![]() |
Name |
aspergillusol
|
Molecular Formula | C14H14O4 | |
IUPAC Name* |
6-(1-hydroxy-2-phenylethyl)-4-methoxypyran-2-one
|
|
SMILES |
COc1cc(C(O)Cc2ccccc2)oc(=O)c1
|
|
InChI |
InChI=1S/C14H14O4/c1-17-11-8-13(18-14(16)9-11)12(15)7-10-5-3-2-4-6-10/h2-6,8-9,12,15H,7H2,1H3/t12-/m0/s1
|
|
InChIKey |
VIRRKTGDXDKRKV-LBPRGKRZSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 246.26 | ALogp: | 1.9 |
HBD: | 1 | HBA: | 4 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 59.7 | Aromatic Rings: | 2 |
Heavy Atoms: | 18 | QED Weighted: | 0.9 |
Caco-2 Permeability: | -4.844 | MDCK Permeability: | 0.00001700 |
Pgp-inhibitor: | 0.37 | Pgp-substrate: | 0.966 |
Human Intestinal Absorption (HIA): | 0.041 | 20% Bioavailability (F20%): | 0.983 |
30% Bioavailability (F30%): | 0.998 |
Blood-Brain-Barrier Penetration (BBB): | 0.285 | Plasma Protein Binding (PPB): | 91.20% |
Volume Distribution (VD): | 0.794 | Fu: | 4.68% |
CYP1A2-inhibitor: | 0.663 | CYP1A2-substrate: | 0.923 |
CYP2C19-inhibitor: | 0.634 | CYP2C19-substrate: | 0.243 |
CYP2C9-inhibitor: | 0.319 | CYP2C9-substrate: | 0.792 |
CYP2D6-inhibitor: | 0.037 | CYP2D6-substrate: | 0.861 |
CYP3A4-inhibitor: | 0.038 | CYP3A4-substrate: | 0.626 |
Clearance (CL): | 11.556 | Half-life (T1/2): | 0.724 |
hERG Blockers: | 0.105 | Human Hepatotoxicity (H-HT): | 0.389 |
Drug-inuced Liver Injury (DILI): | 0.357 | AMES Toxicity: | 0.042 |
Rat Oral Acute Toxicity: | 0.079 | Maximum Recommended Daily Dose: | 0.599 |
Skin Sensitization: | 0.273 | Carcinogencity: | 0.28 |
Eye Corrosion: | 0.021 | Eye Irritation: | 0.772 |
Respiratory Toxicity: | 0.055 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC006022 | ![]() |
0.508 | D0T3LF | ![]() |
0.386 | ||
ENC006023 | ![]() |
0.484 | D05BMG | ![]() |
0.386 | ||
ENC005564 | ![]() |
0.484 | D0R1CR | ![]() |
0.377 | ||
ENC005860 | ![]() |
0.469 | D0P6UB | ![]() |
0.367 | ||
ENC003693 | ![]() |
0.462 | D0H6TP | ![]() |
0.357 | ||
ENC002737 | ![]() |
0.443 | D05OIS | ![]() |
0.345 | ||
ENC001442 | ![]() |
0.442 | D0A8XN | ![]() |
0.341 | ||
ENC003336 | ![]() |
0.437 | D0I2VK | ![]() |
0.333 | ||
ENC002836 | ![]() |
0.432 | D03XYW | ![]() |
0.325 | ||
ENC005859 | ![]() |
0.424 | D0S2UG | ![]() |
0.324 |