NPs Basic Information
|
Name |
7β-hydroxy-3-epigitoxigenin
|
| Molecular Formula | C23H34O6 | |
| IUPAC Name* |
3-(3,7,14,16-tetrahydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl)-2H-furan-5-one
|
|
| SMILES |
CC12CCC(O)CC1CC(O)C1C2CCC2(C)C(C3=CC(=O)OC3)C(O)CC12O
|
|
| InChI |
InChI=1S/C23H34O6/c1-21-5-3-14(24)8-13(21)9-16(25)20-15(21)4-6-22(2)19(12-7-18(27)29-11-12)17(26)10-23(20,22)28/h7,13-17,19-20,24-26,28H,3-6,8-11H2,1-2H3/t13-,14+,15-,16-,17-,19-,20-,21-,22+,23-/m0/s1
|
|
| InChIKey |
UHWSUZAFPMXQNI-LIRDTKSUSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
*Note: the IUPAC Name was calculated by STOUT. Reference: PMID:33906675.
Chemical Classification: |
|
|
|---|
——————————————————————————————————————————
NPs Species Source
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
NPs Biological Activity
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
NPs Physi-Chem Properties
| Molecular Weight: | 406.52 | ALogp: | 1.5 |
| HBD: | 4 | HBA: | 6 |
| Rotatable Bonds: | 1 | Lipinski's rule of five: | Accepted |
| Polar Surface Area: | 107.2 | Aromatic Rings: | 5 |
| Heavy Atoms: | 29 | QED Weighted: | 0.497 |
——————————————————————————————————————————
NPs ADMET Properties*
ADMET: Absorption
| Caco-2 Permeability: | -5.232 | MDCK Permeability: | 0.00004950 |
| Pgp-inhibitor: | 0 | Pgp-substrate: | 0.099 |
| Human Intestinal Absorption (HIA): | 0.866 | 20% Bioavailability (F20%): | 0.972 |
| 30% Bioavailability (F30%): | 0.892 |
——————————————————————————————————————————
ADMET: Distribution
| Blood-Brain-Barrier Penetration (BBB): | 0.881 | Plasma Protein Binding (PPB): | 88.50% |
| Volume Distribution (VD): | 2.603 | Fu: | 18.11% |
——————————————————————————————————————————
ADMET: Metabolism
| CYP1A2-inhibitor: | 0.01 | CYP1A2-substrate: | 0.685 |
| CYP2C19-inhibitor: | 0.007 | CYP2C19-substrate: | 0.58 |
| CYP2C9-inhibitor: | 0.064 | CYP2C9-substrate: | 0.813 |
| CYP2D6-inhibitor: | 0.002 | CYP2D6-substrate: | 0.25 |
| CYP3A4-inhibitor: | 0.067 | CYP3A4-substrate: | 0.161 |
——————————————————————————————————————————
ADMET: Excretion
| Clearance (CL): | 17.936 | Half-life (T1/2): | 0.169 |
——————————————————————————————————————————
ADMET: Toxicity
| hERG Blockers: | 0.049 | Human Hepatotoxicity (H-HT): | 0.294 |
| Drug-inuced Liver Injury (DILI): | 0.014 | AMES Toxicity: | 0.018 |
| Rat Oral Acute Toxicity: | 0.97 | Maximum Recommended Daily Dose: | 0.852 |
| Skin Sensitization: | 0.187 | Carcinogencity: | 0.078 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.008 |
| Respiratory Toxicity: | 0.809 |
——————————————————————————————————————————
*Note: the ADMET properties was calculated by ADMETlab 2.0. Reference: PMID: 33893803.
Similar Compounds*
Compounds similar to EMNPD with top10 similarity:
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC005140 |  |
0.758 | D04RYU |  |
0.444 | ||
| ENC005144 |  |
0.756 | D0G3SH |  |
0.414 | ||
| ENC005147 |  |
0.702 | D03ZTE |  |
0.414 | ||
| ENC005142 |  |
0.636 | D0AR3J |  |
0.412 | ||
| ENC005143 |  |
0.604 | D0M2QH |  |
0.403 | ||
| ENC005141 |  |
0.596 | D0OR2L |  |
0.395 | ||
| ENC005146 |  |
0.553 | D0M3QP |  |
0.367 | ||
| ENC002216 |  |
0.444 | D00VZZ |  |
0.358 | ||
| ENC000609 |  |
0.414 | D0V3GA |  |
0.350 | ||
| ENC001007 |  |
0.395 | D0KR5B |  |
0.348 | ||