |
0.229 | ||
ENC005660 | ![]() |
0.379 | D0G3PI | ![]() |
0.229 | ||
ENC005658 | ![]() |
0.379 | D00DKK | ![]() |
0.229 | ||
ENC005651 | ![]() |
0.333 | D02DGU | ![]() |
0.229 | ||
ENC005654 | ![]() |
0.329 | D09QEI | ![]() |
0.228 | ||
ENC004987 | ![]() |
0.317 | D0B3HD | ![]() |
0.212 |