|
Name |
(+)-asterrelenin
|
| Molecular Formula | C26H29N3O4 | |
| IUPAC Name* |
4-acetyl-3-formyl-2-hydroxy-8b-(2-methylbut-3-en-2-yl)-N-(2-methylphenyl)-1,3a-dihydropyrrolo[2,3-b]indole-2-carboxamide
|
|
| SMILES |
C=CC(C)(C)C12CC(O)(C(=O)Nc3ccccc3C)N(C=O)C1N(C(C)=O)c1ccccc12
|
|
| InChI |
InChI=1S/C26H29N3O4/c1-6-24(4,5)25-15-26(33,22(32)27-20-13-9-7-11-17(20)2)28(16-30)23(25)29(18(3)31)21-14-10-8-12-19(21)25/h6-14,16,23,33H,1,15H2,2-5H3,(H,27,32)/t23-,25-,26+/m1/s1
|
|
| InChIKey |
FZGGQDWDKLWRDW-ARMFNRFLSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 447.54 | ALogp: | 3.3 |
| HBD: | 2 | HBA: | 4 |
| Rotatable Bonds: | 5 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 90.0 | Aromatic Rings: | 4 |
| Heavy Atoms: | 33 | QED Weighted: | 0.534 |
| Caco-2 Permeability: | -4.825 | MDCK Permeability: | 0.00004030 |
| Pgp-inhibitor: | 0.872 | Pgp-substrate: | 0.024 |
| Human Intestinal Absorption (HIA): | 0.049 | 20% Bioavailability (F20%): | 0.006 |
| 30% Bioavailability (F30%): | 0.013 |
| Blood-Brain-Barrier Penetration (BBB): | 0.828 | Plasma Protein Binding (PPB): | 86.60% |
| Volume Distribution (VD): | 0.897 | Fu: | 9.31% |
| CYP1A2-inhibitor: | 0.018 | CYP1A2-substrate: | 0.106 |
| CYP2C19-inhibitor: | 0.785 | CYP2C19-substrate: | 0.915 |
| CYP2C9-inhibitor: | 0.921 | CYP2C9-substrate: | 0.757 |
| CYP2D6-inhibitor: | 0.54 | CYP2D6-substrate: | 0.146 |
| CYP3A4-inhibitor: | 0.945 | CYP3A4-substrate: | 0.957 |
| Clearance (CL): | 3.21 | Half-life (T1/2): | 0.237 |
| hERG Blockers: | 0.001 | Human Hepatotoxicity (H-HT): | 0.095 |
| Drug-inuced Liver Injury (DILI): | 0.955 | AMES Toxicity: | 0.015 |
| Rat Oral Acute Toxicity: | 0.72 | Maximum Recommended Daily Dose: | 0.048 |
| Skin Sensitization: | 0.56 | Carcinogencity: | 0.041 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.016 |
| Respiratory Toxicity: | 0.267 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003221 | ![]() |
0.517 | D0F4NS | ![]() |
0.312 | ||
| ENC003246 | ![]() |
0.517 | D02NEH | ![]() |
0.304 | ||
| ENC006112 | ![]() |
0.442 | D04QZD | ![]() |
0.297 | ||
| ENC002594 | ![]() |
0.363 | D05FTJ | ![]() |
0.296 | ||
| ENC004497 | ![]() |
0.361 | D0QL3P | ![]() |
0.286 | ||
| ENC004262 | ![]() |
0.336 | D0U3EC | ![]() |
0.281 | ||
| ENC004263 | ![]() |
0.333 | D0Y0JH | ![]() |
0.277 | ||
| ENC001985 | ![]() |
0.326 | D0E6OC | ![]() |
0.276 | ||
| ENC004493 | ![]() |
0.318 | D0K4CQ | ![]() |
0.270 | ||
| ENC003916 | ![]() |
0.311 | D04MSM | ![]() |
0.268 | ||