|
Name |
14-Methoxytajixanthone-25-acetate
|
| Molecular Formula | C29H31HoO8 | |
| IUPAC Name* |
[1-acetyloxy-8-[1-(3,3-dimethyloxiran-2-yl)-1-methoxyethyl]-11-hydroxy-5-methyl-12-oxo-2-prop-1-en-2-yl-2,3-dihydro-1H-pyrano[3,2-a]xanthen-3-yl]holmium
|
|
| SMILES |
C=C(C)C1C([Ho])Oc2c(C)cc3oc4c(C(C)(OC)C5OC5(C)C)ccc(O)c4c(=O)c3c2C1OC(C)=O
|
|
| InChI |
InChI=1S/C29H31O8.Ho/c1-13(2)16-12-34-24-14(3)11-19-21(22(24)25(16)35-15(4)30)23(32)20-18(31)10-9-17(26(20)36-19)29(7,33-8)27-28(5,6)37-27;/h9-12,16,25,27,31H,1H2,2-8H3;/t16-,25+,27+,29+;/m0./s1
|
|
| InChIKey |
KMFAZXHWFHEGJU-WFPCKFNCSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 672.49 | ALogp: | 5.1 |
| HBD: | 1 | HBA: | 8 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 107.7 | Aromatic Rings: | 5 |
| Heavy Atoms: | 38 | QED Weighted: | 0.127 |
| Caco-2 Permeability: | -4.898 | MDCK Permeability: | 0.00001400 |
| Pgp-inhibitor: | 0.987 | Pgp-substrate: | 0.072 |
| Human Intestinal Absorption (HIA): | 0.56 | 20% Bioavailability (F20%): | 0.001 |
| 30% Bioavailability (F30%): | 0.1 |
| Blood-Brain-Barrier Penetration (BBB): | 0.036 | Plasma Protein Binding (PPB): | 83.35% |
| Volume Distribution (VD): | 1.364 | Fu: | 9.31% |
| CYP1A2-inhibitor: | 0.045 | CYP1A2-substrate: | 0.942 |
| CYP2C19-inhibitor: | 0.19 | CYP2C19-substrate: | 0.616 |
| CYP2C9-inhibitor: | 0.754 | CYP2C9-substrate: | 0.254 |
| CYP2D6-inhibitor: | 0.41 | CYP2D6-substrate: | 0.346 |
| CYP3A4-inhibitor: | 0.447 | CYP3A4-substrate: | 0.765 |
| Clearance (CL): | 1.845 | Half-life (T1/2): | 0.045 |
| hERG Blockers: | 0.004 | Human Hepatotoxicity (H-HT): | 0.954 |
| Drug-inuced Liver Injury (DILI): | 0.974 | AMES Toxicity: | 0.692 |
| Rat Oral Acute Toxicity: | 0.889 | Maximum Recommended Daily Dose: | 0.881 |
| Skin Sensitization: | 0.165 | Carcinogencity: | 0.778 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.319 |
| Respiratory Toxicity: | 0.415 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC004314 | ![]() |
0.515 | D0Q0PR | ![]() |
0.310 | ||
| ENC004145 | ![]() |
0.496 | D0FX2Q | ![]() |
0.258 | ||
| ENC002544 | ![]() |
0.496 | D0F7CS | ![]() |
0.245 | ||
| ENC002697 | ![]() |
0.450 | D04ITO | ![]() |
0.232 | ||
| ENC002341 | ![]() |
0.430 | D06GCK | ![]() |
0.232 | ||
| ENC002651 | ![]() |
0.414 | D0J5TS | ![]() |
0.225 | ||
| ENC002623 | ![]() |
0.412 | D0H0SJ | ![]() |
0.223 | ||
| ENC006093 | ![]() |
0.366 | D0Z4PE | ![]() |
0.223 | ||
| ENC002916 | ![]() |
0.366 | D0T6WT | ![]() |
0.221 | ||
| ENC004538 | ![]() |
0.331 | D0O6KE | ![]() |
0.220 | ||