![]() |
Name |
4-Oxo-β-isodamascol
|
Molecular Formula | C13H20O2 | |
IUPAC Name* |
3-(1-hydroxy-2-methylprop-2-enyl)-2,4,4-trimethylcyclohex-2-en-1-one
|
|
SMILES |
C=C(C)C(O)C1=C(C)C(=O)CCC1(C)C
|
|
InChI |
InChI=1S/C13H20O2/c1-8(2)12(15)11-9(3)10(14)6-7-13(11,4)5/h12,15H,1,6-7H2,2-5H3
|
|
InChIKey |
SLCFYYKEJSZUCI-UHFFFAOYSA-N
|
|
Synonyms |
NA
|
|
CAS | NA | |
PubChem CID | NA | |
ChEMBL ID | NA |
Chemical Classification: |
|
|
---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference | |
---|---|---|---|---|---|---|---|---|
Endophyte ID | Endophyte Name | Family | Genus | Taxonomy ID | GenBank ID | Closest GenBank ID | Reference |
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name | |
---|---|---|---|---|---|---|---|---|---|---|---|---|
Bioactivity Name | Target ID | Target Name | Target Type | Target Organism | Target Organism ID | Potency of Bioactivity | Activity Type | Value | Unit | Endophyte ID | Endophyte Name |
Molecular Weight: | 208.3 | ALogp: | 2.6 |
HBD: | 1 | HBA: | 2 |
Rotatable Bonds: | 2 | Lipinski's rule of five: | Accepted |
Polar Surface Area: | 37.3 | Aromatic Rings: | 1 |
Heavy Atoms: | 15 | QED Weighted: | 0.706 |
Caco-2 Permeability: | -4.435 | MDCK Permeability: | 0.00003380 |
Pgp-inhibitor: | 0.027 | Pgp-substrate: | 0.001 |
Human Intestinal Absorption (HIA): | 0.011 | 20% Bioavailability (F20%): | 0.004 |
30% Bioavailability (F30%): | 0.009 |
Blood-Brain-Barrier Penetration (BBB): | 0.944 | Plasma Protein Binding (PPB): | 86.92% |
Volume Distribution (VD): | 1.026 | Fu: | 15.77% |
CYP1A2-inhibitor: | 0.078 | CYP1A2-substrate: | 0.453 |
CYP2C19-inhibitor: | 0.105 | CYP2C19-substrate: | 0.907 |
CYP2C9-inhibitor: | 0.067 | CYP2C9-substrate: | 0.261 |
CYP2D6-inhibitor: | 0.05 | CYP2D6-substrate: | 0.312 |
CYP3A4-inhibitor: | 0.205 | CYP3A4-substrate: | 0.406 |
Clearance (CL): | 5.944 | Half-life (T1/2): | 0.408 |
hERG Blockers: | 0.016 | Human Hepatotoxicity (H-HT): | 0.256 |
Drug-inuced Liver Injury (DILI): | 0.358 | AMES Toxicity: | 0.02 |
Rat Oral Acute Toxicity: | 0.799 | Maximum Recommended Daily Dose: | 0.352 |
Skin Sensitization: | 0.267 | Carcinogencity: | 0.546 |
Eye Corrosion: | 0.46 | Eye Irritation: | 0.419 |
Respiratory Toxicity: | 0.965 |
Similar NPs | Similar Drugs | ||||||
---|---|---|---|---|---|---|---|
NPs ID | NPs 2D Structure | Similarity Score | TTD ID | Drug 2D Structure | Similarity Score | ||
ENC002195 | ![]() |
0.339 | D0H6VY | ![]() |
0.276 | ||
ENC001425 | ![]() |
0.316 | D0G3PI | ![]() |
0.244 | ||
ENC000476 | ![]() |
0.311 | D00DKK | ![]() |
0.244 | ||
ENC001738 | ![]() |
0.300 | D02DGU | ![]() |
0.244 | ||
ENC000328 | ![]() |
0.288 | D0S7WX | ![]() |
0.234 | ||
ENC002941 | ![]() |
0.288 | D04GJN | ![]() |
0.233 | ||
ENC001408 | ![]() |
0.286 | D0N0RU | ![]() |
0.227 | ||
ENC002058 | ![]() |
0.277 | D0H1QY | ![]() |
0.218 | ||
ENC002919 | ![]() |
0.269 | D04ATM | ![]() |
0.216 | ||
ENC004209 | ![]() |
0.269 | D0K7LU | ![]() |
0.208 |