![]() |
Name |
bipolenin F
|
Molecular Formula | C17H28O3 | |
IUPAC Name* |
2-[7-(hydroxymethyl)-1,5,5-trimethyl-9-bicyclo[4.2.1]non-7-enyl]ethylacetate
|
|
SMILES |
CC(=O)OCCC1C2C=C(CO)C1(C)CCCC2(C)C
|
|
InChI |
InChI=1S/C17H28O3/c1-12(19)20-9-6-14-15-10-13(11-18)17(14,4)8-5-7-16(15,2)3/h10,14-15,18H,5-9,11H2,1-4H3/t14-,15+,17-/m0/s1
|
|
InChIKey |
HNISXCAJVVWNNG-UXLLHSPISA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 280.41 | ALogp: | 3.3 |
HBD: | 1 | HBA: | 3 |
Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 46.5 | Aromatic Rings: | 2 |
Heavy Atoms: | 20 | QED Weighted: | 0.623 |
Caco-2 Permeability: | -4.533 | MDCK Permeability: | 0.00002140 |
Pgp-inhibitor: | 0.02 | Pgp-substrate: | 0 |
Human Intestinal Absorption (HIA): | 0.003 | 20% Bioavailability (F20%): | 0.019 |
30% Bioavailability (F30%): | 0.005 |
Blood-Brain-Barrier Penetration (BBB): | 0.718 | Plasma Protein Binding (PPB): | 84.07% |
Volume Distribution (VD): | 1.185 | Fu: | 23.98% |
CYP1A2-inhibitor: | 0.111 | CYP1A2-substrate: | 0.2 |
CYP2C19-inhibitor: | 0.133 | CYP2C19-substrate: | 0.872 |
CYP2C9-inhibitor: | 0.133 | CYP2C9-substrate: | 0.412 |
CYP2D6-inhibitor: | 0.016 | CYP2D6-substrate: | 0.384 |
CYP3A4-inhibitor: | 0.205 | CYP3A4-substrate: | 0.353 |
Clearance (CL): | 5.179 | Half-life (T1/2): | 0.186 |
hERG Blockers: | 0.009 | Human Hepatotoxicity (H-HT): | 0.121 |
Drug-inuced Liver Injury (DILI): | 0.218 | AMES Toxicity: | 0.369 |
Rat Oral Acute Toxicity: | 0.182 | Maximum Recommended Daily Dose: | 0.073 |
Skin Sensitization: | 0.09 | Carcinogencity: | 0.477 |
Eye Corrosion: | 0.005 | Eye Irritation: | 0.246 |
Respiratory Toxicity: | 0.854 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC003774 | ![]() |
0.770 | D0X4RS | ![]() |
0.255 | ||
ENC003754 | ![]() |
0.731 | D0Q9HF | ![]() |
0.254 | ||
ENC004836 | ![]() |
0.695 | D02CJX | ![]() |
0.252 | ||
ENC002921 | ![]() |
0.375 | D02CNR | ![]() |
0.248 | ||
ENC001350 | ![]() |
0.356 | D04GJN | ![]() |
0.245 | ||
ENC002466 | ![]() |
0.353 | D01CKY | ![]() |
0.242 | ||
ENC000830 | ![]() |
0.338 | D0I2SD | ![]() |
0.232 | ||
ENC004662 | ![]() |
0.329 | D08TEJ | ![]() |
0.229 | ||
ENC005235 | ![]() |
0.312 | D0B4RU | ![]() |
0.229 | ||
ENC002923 | ![]() |
0.312 | D00AEQ | ![]() |
0.228 |