NPs Basic Information
|
Name |
penicillidione A
|
| Molecular Formula | C18H19NO5 | |
| IUPAC Name* |
4-[(2-ethyl-5-hydroxy-3,5-dimethyl-4,6-dioxocyclohex-2-en-1-ylidene)methylamino]benzoicacid
|
|
| SMILES |
CCC1=C(C)C(=O)C(C)(O)C(=O)C1=CNc1ccc(C(=O)O)cc1
|
|
| InChI |
InChI=1S/C18H19NO5/c1-4-13-10(2)15(20)18(3,24)16(21)14(13)9-19-12-7-5-11(6-8-12)17(22)23/h5-9,19,24H,4H2,1-3H3,(H,22,23)/b14-9-/t18-/m1/s1
|
|
| InChIKey |
AAMFCJMUKKFZCK-GIIHOQTISA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 329.35 | ALogp: | 2.3 |
| HBD: | 3 | HBA: | 5 |
| Rotatable Bonds: | 4 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 103.7 | Aromatic Rings: | 2 |
| Heavy Atoms: | 24 | QED Weighted: | 0.579 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -5.169 | MDCK Permeability: | 0.00001350 |
| Pgp-inhibitor: | 0.003 | Pgp-substrate: | 0.983 |
| Human Intestinal Absorption (HIA): | 0.043 | 20% Bioavailability (F20%): | 0.866 |
| 30% Bioavailability (F30%): | 0.077 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.455 | Plasma Protein Binding (PPB): | 72.62% |
| Volume Distribution (VD): | 0.408 | Fu: | 18.83% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.029 | CYP1A2-substrate: | 0.268 |
| CYP2C19-inhibitor: | 0.03 | CYP2C19-substrate: | 0.065 |
| CYP2C9-inhibitor: | 0.039 | CYP2C9-substrate: | 0.12 |
| CYP2D6-inhibitor: | 0.009 | CYP2D6-substrate: | 0.079 |
| CYP3A4-inhibitor: | 0.162 | CYP3A4-substrate: | 0.262 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 1.321 | Half-life (T1/2): | 0.626 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.077 |
| Drug-inuced Liver Injury (DILI): | 0.987 | AMES Toxicity: | 0.416 |
| Rat Oral Acute Toxicity: | 0.876 | Maximum Recommended Daily Dose: | 0.012 |
| Skin Sensitization: | 0.194 | Carcinogencity: | 0.771 |
| Eye Corrosion: | 0.149 | Eye Irritation: | 0.132 |
| Respiratory Toxicity: | 0.982 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005260 |  |
0.618 | D0L7FM |  |
0.307 | ||
| ENC003736 |  |
0.321 | D0N0RU |  |
0.301 | ||
| ENC000007 |  |
0.319 | D0Z5IU |  |
0.279 | ||
| ENC000202 |  |
0.315 | D0E0SW |  |
0.276 | ||
| ENC005264 |  |
0.310 | D02AQY |  |
0.275 | ||
| ENC005266 |  |
0.301 | D09BHB |  |
0.275 | ||
| ENC005265 |  |
0.301 | D0L0SW |  |
0.274 | ||
| ENC002999 |  |
0.301 | D08HQK |  |
0.272 | ||
| ENC002802 |  |
0.300 | D0Y7PG |  |
0.269 | ||
| ENC006124 |  |
0.298 | D0R1RS |  |
0.267 | ||