|
Name |
phomopchalasin C7
|
| Molecular Formula | C30H41NO6 | |
| IUPAC Name* |
(16-benzyl-2,5,14-trihydroxy-5,7,14,15-tetramethyl-18-oxo-17-azatricyclo[10.7.0.01,15]nonadeca-3,9-dien-13-yl)acetate
|
|
| SMILES |
CC(=O)OC1C2C=CCC(C)CC(C)(O)C=CC(O)C23C(=O)NC(Cc2ccccc2)C3C(C)C1(C)O
|
|
| InChI |
InChI=1S/C30H41NO6/c1-18-10-9-13-22-26(37-20(3)32)29(5,36)19(2)25-23(16-21-11-7-6-8-12-21)31-27(34)30(22,25)24(33)14-15-28(4,35)17-18/h6-9,11-15,18-19,22-26,33,35-36H,10,16-17H2,1-5H3,(H,31,34)/b13-9+,15-14+/t18-,19-,22-,23-,24+,25-,26-,28-,29-,30+/m0/s1
|
|
| InChIKey |
VFHHCEJSZPPFQU-WRERFMELSA-N
|
|
| Synonyms |
NA
|
|
| CAS | NA | |
| PubChem CID | NA | |
| ChEMBL ID | NA |
Chemical Classification: |
|
|
|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
|---|---|---|---|---|---|---|---|---|
| Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
| Molecular Weight: | 511.66 | ALogp: | 2.9 |
| HBD: | 4 | HBA: | 6 |
| Rotatable Bonds: | 3 | Lipinski's rule of five: | Rejected |
| Polar Surface Area: | 116.1 | Aromatic Rings: | 4 |
| Heavy Atoms: | 37 | QED Weighted: | 0.363 |
| Caco-2 Permeability: | -4.951 | MDCK Permeability: | 0.00011575 |
| Pgp-inhibitor: | 0.367 | Pgp-substrate: | 0.016 |
| Human Intestinal Absorption (HIA): | 0.204 | 20% Bioavailability (F20%): | 0.005 |
| 30% Bioavailability (F30%): | 0.005 |
| Blood-Brain-Barrier Penetration (BBB): | 0.92 | Plasma Protein Binding (PPB): | 80.33% |
| Volume Distribution (VD): | 1.64 | Fu: | 25.29% |
| CYP1A2-inhibitor: | 0.015 | CYP1A2-substrate: | 0.125 |
| CYP2C19-inhibitor: | 0.068 | CYP2C19-substrate: | 0.673 |
| CYP2C9-inhibitor: | 0.128 | CYP2C9-substrate: | 0.535 |
| CYP2D6-inhibitor: | 0.018 | CYP2D6-substrate: | 0.109 |
| CYP3A4-inhibitor: | 0.856 | CYP3A4-substrate: | 0.535 |
| Clearance (CL): | 3.633 | Half-life (T1/2): | 0.049 |
| hERG Blockers: | 0.018 | Human Hepatotoxicity (H-HT): | 0.079 |
| Drug-inuced Liver Injury (DILI): | 0.15 | AMES Toxicity: | 0.018 |
| Rat Oral Acute Toxicity: | 0.774 | Maximum Recommended Daily Dose: | 0.486 |
| Skin Sensitization: | 0.03 | Carcinogencity: | 0.041 |
| Eye Corrosion: | 0.003 | Eye Irritation: | 0.005 |
| Respiratory Toxicity: | 0.121 |
| Similar NPs | Similar Drugs | ||||||
|---|---|---|---|---|---|---|---|
| NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
| ENC003653 | ![]() |
0.836 | D06CWH | ![]() |
0.290 | ||
| ENC002261 | ![]() |
0.836 | D05VQI | ![]() |
0.268 | ||
| ENC003170 | ![]() |
0.813 | D0O5WP | ![]() |
0.259 | ||
| ENC002762 | ![]() |
0.748 | D0F1EX | ![]() |
0.257 | ||
| ENC005131 | ![]() |
0.732 | D03IKT | ![]() |
0.257 | ||
| ENC004468 | ![]() |
0.709 | D0E9KA | ![]() |
0.253 | ||
| ENC004243 | ![]() |
0.699 | D0R1BD | ![]() |
0.252 | ||
| ENC005132 | ![]() |
0.670 | D08PIQ | ![]() |
0.252 | ||
| ENC002763 | ![]() |
0.667 | D0V3ZA | ![]() |
0.251 | ||
| ENC001922 | ![]() |
0.664 | D0SP3D | ![]() |
0.251 | ||