![]() |
Name |
Sclerazaphilone B
|
Molecular Formula | C23H29NO6 | |
IUPAC Name* |
ethyl6-acetyloxy-3-(3,5-dimethylhepta-1,3-dienyl)-5-hydroxy-6-methyl-7-oxocyclopenta[c]pyridine-5-carboxylate
|
|
SMILES |
CCOC(=O)C1(O)c2cc(C=CC(C)=CC(C)CC)ncc2C(=O)C1(C)OC(C)=O
|
|
InChI |
InChI=1S/C23H29NO6/c1-7-14(3)11-15(4)9-10-17-12-19-18(13-24-17)20(26)22(6,30-16(5)25)23(19,28)21(27)29-8-2/h9-14,28H,7-8H2,1-6H3/b10-9+,15-11+/t14-,22+,23-/m0/s1
|
|
InChIKey |
QBCYFTCLVXRQDA-CBOYXNCDSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 415.49 | ALogp: | 3.4 |
HBD: | 1 | HBA: | 7 |
Rotatable Bonds: | 7 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 102.8 | Aromatic Rings: | 2 |
Heavy Atoms: | 30 | QED Weighted: | 0.528 |
Caco-2 Permeability: | -4.709 | MDCK Permeability: | 0.00002260 |
Pgp-inhibitor: | 0.997 | Pgp-substrate: | 0.002 |
Human Intestinal Absorption (HIA): | 0.008 | 20% Bioavailability (F20%): | 0.864 |
30% Bioavailability (F30%): | 0.965 |
Blood-Brain-Barrier Penetration (BBB): | 0.925 | Plasma Protein Binding (PPB): | 87.62% |
Volume Distribution (VD): | 1.404 | Fu: | 10.68% |
CYP1A2-inhibitor: | 0.672 | CYP1A2-substrate: | 0.193 |
CYP2C19-inhibitor: | 0.67 | CYP2C19-substrate: | 0.857 |
CYP2C9-inhibitor: | 0.524 | CYP2C9-substrate: | 0.05 |
CYP2D6-inhibitor: | 0.006 | CYP2D6-substrate: | 0.205 |
CYP3A4-inhibitor: | 0.581 | CYP3A4-substrate: | 0.859 |
Clearance (CL): | 2.475 | Half-life (T1/2): | 0.159 |
hERG Blockers: | 0.282 | Human Hepatotoxicity (H-HT): | 0.867 |
Drug-inuced Liver Injury (DILI): | 0.813 | AMES Toxicity: | 0.152 |
Rat Oral Acute Toxicity: | 0.061 | Maximum Recommended Daily Dose: | 0.876 |
Skin Sensitization: | 0.635 | Carcinogencity: | 0.778 |
Eye Corrosion: | 0.003 | Eye Irritation: | 0.009 |
Respiratory Toxicity: | 0.052 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC005588 | ![]() |
0.869 | D0B1IP | ![]() |
0.282 | ||
ENC005591 | ![]() |
0.727 | D05QDC | ![]() |
0.241 | ||
ENC005590 | ![]() |
0.656 | D08BDT | ![]() |
0.218 | ||
ENC003521 | ![]() |
0.567 | D0G7KJ | ![]() |
0.218 | ||
ENC006052 | ![]() |
0.434 | D0WY9N | ![]() |
0.217 | ||
ENC001841 | ![]() |
0.421 | D09IEE | ![]() |
0.214 | ||
ENC001870 | ![]() |
0.416 | D06BLQ | ![]() |
0.211 | ||
ENC002463 | ![]() |
0.412 | D0L5FY | ![]() |
0.211 | ||
ENC001871 | ![]() |
0.394 | D0VT8P | ![]() |
0.210 | ||
ENC002178 | ![]() |
0.394 | D0G3PI | ![]() |
0.209 |